diff --git a/.coveragerc b/.coveragerc index 5bf3ba6d8..efa9a2ff8 100644 --- a/.coveragerc +++ b/.coveragerc @@ -2,7 +2,8 @@ branch = True source = pymysql -omit = pymysql/test/* + tests +omit = pymysql/tests/* pymysql/tests/thirdparty/test_MySQLdb/* [report] diff --git a/.github/FUNDING.yml b/.github/FUNDING.yml new file mode 100644 index 000000000..253a13aca --- /dev/null +++ b/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: ["methane"] # Replace with up to 4 GitHub Sponsors-enabled usernames e.g., [user1, user2] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: "pypi/PyMySQL" # Replace with a single Tidelift platform-name/package-name e.g., npm/babel +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/.github/ISSUE_TEMPLATE/bug_report.md b/.github/ISSUE_TEMPLATE/bug_report.md new file mode 100644 index 000000000..f2bd4d300 --- /dev/null +++ b/.github/ISSUE_TEMPLATE/bug_report.md @@ -0,0 +1,39 @@ +--- +name: Bug report +about: Create a report to help us improve +title: '' +labels: '' +assignees: '' + +--- + +**Describe the bug** +A clear and concise description of what the bug is. + +**To Reproduce** +Complete steps to reproduce the behavior: + +Schema: + +``` +CREATE DATABASE ... +CREATE TABLE ... +``` + +Code: + +```py +import pymysql +con = pymysql.connect(...) +``` + +**Expected behavior** +A clear and concise description of what you expected to happen. + +**Environment** + - OS: [e.g. Windows, Linux] + - Server and version: [e.g. MySQL 8.0.19, MariaDB] + - PyMySQL version: + +**Additional context** +Add any other context about the problem here. diff --git a/.github/workflows/django.yaml b/.github/workflows/django.yaml new file mode 100644 index 000000000..5c4609543 --- /dev/null +++ b/.github/workflows/django.yaml @@ -0,0 +1,66 @@ +name: Django test + +on: + push: + # branches: ["main"] + # pull_request: + +jobs: + django-test: + name: "Run Django LTS test suite" + runs-on: ubuntu-latest + # There are some known difference between MySQLdb and PyMySQL. + continue-on-error: true + env: + PIP_NO_PYTHON_VERSION_WARNING: 1 + PIP_DISABLE_PIP_VERSION_CHECK: 1 + # DJANGO_VERSION: "3.2.19" + strategy: + fail-fast: false + matrix: + include: + # Django 3.2.9+ supports Python 3.10 + # https://docs.djangoproject.com/ja/3.2/releases/3.2/ + - django: "3.2.19" + python: "3.10" + + - django: "4.2.1" + python: "3.11" + + steps: + - name: Start MySQL + run: | + sudo systemctl start mysql.service + mysql_tzinfo_to_sql /usr/share/zoneinfo | mysql -uroot -proot mysql + mysql -uroot -proot -e "set global innodb_flush_log_at_trx_commit=0;" + mysql -uroot -proot -e "CREATE USER 'scott'@'%' IDENTIFIED BY 'tiger'; GRANT ALL ON *.* TO scott;" + mysql -uroot -proot -e "CREATE DATABASE django_default; CREATE DATABASE django_other;" + + - uses: actions/checkout@v4 + + - name: Set up Python + uses: actions/setup-python@v5 + with: + python-version: ${{ matrix.python }} + + - name: Install mysqlclient + run: | + #pip install mysqlclient # Use stable version + pip install .[rsa] + + - name: Setup Django + run: | + sudo apt-get install libmemcached-dev + wget https://github.com/django/django/archive/${{ matrix.django }}.tar.gz + tar xf ${{ matrix.django }}.tar.gz + cp ci/test_mysql.py django-${{ matrix.django }}/tests/ + cd django-${{ matrix.django }} + pip install . -r tests/requirements/py3.txt + + - name: Run Django test + run: | + cd django-${{ matrix.django }}/tests/ + # test_runner does not using our test_mysql.py + # We can't run whole django test suite for now. + # Run olly backends test + DJANGO_SETTINGS_MODULE=test_mysql python runtests.py backends diff --git a/.github/workflows/lint.yaml b/.github/workflows/lint.yaml new file mode 100644 index 000000000..07ea66031 --- /dev/null +++ b/.github/workflows/lint.yaml @@ -0,0 +1,24 @@ +name: Lint + +on: + push: + branches: ["main"] + paths: + - '**.py' + pull_request: + paths: + - '**.py' + +jobs: + lint: + runs-on: ubuntu-latest + steps: + - uses: actions/checkout@v4 + + - uses: astral-sh/ruff-action@v3 + + - name: format + run: ruff format --diff + + - name: lint + run: ruff check --diff diff --git a/.github/workflows/test.yaml b/.github/workflows/test.yaml new file mode 100644 index 000000000..b09b2269c --- /dev/null +++ b/.github/workflows/test.yaml @@ -0,0 +1,116 @@ +name: Test + +on: + push: + pull_request: + +concurrency: + group: ${{ github.workflow }}-${{ github.event.pull_request.number || github.sha }} + cancel-in-progress: true + +env: + FORCE_COLOR: 1 + +jobs: + test: + runs-on: ubuntu-latest + strategy: + fail-fast: false + matrix: + include: + - db: "mariadb:12" # rolling release + py: "3.13" + # pynacl 1.5 doesn't support Python 3.14 yet. + # https://github.com/pyca/pynacl/commit/d33028e43b814615a33e231925eaddb0f679fa2b + + - db: "mariadb:11.8" + py: "3.12" + + - db: "mariadb:11.4" + py: "3.11" + + - db: "mariadb:10.11" + py: "3.10" + + - db: "mariadb:10.6" + py: "3.9" + + - db: "mysql:8.0" + py: "pypy3.11" + mysql_auth: true + + - db: "mysql:9" + py: "3.14" + mysql_auth: true + + - db: "mysql:8.4" + py: "3.9" + mysql_auth: true + + - db: "mysql:5.7" + py: "3.9" + + services: + mysql: + image: "${{ matrix.db }}" + ports: + - 3306:3306 + env: + MYSQL_ALLOW_EMPTY_PASSWORD: yes + MARIADB_ALLOW_EMPTY_ROOT_PASSWORD: yes + options: "--name=mysqld" + volumes: + - /run/mysqld:/run/mysqld + + steps: + - uses: actions/checkout@v5 + + - name: Workaround MySQL container permissions + if: startsWith(matrix.db, 'mysql') + run: | + sudo chown 999:999 /run/mysqld + /usr/bin/docker ps --all --filter status=exited --no-trunc --format "{{.ID}}" | xargs -r /usr/bin/docker start + + - name: Set up Python ${{ matrix.py }} + uses: actions/setup-python@v5 + with: + python-version: ${{ matrix.py }} + allow-prereleases: true + cache: 'pip' + cache-dependency-path: 'requirements-dev.txt' + + - name: Install dependency + run: | + pip install --upgrade -r requirements-dev.txt + + - name: Set up MySQL + run: | + while : + do + sleep 1 + mysql -h127.0.0.1 -uroot -e 'select version()' && break + done + mysql -h127.0.0.1 -uroot -e "SET GLOBAL local_infile=on" + mysql -h127.0.0.1 -uroot --comments < ci/docker-entrypoint-initdb.d/init.sql + mysql -h127.0.0.1 -uroot --comments < ci/docker-entrypoint-initdb.d/mysql.sql + mysql -h127.0.0.1 -uroot --comments < ci/docker-entrypoint-initdb.d/mariadb.sql + cp ci/docker.json pymysql/tests/databases.json + + - name: Run test + run: | + pytest -v --cov --cov-config .coveragerc pymysql + pytest -v --cov-append --cov-config .coveragerc --doctest-modules pymysql/converters.py + + - name: Run MySQL8 auth test + if: ${{ matrix.mysql_auth }} + run: | + docker cp mysqld:/var/lib/mysql/public_key.pem "${HOME}" + docker cp mysqld:/var/lib/mysql/ca.pem "${HOME}" + docker cp mysqld:/var/lib/mysql/server-cert.pem "${HOME}" + docker cp mysqld:/var/lib/mysql/client-key.pem "${HOME}" + docker cp mysqld:/var/lib/mysql/client-cert.pem "${HOME}" + pytest -v --cov-append --cov-config .coveragerc tests/test_auth.py; + + - name: Upload coverage reports to Codecov + if: github.repository == 'PyMySQL/PyMySQL' + uses: codecov/codecov-action@v5 diff --git a/.gitignore b/.gitignore index 236fc37f4..09a5654fb 100644 --- a/.gitignore +++ b/.gitignore @@ -1,9 +1,16 @@ *.pyc *.pyo -__pycache__ -.coverage -/dist -/PyMySQL.egg-info +/.cache +/.coverage +/.idea /.tox +/.venv +/.vscode +/PyMySQL.egg-info /build +/dist +/docs/build /pymysql/tests/databases.json +__pycache__ +Pipfile.lock +pdm.lock diff --git a/.readthedocs.yaml b/.readthedocs.yaml new file mode 100644 index 000000000..59fdb65df --- /dev/null +++ b/.readthedocs.yaml @@ -0,0 +1,17 @@ +# .readthedocs.yaml +# Read the Docs configuration file +# See https://docs.readthedocs.io/en/stable/config-file/v2.html for details +version: 2 + +build: + os: ubuntu-22.04 + tools: + python: "3.12" + +python: + install: + - requirements: docs/requirements.txt + +# Build documentation in the docs/ directory with Sphinx +sphinx: + configuration: docs/source/conf.py diff --git a/.travis.databases.json b/.travis.databases.json deleted file mode 100644 index 7acd20c14..000000000 --- a/.travis.databases.json +++ /dev/null @@ -1,4 +0,0 @@ -[ - {"host": "localhost", "unix_socket": "/var/run/mysqld/mysqld.sock", "user": "root", "passwd": "", "db": "test_pymysql", "use_unicode": true, "local_infile": true}, - {"host": "127.0.0.1", "port": 3306, "user": "travis_pymysql2", "password": "some password", "db": "test_pymysql2" } -] diff --git a/.travis.initialize.db.sh b/.travis.initialize.db.sh deleted file mode 100755 index b89046fac..000000000 --- a/.travis.initialize.db.sh +++ /dev/null @@ -1,51 +0,0 @@ -#!/bin/bash - -#debug -set -x -#verbose -set -v - -if [ ! -z "${DB}" ]; then - # disable existing database server in case of accidential connection - mysql -u root -e 'drop user travis@localhost; drop user root@localhost; drop user travis; create user super@localhost; grant all on *.* to super@localhost with grant option' - mysql -u super -e 'drop user root' - F=mysql-${DB}-linux-glibc2.5-x86_64 - mkdir -p ${HOME}/mysql - P=${HOME}/mysql/${F} - if [ ! -d "${P}" ]; then - wget http://cdn.mysql.com/Downloads/MySQL-${DB%.*}/${F}.tar.gz -O - | tar -zxf - --directory=${HOME}/mysql - fi - if [ -f "${P}"/my.cnf ]; then - O="--defaults-file=${P}/my.cnf" - fi - if [ -x "${P}"/scripts/mysql_install_db ]; then - I=${P}/scripts/mysql_install_db - O="--defaults-file=${P}/my.cnf" - else - I=${P}/bin/mysqld - IO=" --initialize " - O="--no-defaults " - fi - ${I} ${O} ${IO} --basedir=${P} --datadir=${HOME}/db-"${DB}" --log-error=/tmp/mysql.err - PWLINE=$(grep 'A temporary password is generated for root@localhost:' /tmp/mysql.err) - PASSWD=${PWLINE##* } - if [ -x ${P}/bin/mysql_ssl_rsa_setup ]; then - ${P}/bin/mysql_ssl_rsa_setup --datadir=${HOME}/db-"${DB}" - fi - # sha256 password auth keys: - openssl genrsa -out "${P}"/private_key.pem 2048 - openssl rsa -in "${P}"/private_key.pem -pubout -out "${P}"/public_key.pem - ${P}/bin/mysqld_safe ${O} --ledir=/ --mysqld=${P}/bin/mysqld --datadir=${HOME}/db-${DB} --socket=/tmp/mysql.sock --port 3307 --innodb-buffer-pool-size=200M --lc-messages-dir=${P}/share --plugin-dir=${P}/lib/plugin/ --log-error=/tmp/mysql.err & - while [ ! -S /tmp/mysql.sock ]; do - sleep 2 - done - cat /tmp/mysql.err - if [ ! -z "${PASSWD}" ]; then - ${P}/bin/mysql -S /tmp/mysql.sock -u root -p"${PASSWD}" --connect-expired-password -e "SET PASSWORD = PASSWORD('')" - fi - mysql -S /tmp/mysql.sock -u root -e "create user ${USER}@localhost; create user ${USER}@'%'; grant all on *.* to ${USER}@localhost WITH GRANT OPTION;grant all on *.* to ${USER}@'%' WITH GRANT OPTION;" - sed -e 's/3306/3307/g' -e 's:/var/run/mysqld/mysqld.sock:/tmp/mysql.sock:g' .travis.databases.json > pymysql/tests/databases.json - echo -e "[client]\nsocket = /tmp/mysql.sock\n" > "${HOME}"/.my.cnf -else - cp .travis.databases.json pymysql/tests/databases.json -fi diff --git a/.travis.yml b/.travis.yml deleted file mode 100644 index bfc434d44..000000000 --- a/.travis.yml +++ /dev/null @@ -1,77 +0,0 @@ -sudo: false -language: python -python: "3.4" -cache: - pip: true - - -env: - matrix: - - TOX_ENV=py26 - - TOX_ENV=py27 - - TOX_ENV=py33 - - TOX_ENV=py34 - - TOX_ENV=pypy - - TOX_ENV=pypy3 - -matrix: - include: - - addons: - mariadb: 5.5 - env: TOX_ENV=py27 - - addons: - mariadb: 10.0 - env: TOX_ENV=py33 - - addons: - mariadb: 10.1 - env: TOX_ENV=py34 - - env: - - TOX_ENV=py34 - - DB=5.6.26 - addons: - apt: - packages: - - libaio-dev - python: 3.3 - cache: - directories: - - ${HOME}/mysql - - env: - - TOX_ENV=py34 - - DB=5.7.8-rc - addons: - apt: - packages: - - libaio-dev - python: 3.4 - cache: - directories: - - ${HOME}/mysql - -# different py version from 5.6 and 5.7 as cache seems to be based on py version - -# http://dev.mysql.com/downloads/mysql/5.7.html has latest development release version - -# really only need libaio1 for DB builds however libaio-dev is whitelisted for container builds and liaio1 isn't - -install: - - pip install -U tox coveralls - -before_script: - - ./.travis.initialize.db.sh; - - mysql -e 'create database test_pymysql DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' - - mysql -e 'create database test_pymysql2 DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' - - mysql -u root -e "create user travis_pymysql2 identified by 'some password'; grant all on test_pymysql2.* to travis_pymysql2;" - - mysql -u root -e "create user travis_pymysql2@localhost identified by 'some password'; grant all on test_pymysql2.* to travis_pymysql2@localhost;" - - mysql -e 'select VERSION();' - - rm -f ~/.my.cnf # set in .travis.initialize.db.sh for the above commands - we should be using database.json however - - export COVERALLS_PARALLEL=true - -script: - - tox -e $TOX_ENV - -after_success: - - coveralls - -after_failure: - - cat /tmp/mysql.err diff --git a/CHANGELOG b/CHANGELOG deleted file mode 100644 index 91e9baa79..000000000 --- a/CHANGELOG +++ /dev/null @@ -1,112 +0,0 @@ -# Changes - -## 0.6.7 - -Release date: 2015-09-30 - -* Allow self signed certificate -* Add max_allowed_packet option -* Fix error when bytes in executemany -* Support geometry type -* Add coveralls badge to README -* Fix some bugs relating to warnings -* Add Cursor.mogrify() method -* no_delay option is deprecated and True by default -* Fix options from my.cnf overrides options from arguments -* Allow socket like object. (It's not feature for end users) -* Strip quotes while reading options from my.cnf file -* Fix encoding issue in executemany() - -## 0.6.6 - -* Add context manager to cursor -* Fix can't encode blob that is not utf-8 on PY3. (regression of 0.6.4, - Thanks to @wiggzz) - -## 0.6.5 -Skipped - -## 0.6.4 -* Support "LOAD LOCAL INFILE". Thanks @wraziens -* Show MySQL warnings after execute query. -* Fix MySQLError may be wrapped with OperationalError while connectiong. (#274) -* SSCursor no longer attempts to expire un-collected rows within __del__, - delaying termination of an interrupted program; cleanup of uncollected - rows is left to the Connection on next execute, which emits a - warning at that time. (#287) -* Support datetime and time with microsecond. (#303) -* Use surrogateescape to format bytes on Python 3. -* OperationalError raised from connect() have information about original - exception. (#304) -* `init_command` now support multi statement. -* `Connection.escape()` method now accepts second argument compatible to - MySQL-Python. - -## 0.6.3 -* Fixed multiple result sets with SSCursor. -* Fixed connection timeout. -* Fixed literal set syntax to work on Py2.6. -* Allow for mysql negative values with 0 hour timedelta. -* Added Connection.begin(). - -## 0.6.2 -* Fixed old password on Python 3. -* Added support for bulk insert in Cursor.executemany(). -* Added support for microseconds in datetimes and dates before 1900. -* Several other bug fixes. - -## 0.6.1 -* Added cursor._last_executed for MySQLdb compatibility -* Cursor.fetchall() and .fetchmany now return list, not tuple -* Allow "length of auth-plugin-data" = 0 -* Cursor.connection references connection object without weakref - -## 0.6 -* Improved Py3k support -* Improved PyPy support -* Added IPv6 support -* Added Thing2Literal for Django/MySQLdb compatibility -* Removed errorhandler -* Fixed GC errors -* Improved test suite -* Many bug fixes -* Many performance improvements - -## 0.4 -* Miscellaneous bug fixes -* Implementation of SSL support -* Implementation of kill() -* Cleaned up charset functionality -* Fixed BIT type handling -* Connections raise exceptions after they are close()'d -* Full Py3k and unicode support - -## 0.3 -* Implemented most of the extended DBAPI 2.0 spec including callproc() -* Fixed error handling to include the message from the server and support - multiple protocol versions. -* Implemented ping() -* Implemented unicode support (probably needs better testing) -* Removed DeprecationWarnings -* Ran against the MySQLdb unit tests to check for bugs -* Added support for client_flag, charset, sql_mode, read_default_file, - use_unicode, cursorclass, init_command, and connect_timeout. -* Refactoring for some more compatibility with MySQLdb including a fake - pymysql.version_info attribute. -* Now runs with no warnings with the -3 command-line switch -* Added test cases for all outstanding tickets and closed most of them. -* Basic Jython support added. -* Fixed empty result sets bug. -* Integrated new unit tests and refactored the example into one. -* Fixed bug with decimal conversion. -* Fixed string encoding bug. Now unicode and binary data work! -* Added very basic docstrings. - -## 0.2 -* Changed connection parameter name 'password' to 'passwd' - to make it more plugin replaceable for the other mysql clients. -* Changed pack()/unpack() calls so it runs on 64 bit OSes too. -* Added support for unix_socket. -* Added support for no password. -* Renamed decorders to decoders. -* Better handling of non-existing decoder. diff --git a/CHANGELOG.md b/CHANGELOG.md new file mode 100644 index 000000000..d78d2a010 --- /dev/null +++ b/CHANGELOG.md @@ -0,0 +1,441 @@ +# Changes + +## Backward incompatible changes planned in the future. + +* Error classes in Cursor class will be removed after 2024-06 +* `Connection.set_charset(charset)` will be removed after 2024-06 +* `db` and `passwd` will emit DeprecationWarning in v1.2. See #933. +* `Connection.ping(reconnect)` change the default to not reconnect. + +## v1.1.2 + +Release date: 2025-08-24 + +* Prevent UnboundLocalError in very rare situation. https://github.com/PyMySQL/PyMySQL/pull/1174 +* Close underlying `SocketIO` soon when Connection is closed for PyPy. https://github.com/PyMySQL/PyMySQL/issues/1183 +* Fix importing PyMySQL fail on CPython 3.13 when `getpass.getuser()` raises OSEError. https://github.com/PyMySQL/PyMySQL/pull/1190 +* Make charset name "utf8" case insensitive. https://github.com/PyMySQL/PyMySQL/pull/1195 +* `Connection.kill()` uses `KILL` query instead of `COM_KILL`command to support MySQL 8.4. https://github.com/PyMySQL/PyMySQL/pull/1197 +* Fix SSL error on CPython 3.13 caused by strict TLS default setting. https://github.com/PyMySQL/PyMySQL/pull/1198 +* Fix auth switch request handling. https://github.com/PyMySQL/PyMySQL/pull/1200 + + +## v1.1.1 + +Release date: 2024-05-21 + +> [!WARNING] +> This release fixes a vulnerability (CVE-2024-36039). +> All users are recommended to update to this version. +> +> If you can not update soon, check the input value from +> untrusted source has an expected type. Only dict input +> from untrusted source can be an attack vector. + +* Prohibit dict parameter for `Cursor.execute()`. It didn't produce valid SQL + and might cause SQL injection. (CVE-2024-36039) +* Added ssl_key_password param. #1145 + +## v1.1.0 + +Release date: 2023-06-26 + +* Fixed SSCursor raising OperationalError for query timeouts on wrong statement (#1032) +* Exposed `Cursor.warning_count` to check for warnings without additional query (#1056) +* Make Cursor iterator (#995) +* Support '_' in key name in my.cnf (#1114) +* `Cursor.fetchall()` returns empty list instead of tuple (#1115). Note that `Cursor.fetchmany()` still return empty tuple after reading all rows for compatibility with Django. +* Deprecate Error classes in Cursor class (#1117) +* Add `Connection.set_character_set(charset, collation=None)`. This method is compatible with mysqlclient. (#1119) +* Deprecate `Connection.set_charset(charset)` (#1119) +* New connection always send "SET NAMES charset [COLLATE collation]" query. (#1119) + Since collation table is vary on MySQL server versions, collation in handshake is fragile. +* Support `charset="utf8mb3"` option (#1127) + + +## v1.0.3 + +Release date: 2023-03-28 + +* Dropped support of end of life MySQL version 5.6 +* Dropped support of end of life MariaDB versions below 10.3 +* Dropped support of end of life Python version 3.6 +* Removed `_last_executed` because of duplication with `_executed` by @rajat315315 in https://github.com/PyMySQL/PyMySQL/pull/948 +* Fix generating authentication response with long strings by @netch80 in https://github.com/PyMySQL/PyMySQL/pull/988 +* update pymysql.constants.CR by @Nothing4You in https://github.com/PyMySQL/PyMySQL/pull/1029 +* Document that the ssl connection parameter can be an SSLContext by @cakemanny in https://github.com/PyMySQL/PyMySQL/pull/1045 +* Raise ProgrammingError on -np.inf in addition to np.inf by @cdcadman in https://github.com/PyMySQL/PyMySQL/pull/1067 +* Use Python 3.11 release instead of -dev in tests by @Nothing4You in https://github.com/PyMySQL/PyMySQL/pull/1076 + + +## v1.0.2 + +Release date: 2021-01-09 + +* Fix `user`, `password`, `host`, `database` are still positional arguments. + All arguments of `connect()` are now keyword-only. (#941) + + +## v1.0.1 + +Release date: 2021-01-08 + +* Stop emitting DeprecationWarning for use of ``db`` and ``passwd``. + Note that they are still deprecated. (#939) +* Add ``python_requires=">=3.6"`` to setup.py. (#936) + + +## v1.0.0 + +Release date: 2021-01-07 + +Backward incompatible changes: + +* Python 2.7 and 3.5 are not supported. +* ``connect()`` uses keyword-only arguments. User must use keyword argument. +* ``connect()`` kwargs ``db`` and ``passwd`` are now deprecated; Use ``database`` and ``password`` instead. +* old_password authentication method (used by MySQL older than 4.1) is not supported. +* MySQL 5.5 and MariaDB 5.5 are not officially supported, although it may still works. +* Removed ``escape_dict``, ``escape_sequence``, and ``escape_string`` from ``pymysql`` + module. They are still in ``pymysql.converters``. + +Other changes: + +* Connection supports context manager API. ``__exit__`` closes the connection. (#886) +* Add MySQL Connector/Python compatible TLS options (#903) +* Major code cleanup; PyMySQL now uses black and flake8. + + +## v0.10.1 + +Release date: 2020-09-10 + +* Fix missing import of ProgrammingError. (#878) +* Fix auth switch request handling. (#890) + + +## v0.10.0 + +Release date: 2020-07-18 + +This version is the last version supporting Python 2.7. + +* MariaDB ed25519 auth is supported. +* Python 3.4 support is dropped. +* Context manager interface is removed from `Connection`. It will be added + with different meaning. +* MySQL warnings are not shown by default because many user report issue to + PyMySQL issue tracker when they see warning. You need to call "SHOW WARNINGS" + explicitly when you want to see warnings. +* Formatting of float object is changed from "3.14" to "3.14e0". +* Use cp1252 codec for latin1 charset. +* Fix decimal literal. +* TRUNCATED_WRONG_VALUE_FOR_FIELD, and ILLEGAL_VALUE_FOR_TYPE are now + DataError instead of InternalError. + + +## 0.9.3 + +Release date: 2018-12-18 + +* cryptography dependency is optional now. +* Fix old_password (used before MySQL 4.1) support. +* Deprecate old_password. +* Stop sending ``sys.argv[0]`` for connection attribute "program_name". +* Close connection when unknown error is happened. +* Deprecate context manager API of Connection object. + +## 0.9.2 + +Release date: 2018-07-04 + +* Disabled unintentinally enabled debug log +* Removed unintentionally installed tests + + +## 0.9.1 + +Release date: 2018-07-03 + +* Fixed caching_sha2_password and sha256_password raise TypeError on PY2 + (#700, #702) + + +## 0.9.0 + +Release date: 2018-06-27 + +* Change default charset from latin1 to utf8mb4. (because MySQL 8 changed) (#692) +* Support sha256_password and caching_sha2_password auth method (#682) +* Add cryptography dependency, because it's needed for new auth methods. +* Remove deprecated `no_delay` option (#694) +* Support connection attributes (#679) +* Map LOCK_DEADLOCK to OperationalError (#693) + +## 0.8.1 + +Release date: 2018-05-07 + +* Reduce `cursor.callproc()` roundtrip time. (#636) + +* Fixed `cursor.query()` is hunged after multi statement failed. (#647) + +* WRONG_DB_NAME and WRONG_COLUMN_NAME is ProgrammingError for now. (#629) + +* Many test suite improvements, especially adding MySQL 8.0 and using Docker. + Thanks to Daniel Black. + +* Dropped support for old Python and MySQL which is not tested long time. + + +## 0.8 + +Release date: 2017-12-20 + +* **BACKWARD INCOMPATIBLE** ``binary_prefix`` option is added and off + by default because of compatibility with mysqlclient. + When you need PyMySQL 0.7 behavior, you have to pass ``binary_prefix=True``. + (#549) + +* **BACKWARD INCOMPATIBLE** ``MULTI_STATEMENTS`` client flag is no longer + set by default, while it was on PyMySQL 0.7. You need to pass + ``client_flag=CLIENT.MULTI_STATEMENTS`` when you connect to explicitly + enable multi-statement mode. (#590) + +* Fixed AuthSwitch packet handling. + +* Raise OperationalError for MariaDB's constraint error. (#607) + +* executemany() accepts query without space between ``VALUES`` and ``(``. (#597) + +* Support config file containing option without value. (#588) + +* Fixed Connection.ping() returned unintended value. + + +## 0.7.11 + +Release date: 2017-04-06 + +* Fixed Connection.close() failed when failed to send COM_CLOSE packet. +* Cursor.executemany() accepts query ends with semicolon. +* ssl parameters can be read from my.cnf. + + +## 0.7.10 + +Release date: 2017-02-14 + +* **SECURITY FIX**: Raise RuntimeError when received LOAD_LOCAL packet while + ``loacal_infile=False``. (Thanks to Bryan Helmig) + +* Raise SERVER_LOST error for MariaDB's shutdown packet (#540) + +* Change default connect_timeout to 10. + +* Add bind_address option (#529) + + +## 0.7.9 + +Release date: 2016-09-03 + +* Fix PyMySQL stop reading rows when first column is empty string (#513) + Reverts DEPRECATE_EOF introduced in 0.7.7. + +## 0.7.8 + +Release date: 2016-09-01 + +* Revert error message change in 0.7.7. + (SQLAlchemy parses error message, #507) + +## 0.7.7 + +Release date: 2016-08-30 + +* Add new unicode collation (#498) +* Fix conv option is not used for encoding objects. +* Experimental support for DEPRECATE_EOF protocol. + +## 0.7.6 + +Release date: 2016-07-29 + +* Fix SELECT JSON type cause UnicodeError +* Avoid float conversion while parsing microseconds +* Warning has number +* SSCursor supports warnings + +## 0.7.5 + +Release date: 2016-06-28 + +* Fix exception raised while importing when getpwuid() fails (#472) +* SSCursor supports LOAD DATA LOCAL INFILE (#473) +* Fix encoding error happen for JSON type (#477) +* Fix test fail on Python 2.7 and MySQL 5.7 (#478) + +## 0.7.4 + +Release date: 2016-05-26 + +* Fix AttributeError may happen while Connection.__del__ (#463) +* Fix SyntaxError in test_cursor. (#464) +* frozenset support for query value. (#461) +* Start using readthedocs.io + +## 0.7.3 + +Release date: 2016-05-19 + +* Add read_timeout and write_timeout option. +* Support serialization customization by `conv` option. +* Unknown type is converted by `str()`, for MySQLdb compatibility. +* Support '%%' in `Cursor.executemany()` +* Support REPLACE statement in `Cursor.executemany()` +* Fix handling incomplete row caused by 'SHOW SLAVE HOSTS'. +* Fix decode error when use_unicode=False on PY3 +* Fix port option in my.cnf file is ignored. + + +## 0.7.2 + +Release date: 2016-02-24 + +* Fix misuse of `max_allowed_packet` parameter. (#426, #407 and #397) +* Add %(name)s plceholder support to `Cursor.executemany()`. (#427, thanks to + @WorldException) + +## 0.7.1 + +Release date: 2016-01-14 + +* Fix auth fail with MySQL 5.1 +* Fix escaping unicode fails on Python 2 + +## 0.7 + +Release date: 2016-01-10 + +* Faster binary escaping +* Add `"_binary" prefix` to string literal for binary types. + binary types are: `bytearray` on Python 2, `bytes` and `bytearray` on Python 3. + This is because recent MySQL show warnings when string literal is invalid for + connection encoding. +* `pymysql.Binary()` returns `bytearray` on Python 2. This is required to distinguish + binary and string. +* Auth plugin support. +* no_delay option is ignored. It will be removed in PyMySQL 0.8. + + +## 0.6.7 + +Release date: 2015-09-30 + +* Allow self signed certificate +* Add max_allowed_packet option +* Fix error when bytes in executemany +* Support geometry type +* Add coveralls badge to README +* Fix some bugs relating to warnings +* Add Cursor.mogrify() method +* no_delay option is deprecated and True by default +* Fix options from my.cnf overrides options from arguments +* Allow socket like object. (It's not feature for end users) +* Strip quotes while reading options from my.cnf file +* Fix encoding issue in executemany() + +## 0.6.6 + +* Add context manager to cursor +* Fix can't encode blob that is not utf-8 on PY3. (regression of 0.6.4, + Thanks to @wiggzz) + +## 0.6.5 +Skipped + +## 0.6.4 +* Support "LOAD LOCAL INFILE". Thanks @wraziens +* Show MySQL warnings after execute query. +* Fix MySQLError may be wrapped with OperationalError while connectiong. (#274) +* SSCursor no longer attempts to expire un-collected rows within __del__, + delaying termination of an interrupted program; cleanup of uncollected + rows is left to the Connection on next execute, which emits a + warning at that time. (#287) +* Support datetime and time with microsecond. (#303) +* Use surrogateescape to format bytes on Python 3. +* OperationalError raised from connect() have information about original + exception. (#304) +* `init_command` now support multi statement. +* `Connection.escape()` method now accepts second argument compatible to + MySQL-Python. + +## 0.6.3 +* Fixed multiple result sets with SSCursor. +* Fixed connection timeout. +* Fixed literal set syntax to work on Py2.6. +* Allow for mysql negative values with 0 hour timedelta. +* Added Connection.begin(). + +## 0.6.2 +* Fixed old password on Python 3. +* Added support for bulk insert in Cursor.executemany(). +* Added support for microseconds in datetimes and dates before 1900. +* Several other bug fixes. + +## 0.6.1 +* Added cursor._last_executed for MySQLdb compatibility +* Cursor.fetchall() and .fetchmany now return list, not tuple +* Allow "length of auth-plugin-data" = 0 +* Cursor.connection references connection object without weakref + +## 0.6 +* Improved Py3k support +* Improved PyPy support +* Added IPv6 support +* Added Thing2Literal for Django/MySQLdb compatibility +* Removed errorhandler +* Fixed GC errors +* Improved test suite +* Many bug fixes +* Many performance improvements + +## 0.4 +* Miscellaneous bug fixes +* Implementation of SSL support +* Implementation of kill() +* Cleaned up charset functionality +* Fixed BIT type handling +* Connections raise exceptions after they are close()'d +* Full Py3k and unicode support + +## 0.3 +* Implemented most of the extended DBAPI 2.0 spec including callproc() +* Fixed error handling to include the message from the server and support + multiple protocol versions. +* Implemented ping() +* Implemented unicode support (probably needs better testing) +* Removed DeprecationWarnings +* Ran against the MySQLdb unit tests to check for bugs +* Added support for client_flag, charset, sql_mode, read_default_file, + use_unicode, cursorclass, init_command, and connect_timeout. +* Refactoring for some more compatibility with MySQLdb including a fake + pymysql.version_info attribute. +* Now runs with no warnings with the -3 command-line switch +* Added test cases for all outstanding tickets and closed most of them. +* Basic Jython support added. +* Fixed empty result sets bug. +* Integrated new unit tests and refactored the example into one. +* Fixed bug with decimal conversion. +* Fixed string encoding bug. Now unicode and binary data work! +* Added very basic docstrings. + +## 0.2 +* Changed connection parameter name 'password' to 'passwd' + to make it more plugin replaceable for the other mysql clients. +* Changed pack()/unpack() calls so it runs on 64 bit OSes too. +* Added support for unix_socket. +* Added support for no password. +* Renamed decorders to decoders. +* Better handling of non-existing decoder. diff --git a/MANIFEST.in b/MANIFEST.in index 0e4c15a0f..e2e577a9d 100644 --- a/MANIFEST.in +++ b/MANIFEST.in @@ -1,3 +1 @@ -include README.rst LICENSE CHANGELOG -include runtests.py tox.ini -include example.py +include README.md LICENSE CHANGELOG.md diff --git a/README.md b/README.md new file mode 100644 index 000000000..ba491e2df --- /dev/null +++ b/README.md @@ -0,0 +1,107 @@ +[![Documentation Status](https://readthedocs.org/projects/pymysql/badge/?version=latest)](https://pymysql.readthedocs.io/) +[![codecov](https://codecov.io/gh/PyMySQL/PyMySQL/branch/main/graph/badge.svg?token=ppEuaNXBW4)](https://codecov.io/gh/PyMySQL/PyMySQL) +[![Ask DeepWiki](https://deepwiki.com/badge.svg)](https://deepwiki.com/PyMySQL/PyMySQL) + +# PyMySQL + +This package contains a pure-Python MySQL and MariaDB client library, based on +[PEP 249](https://www.python.org/dev/peps/pep-0249/). + +## Requirements + +- Python -- one of the following: + - [CPython](https://www.python.org/) : 3.9 and newer + - [PyPy](https://pypy.org/) : Latest 3.x version +- MySQL Server -- one of the following: + - [MySQL](https://www.mysql.com/) LTS versions + - [MariaDB](https://mariadb.org/) LTS versions + +## Installation + +Package is uploaded on [PyPI](https://pypi.org/project/PyMySQL). + +You can install it with pip: + + $ python3 -m pip install PyMySQL + +To use "sha256_password" or "caching_sha2_password" for authenticate, +you need to install additional dependency: + + $ python3 -m pip install PyMySQL[rsa] + +To use MariaDB's "ed25519" authentication method, you need to install +additional dependency: + + $ python3 -m pip install PyMySQL[ed25519] + +## Documentation + +Documentation is available online: + +For support, please refer to the +[StackOverflow](https://stackoverflow.com/questions/tagged/pymysql). + +## Example + +The following examples make use of a simple table + +``` sql +CREATE TABLE `users` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `email` varchar(255) COLLATE utf8_bin NOT NULL, + `password` varchar(255) COLLATE utf8_bin NOT NULL, + PRIMARY KEY (`id`) +) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_bin +AUTO_INCREMENT=1 ; +``` + +``` python +import pymysql.cursors + +# Connect to the database +connection = pymysql.connect(host='localhost', + user='user', + password='passwd', + database='db', + cursorclass=pymysql.cursors.DictCursor) + +with connection: + with connection.cursor() as cursor: + # Create a new record + sql = "INSERT INTO `users` (`email`, `password`) VALUES (%s, %s)" + cursor.execute(sql, ('webmaster@python.org', 'very-secret')) + + # connection is not autocommit by default. So you must commit to save + # your changes. + connection.commit() + + with connection.cursor() as cursor: + # Read a single record + sql = "SELECT `id`, `password` FROM `users` WHERE `email`=%s" + cursor.execute(sql, ('webmaster@python.org',)) + result = cursor.fetchone() + print(result) +``` + +This example will print: + +``` python +{'password': 'very-secret', 'id': 1} +``` + +## Resources + +- DB-API 2.0: +- MySQL Reference Manuals: +- Getting Help With MariaDB +- MySQL client/server protocol: + +- "Connector" channel in MySQL Community Slack: + +- PyMySQL mailing list: + + +## License + +PyMySQL is released under the MIT License. See LICENSE for more +information. diff --git a/README.rst b/README.rst deleted file mode 100644 index 124a8176b..000000000 --- a/README.rst +++ /dev/null @@ -1,146 +0,0 @@ -======= -PyMySQL -======= - -.. image:: https://travis-ci.org/PyMySQL/PyMySQL.svg?branch=master - :target: https://travis-ci.org/PyMySQL/PyMySQL - -.. image:: https://coveralls.io/repos/PyMySQL/PyMySQL/badge.svg?branch=master&service=github :target: https://coveralls.io/github/PyMySQL/PyMySQL?branch=master - -.. contents:: - -This package contains a pure-Python MySQL client library. The goal of PyMySQL -is to be a drop-in replacement for MySQLdb and work on CPython, PyPy and IronPython. - - -Requirements -------------- - -* Python -- one of the following: - - - CPython_ >= 2.6 or >= 3.3 - - PyPy_ >= 2.3 - - IronPython_ 2.7 - -* MySQL Server -- one of the following: - - - MySQL_ >= 4.1 - - MariaDB_ >= 5.1 - -.. _CPython: http://www.python.org/ -.. _PyPy: http://pypy.org/ -.. _IronPython: http://ironpython.net/ -.. _MySQL: http://www.mysql.com/ -.. _MariaDB: https://mariadb.org/ - - -Installation ------------- - -The last stable release is available on PyPI and can be installed with ``pip``:: - - $ pip install PyMySQL - -Alternatively (e.g. if ``pip`` is not available), a tarball can be downloaded -from GitHub and installed with Setuptools:: - - $ # X.X is the desired PyMySQL version (e.g. 0.5 or 0.6). - $ curl -L https://github.com/PyMySQL/PyMySQL/tarball/pymysql-X.X | tar xz - $ cd PyMySQL* - $ python setup.py install - $ # The folder PyMySQL* can be safely removed now. - -Test Suite ----------- - -If you would like to run the test suite, create database for test like this:: - - mysql -e 'create database test_pymysql DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' - mysql -e 'create database test_pymysql2 DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' - -Then, copy the file ``.travis.databases.json`` to ``pymysql/tests/databases.json`` -and edit the new file to match your MySQL configuration:: - - $ cp .travis.databases.json pymysql/tests/databases.json - $ $EDITOR pymysql/tests/databases.json - -To run all the tests, execute the script ``runtests.py``:: - - $ python runtests.py - -A ``tox.ini`` file is also provided for conveniently running tests on multiple -Python versions:: - - $ tox - - -Example -------- - -The following examples make use of a simple table - -.. code:: sql - - CREATE TABLE `users` ( - `id` int(11) NOT NULL AUTO_INCREMENT, - `email` varchar(255) COLLATE utf8_bin NOT NULL, - `password` varchar(255) COLLATE utf8_bin NOT NULL, - PRIMARY KEY (`id`) - ) ENGINE=InnoDB DEFAULT CHARSET=utf8 COLLATE=utf8_bin - AUTO_INCREMENT=1 ; - - -.. code:: python - - import pymysql.cursors - - # Connect to the database - connection = pymysql.connect(host='localhost', - user='user', - password='passwd', - db='db', - charset='utf8mb4', - cursorclass=pymysql.cursors.DictCursor) - - try: - with connection.cursor() as cursor: - # Create a new record - sql = "INSERT INTO `users` (`email`, `password`) VALUES (%s, %s)" - cursor.execute(sql, ('webmaster@python.org', 'very-secret')) - - # connection is not autocommit by default. So you must commit to save - # your changes. - connection.commit() - - with connection.cursor() as cursor: - # Read a single record - sql = "SELECT `id`, `password` FROM `users` WHERE `email`=%s" - cursor.execute(sql, ('webmaster@python.org',)) - result = cursor.fetchone() - print(result) - finally: - connection.close() - -This example will print: - -.. code:: python - - {'password': 'very-secret', 'id': 1} - - -Resources ---------- - -DB-API 2.0: http://www.python.org/dev/peps/pep-0249 - -MySQL Reference Manuals: http://dev.mysql.com/doc/ - -MySQL client/server protocol: -http://dev.mysql.com/doc/internals/en/client-server-protocol.html - -PyMySQL mailing list: https://groups.google.com/forum/#!forum/pymysql-users - -License -------- - -PyMySQL is released under the MIT License. See LICENSE for more information. diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 000000000..da9c516dd --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,5 @@ +## Security contact information + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. diff --git a/ci/database.json b/ci/database.json new file mode 100644 index 000000000..aad0bfb29 --- /dev/null +++ b/ci/database.json @@ -0,0 +1,4 @@ +[ + {"host": "localhost", "unix_socket": "/var/run/mysqld/mysqld.sock", "user": "root", "password": "", "database": "test1", "use_unicode": true, "local_infile": true}, + {"host": "127.0.0.1", "port": 3306, "user": "test2", "password": "some password", "database": "test2" } +] diff --git a/ci/docker-entrypoint-initdb.d/README b/ci/docker-entrypoint-initdb.d/README new file mode 100644 index 000000000..6a54b93da --- /dev/null +++ b/ci/docker-entrypoint-initdb.d/README @@ -0,0 +1,12 @@ +To test with a MariaDB or MySQL container image: + +docker run -d -p 3306:3306 -e MYSQL_ALLOW_EMPTY_PASSWORD=1 \ + --name=mysqld -v ./ci/docker-entrypoint-initdb.d:/docker-entrypoint-initdb.d:z \ + mysql:8.0.26 --local-infile=1 + +cp ci/docker.json pymysql/tests/databases.json + +pytest + + +Note: Some authentication tests that don't match the image version will fail. diff --git a/ci/docker-entrypoint-initdb.d/init.sql b/ci/docker-entrypoint-initdb.d/init.sql new file mode 100644 index 000000000..b741d41c5 --- /dev/null +++ b/ci/docker-entrypoint-initdb.d/init.sql @@ -0,0 +1,7 @@ +create database test1 DEFAULT CHARACTER SET utf8mb4; +create database test2 DEFAULT CHARACTER SET utf8mb4; +create user test2 identified by 'some password'; +grant all on test2.* to test2; +create user test2@localhost identified by 'some password'; +grant all on test2.* to test2@localhost; + diff --git a/ci/docker-entrypoint-initdb.d/mariadb.sql b/ci/docker-entrypoint-initdb.d/mariadb.sql new file mode 100644 index 000000000..912d365a9 --- /dev/null +++ b/ci/docker-entrypoint-initdb.d/mariadb.sql @@ -0,0 +1,2 @@ +/*M!100122 INSTALL SONAME "auth_ed25519" */; +/*M!100122 CREATE FUNCTION ed25519_password RETURNS STRING SONAME "auth_ed25519.so" */; diff --git a/ci/docker-entrypoint-initdb.d/mysql.sql b/ci/docker-entrypoint-initdb.d/mysql.sql new file mode 100644 index 000000000..a4ba0927d --- /dev/null +++ b/ci/docker-entrypoint-initdb.d/mysql.sql @@ -0,0 +1,8 @@ +/*!80001 CREATE USER + user_sha256 IDENTIFIED WITH "sha256_password" BY "pass_sha256_01234567890123456789", + nopass_sha256 IDENTIFIED WITH "sha256_password", + user_caching_sha2 IDENTIFIED WITH "caching_sha2_password" BY "pass_caching_sha2_01234567890123456789", + nopass_caching_sha2 IDENTIFIED WITH "caching_sha2_password" + PASSWORD EXPIRE NEVER */; + +/*!80001 GRANT RELOAD ON *.* TO user_caching_sha2 */; diff --git a/ci/docker.json b/ci/docker.json new file mode 100644 index 000000000..63d19a687 --- /dev/null +++ b/ci/docker.json @@ -0,0 +1,5 @@ +[ + {"host": "127.0.0.1", "port": 3306, "user": "root", "password": "", "database": "test1", "use_unicode": true, "local_infile": true}, + {"host": "127.0.0.1", "port": 3306, "user": "test2", "password": "some password", "database": "test2" }, + {"host": "localhost", "port": 3306, "user": "test2", "password": "some password", "database": "test2", "unix_socket": "/run/mysqld/mysqld.sock"} +] diff --git a/ci/test_mysql.py b/ci/test_mysql.py new file mode 100644 index 000000000..b97978a27 --- /dev/null +++ b/ci/test_mysql.py @@ -0,0 +1,47 @@ +# This is an example test settings file for use with the Django test suite. +# +# The 'sqlite3' backend requires only the ENGINE setting (an in- +# memory database will be used). All other backends will require a +# NAME and potentially authentication information. See the +# following section in the docs for more information: +# +# https://docs.djangoproject.com/en/dev/internals/contributing/writing-code/unit-tests/ +# +# The different databases that Django supports behave differently in certain +# situations, so it is recommended to run the test suite against as many +# database backends as possible. You may want to create a separate settings +# file for each of the backends you test against. + +import pymysql + +pymysql.install_as_MySQLdb() + +DATABASES = { + "default": { + "ENGINE": "django.db.backends.mysql", + "NAME": "django_default", + "HOST": "127.0.0.1", + "USER": "scott", + "PASSWORD": "tiger", + "TEST": {"CHARSET": "utf8mb3", "COLLATION": "utf8mb3_general_ci"}, + }, + "other": { + "ENGINE": "django.db.backends.mysql", + "NAME": "django_other", + "HOST": "127.0.0.1", + "USER": "scott", + "PASSWORD": "tiger", + "TEST": {"CHARSET": "utf8mb3", "COLLATION": "utf8mb3_general_ci"}, + }, +} + +SECRET_KEY = "django_tests_secret_key" + +# Use a fast hasher to speed up tests. +PASSWORD_HASHERS = [ + "django.contrib.auth.hashers.MD5PasswordHasher", +] + +DEFAULT_AUTO_FIELD = "django.db.models.AutoField" + +USE_TZ = False diff --git a/codecov.yml b/codecov.yml new file mode 100644 index 000000000..919adf200 --- /dev/null +++ b/codecov.yml @@ -0,0 +1,7 @@ +# https://docs.codecov.com/docs/common-recipe-list +coverage: + status: + project: + default: + target: auto + threshold: 3% diff --git a/docs/Makefile b/docs/Makefile new file mode 100644 index 000000000..c1240d2ba --- /dev/null +++ b/docs/Makefile @@ -0,0 +1,153 @@ +# Makefile for Sphinx documentation +# + +# You can set these variables from the command line. +SPHINXOPTS = +SPHINXBUILD = sphinx-build +PAPER = +BUILDDIR = build + +# User-friendly check for sphinx-build +ifeq ($(shell which $(SPHINXBUILD) >/dev/null 2>&1; echo $$?), 1) +$(error The '$(SPHINXBUILD)' command was not found. Make sure you have Sphinx installed, then set the SPHINXBUILD environment variable to point to the full path of the '$(SPHINXBUILD)' executable. Alternatively you can add the directory with the executable to your PATH. If you don't have Sphinx installed, grab it from http://sphinx-doc.org/) +endif + +# Internal variables. +PAPEROPT_a4 = -D latex_paper_size=a4 +PAPEROPT_letter = -D latex_paper_size=letter +ALLSPHINXOPTS = -d $(BUILDDIR)/doctrees $(PAPEROPT_$(PAPER)) $(SPHINXOPTS) source +# the i18n builder cannot share the environment and doctrees with the others +I18NSPHINXOPTS = $(PAPEROPT_$(PAPER)) $(SPHINXOPTS) source + +.PHONY: help clean html dirhtml singlehtml pickle json htmlhelp qthelp devhelp epub latex latexpdf text man changes linkcheck doctest gettext + +help: + @echo "Please use \`make ' where is one of" + @echo " html to make standalone HTML files" + @echo " dirhtml to make HTML files named index.html in directories" + @echo " singlehtml to make a single large HTML file" + @echo " pickle to make pickle files" + @echo " json to make JSON files" + @echo " htmlhelp to make HTML files and a HTML help project" + @echo " qthelp to make HTML files and a qthelp project" + @echo " devhelp to make HTML files and a Devhelp project" + @echo " epub to make an epub" + @echo " latex to make LaTeX files, you can set PAPER=a4 or PAPER=letter" + @echo " latexpdf to make LaTeX files and run them through pdflatex" + @echo " latexpdfja to make LaTeX files and run them through platex/dvipdfmx" + @echo " text to make text files" + @echo " man to make manual pages" + @echo " texinfo to make Texinfo files" + @echo " info to make Texinfo files and run them through makeinfo" + @echo " gettext to make PO message catalogs" + @echo " changes to make an overview of all changed/added/deprecated items" + @echo " xml to make Docutils-native XML files" + @echo " pseudoxml to make pseudoxml-XML files for display purposes" + @echo " linkcheck to check all external links for integrity" + @echo " doctest to run all doctests embedded in the documentation (if enabled)" + +clean: + rm -rf $(BUILDDIR)/* + +html: + $(SPHINXBUILD) -b html $(ALLSPHINXOPTS) $(BUILDDIR)/html + @echo + @echo "Build finished. The HTML pages are in $(BUILDDIR)/html." + +dirhtml: + $(SPHINXBUILD) -b dirhtml $(ALLSPHINXOPTS) $(BUILDDIR)/dirhtml + @echo + @echo "Build finished. The HTML pages are in $(BUILDDIR)/dirhtml." + +singlehtml: + $(SPHINXBUILD) -b singlehtml $(ALLSPHINXOPTS) $(BUILDDIR)/singlehtml + @echo + @echo "Build finished. The HTML page is in $(BUILDDIR)/singlehtml." + +pickle: + $(SPHINXBUILD) -b pickle $(ALLSPHINXOPTS) $(BUILDDIR)/pickle + @echo + @echo "Build finished; now you can process the pickle files." + +json: + $(SPHINXBUILD) -b json $(ALLSPHINXOPTS) $(BUILDDIR)/json + @echo + @echo "Build finished; now you can process the JSON files." + +epub: + $(SPHINXBUILD) -b epub $(ALLSPHINXOPTS) $(BUILDDIR)/epub + @echo + @echo "Build finished. The epub file is in $(BUILDDIR)/epub." + +latex: + $(SPHINXBUILD) -b latex $(ALLSPHINXOPTS) $(BUILDDIR)/latex + @echo + @echo "Build finished; the LaTeX files are in $(BUILDDIR)/latex." + @echo "Run \`make' in that directory to run these through (pdf)latex" \ + "(use \`make latexpdf' here to do that automatically)." + +latexpdf: + $(SPHINXBUILD) -b latex $(ALLSPHINXOPTS) $(BUILDDIR)/latex + @echo "Running LaTeX files through pdflatex..." + $(MAKE) -C $(BUILDDIR)/latex all-pdf + @echo "pdflatex finished; the PDF files are in $(BUILDDIR)/latex." + +latexpdfja: + $(SPHINXBUILD) -b latex $(ALLSPHINXOPTS) $(BUILDDIR)/latex + @echo "Running LaTeX files through platex and dvipdfmx..." + $(MAKE) -C $(BUILDDIR)/latex all-pdf-ja + @echo "pdflatex finished; the PDF files are in $(BUILDDIR)/latex." + +text: + $(SPHINXBUILD) -b text $(ALLSPHINXOPTS) $(BUILDDIR)/text + @echo + @echo "Build finished. The text files are in $(BUILDDIR)/text." + +man: + $(SPHINXBUILD) -b man $(ALLSPHINXOPTS) $(BUILDDIR)/man + @echo + @echo "Build finished. The manual pages are in $(BUILDDIR)/man." + +texinfo: + $(SPHINXBUILD) -b texinfo $(ALLSPHINXOPTS) $(BUILDDIR)/texinfo + @echo + @echo "Build finished. The Texinfo files are in $(BUILDDIR)/texinfo." + @echo "Run \`make' in that directory to run these through makeinfo" \ + "(use \`make info' here to do that automatically)." + +info: + $(SPHINXBUILD) -b texinfo $(ALLSPHINXOPTS) $(BUILDDIR)/texinfo + @echo "Running Texinfo files through makeinfo..." + make -C $(BUILDDIR)/texinfo info + @echo "makeinfo finished; the Info files are in $(BUILDDIR)/texinfo." + +gettext: + $(SPHINXBUILD) -b gettext $(I18NSPHINXOPTS) $(BUILDDIR)/locale + @echo + @echo "Build finished. The message catalogs are in $(BUILDDIR)/locale." + +changes: + $(SPHINXBUILD) -b changes $(ALLSPHINXOPTS) $(BUILDDIR)/changes + @echo + @echo "The overview file is in $(BUILDDIR)/changes." + +linkcheck: + $(SPHINXBUILD) -b linkcheck $(ALLSPHINXOPTS) $(BUILDDIR)/linkcheck + @echo + @echo "Link check complete; look for any errors in the above output " \ + "or in $(BUILDDIR)/linkcheck/output.txt." + +doctest: + $(SPHINXBUILD) -b doctest $(ALLSPHINXOPTS) $(BUILDDIR)/doctest + @echo "Testing of doctests in the sources finished, look at the " \ + "results in $(BUILDDIR)/doctest/output.txt." + +xml: + $(SPHINXBUILD) -b xml $(ALLSPHINXOPTS) $(BUILDDIR)/xml + @echo + @echo "Build finished. The XML files are in $(BUILDDIR)/xml." + +pseudoxml: + $(SPHINXBUILD) -b pseudoxml $(ALLSPHINXOPTS) $(BUILDDIR)/pseudoxml + @echo + @echo "Build finished. The pseudo-XML files are in $(BUILDDIR)/pseudoxml." diff --git a/docs/requirements.txt b/docs/requirements.txt new file mode 100644 index 000000000..48319f033 --- /dev/null +++ b/docs/requirements.txt @@ -0,0 +1,2 @@ +sphinx~=8.0 +sphinx-rtd-theme~=3.0.0 diff --git a/docs/source/conf.py b/docs/source/conf.py new file mode 100644 index 000000000..158d0d12f --- /dev/null +++ b/docs/source/conf.py @@ -0,0 +1,276 @@ +# PyMySQL documentation build configuration file, created by +# sphinx-quickstart on Tue May 17 12:01:11 2016. +# +# This file is execfile()d with the current directory set to its +# containing dir. +# +# Note that not all possible configuration values are present in this +# autogenerated file. +# +# All configuration values have a default; values that are commented out +# serve to show the default. + +import sys +import os + +# If extensions (or modules to document with autodoc) are in another directory, +# add these directories to sys.path here. If the directory is relative to the +# documentation root, use os.path.abspath to make it absolute, like shown here. +sys.path.insert(0, os.path.abspath("../../")) + +# -- General configuration ------------------------------------------------ + +# If your documentation needs a minimal Sphinx version, state it here. +# needs_sphinx = '1.0' + +# Add any Sphinx extension module names here, as strings. They can be +# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom +# ones. +extensions = [ + "sphinx.ext.autodoc", +] + +# Add any paths that contain templates here, relative to this directory. +templates_path = ["_templates"] + +# The suffix of source filenames. +source_suffix = ".rst" + +# The encoding of source files. +# source_encoding = 'utf-8-sig' + +# The master toctree document. +master_doc = "index" + +# General information about the project. +project = "PyMySQL" +copyright = "2023, Inada Naoki and GitHub contributors" + +# The version info for the project you're documenting, acts as replacement for +# |version| and |release|, also used in various other places throughout the +# built documents. +# +# The short X.Y version. +version = "0.7" +# The full version, including alpha/beta/rc tags. +release = "0.7.2" + +# The language for content autogenerated by Sphinx. Refer to documentation +# for a list of supported languages. +# language = None + +# There are two options for replacing |today|: either, you set today to some +# non-false value, then it is used: +# today = '' +# Else, today_fmt is used as the format for a strftime call. +# today_fmt = '%B %d, %Y' + +# List of patterns, relative to source directory, that match files and +# directories to ignore when looking for source files. +exclude_patterns = [] + +# The reST default role (used for this markup: `text`) to use for all +# documents. +# default_role = None + +# If true, '()' will be appended to :func: etc. cross-reference text. +# add_function_parentheses = True + +# If true, the current module name will be prepended to all description +# unit titles (such as .. function::). +# add_module_names = True + +# If true, sectionauthor and moduleauthor directives will be shown in the +# output. They are ignored by default. +# show_authors = False + +# The name of the Pygments (syntax highlighting) style to use. +pygments_style = "sphinx" + +# A list of ignored prefixes for module index sorting. +# modindex_common_prefix = [] + +# If true, keep warnings as "system message" paragraphs in the built documents. +# keep_warnings = False + + +# -- Options for HTML output ---------------------------------------------- + +# The theme to use for HTML and HTML Help pages. See the documentation for +# a list of builtin themes. +html_theme = "sphinx_rtd_theme" + +# Theme options are theme-specific and customize the look and feel of a theme +# further. For a list of options available for each theme, see the +# documentation. +# html_theme_options = {} + +# Add any paths that contain custom themes here, relative to this directory. +# html_theme_path = [] + +# The name for this set of Sphinx documents. If None, it defaults to +# " v documentation". +# html_title = None + +# A shorter title for the navigation bar. Default is the same as html_title. +# html_short_title = None + +# The name of an image file (relative to this directory) to place at the top +# of the sidebar. +# html_logo = None + +# The name of an image file (within the static path) to use as favicon of the +# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 +# pixels large. +# html_favicon = None + +# Add any paths that contain custom static files (such as style sheets) here, +# relative to this directory. They are copied after the builtin static files, +# so a file named "default.css" will overwrite the builtin "default.css". +html_static_path = ["_static"] + +# Add any extra paths that contain custom files (such as robots.txt or +# .htaccess) here, relative to this directory. These files are copied +# directly to the root of the documentation. +# html_extra_path = [] + +# If not '', a 'Last updated on:' timestamp is inserted at every page bottom, +# using the given strftime format. +# html_last_updated_fmt = '%b %d, %Y' + +# If true, SmartyPants will be used to convert quotes and dashes to +# typographically correct entities. +# html_use_smartypants = True + +# Custom sidebar templates, maps document names to template names. +# html_sidebars = {} + +# Additional templates that should be rendered to pages, maps page names to +# template names. +# html_additional_pages = {} + +# If false, no module index is generated. +# html_domain_indices = True + +# If false, no index is generated. +# html_use_index = True + +# If true, the index is split into individual pages for each letter. +# html_split_index = False + +# If true, links to the reST sources are added to the pages. +# html_show_sourcelink = True + +# If true, "Created using Sphinx" is shown in the HTML footer. Default is True. +# html_show_sphinx = True + +# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. +# html_show_copyright = True + +# If true, an OpenSearch description file will be output, and all pages will +# contain a tag referring to it. The value of this option must be the +# base URL from which the finished HTML is served. +# html_use_opensearch = '' + +# This is the file name suffix for HTML files (e.g. ".xhtml"). +# html_file_suffix = None + +# Output file base name for HTML help builder. +htmlhelp_basename = "PyMySQLdoc" + + +# -- Options for LaTeX output --------------------------------------------- + +latex_elements = { + # The paper size ('letterpaper' or 'a4paper'). + #'papersize': 'letterpaper', + # The font size ('10pt', '11pt' or '12pt'). + #'pointsize': '10pt', + # Additional stuff for the LaTeX preamble. + #'preamble': '', +} + +# Grouping the document tree into LaTeX files. List of tuples +# (source start file, target name, title, +# author, documentclass [howto, manual, or own class]). +latex_documents = [ + ( + "index", + "PyMySQL.tex", + "PyMySQL Documentation", + "Yutaka Matsubara and GitHub contributors", + "manual", + ), +] + +# The name of an image file (relative to this directory) to place at the top of +# the title page. +# latex_logo = None + +# For "manual" documents, if this is true, then toplevel headings are parts, +# not chapters. +# latex_use_parts = False + +# If true, show page references after internal links. +# latex_show_pagerefs = False + +# If true, show URL addresses after external links. +# latex_show_urls = False + +# Documents to append as an appendix to all manuals. +# latex_appendices = [] + +# If false, no module index is generated. +# latex_domain_indices = True + + +# -- Options for manual page output --------------------------------------- + +# One entry per manual page. List of tuples +# (source start file, name, description, authors, manual section). +man_pages = [ + ( + "index", + "pymysql", + "PyMySQL Documentation", + ["Yutaka Matsubara and GitHub contributors"], + 1, + ) +] + +# If true, show URL addresses after external links. +# man_show_urls = False + + +# -- Options for Texinfo output ------------------------------------------- + +# Grouping the document tree into Texinfo files. List of tuples +# (source start file, target name, title, author, +# dir menu entry, description, category) +texinfo_documents = [ + ( + "index", + "PyMySQL", + "PyMySQL Documentation", + "Yutaka Matsubara and GitHub contributors", + "PyMySQL", + "One line description of project.", + "Miscellaneous", + ), +] + +# Documents to append as an appendix to all manuals. +# texinfo_appendices = [] + +# If false, no module index is generated. +# texinfo_domain_indices = True + +# How to display URL addresses: 'footnote', 'no', or 'inline'. +# texinfo_show_urls = 'footnote' + +# If true, do not generate a @detailmenu in the "Top" node's menu. +# texinfo_no_detailmenu = False + + +# Example configuration for intersphinx: refer to the Python standard library. +intersphinx_mapping = {"http://docs.python.org/": None} diff --git a/docs/source/index.rst b/docs/source/index.rst new file mode 100644 index 000000000..e64b64238 --- /dev/null +++ b/docs/source/index.rst @@ -0,0 +1,17 @@ +PyMySQL documentation +===================== + +.. toctree:: + :maxdepth: 2 + + user/index + modules/index + + +Indices and tables +================== + +* :ref:`genindex` +* :ref:`modindex` +* :ref:`search` + diff --git a/docs/source/modules/connections.rst b/docs/source/modules/connections.rst new file mode 100644 index 000000000..7cce62fd3 --- /dev/null +++ b/docs/source/modules/connections.rst @@ -0,0 +1,11 @@ +Connection Object +================= + +.. module:: pymysql.connections + +.. autoclass:: Connection + :members: + :exclude-members: DataError, DatabaseError, Error, InterfaceError, + IntegrityError, InternalError, NotSupportedError, + OperationalError, ProgrammingError, Warning, + escape, literal, write_packet diff --git a/docs/source/modules/cursors.rst b/docs/source/modules/cursors.rst new file mode 100644 index 000000000..19706f3c3 --- /dev/null +++ b/docs/source/modules/cursors.rst @@ -0,0 +1,19 @@ +Cursor Objects +============== + +.. module:: pymysql.cursors + +.. autoclass:: Cursor + :members: + :exclude-members: DataError, DatabaseError, Error, InterfaceError, + IntegrityError, InternalError, NotSupportedError, + OperationalError, ProgrammingError, Warning + +.. autoclass:: SSCursor + :members: + +.. autoclass:: DictCursor + :members: + +.. autoclass:: SSDictCursor + :members: diff --git a/docs/source/modules/index.rst b/docs/source/modules/index.rst new file mode 100644 index 000000000..ef190a117 --- /dev/null +++ b/docs/source/modules/index.rst @@ -0,0 +1,14 @@ +API Reference +------------- + +If you are looking for information on a specific function, class or +method, this part of the documentation is for you. + +For more information, please read the `Python Database API specification +`_. + +.. toctree:: + :maxdepth: 2 + + connections + cursors diff --git a/docs/source/user/development.rst b/docs/source/user/development.rst new file mode 100644 index 000000000..2d80a6248 --- /dev/null +++ b/docs/source/user/development.rst @@ -0,0 +1,34 @@ +.. _development: + +=========== +Development +=========== + +You can help developing PyMySQL by `contributing on GitHub`_. + +.. _contributing on GitHub: https://github.com/PyMySQL/PyMySQL + +Building the documentation +-------------------------- + +Go to the ``docs`` directory and run ``make html``. + + +Test Suite +----------- + +If you would like to run the test suite, create a database for testing like this:: + + mysql -e 'create database test_pymysql DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' + mysql -e 'create database test_pymysql2 DEFAULT CHARACTER SET utf8 DEFAULT COLLATE utf8_general_ci;' + +Then, copy the file ``ci/database.json`` to ``pymysql/tests/databases.json`` +and edit the new file to match your MySQL configuration:: + + $ cp ci/database.json pymysql/tests/databases.json + $ $EDITOR pymysql/tests/databases.json + +To run all the tests, you can use pytest:: + + $ pip install -r requirements-dev.txt + $ pytest -v pymysql diff --git a/docs/source/user/examples.rst b/docs/source/user/examples.rst new file mode 100644 index 000000000..3946db9b9 --- /dev/null +++ b/docs/source/user/examples.rst @@ -0,0 +1,59 @@ +.. _examples: + +======== +Examples +======== + +.. _CRUD: + +CRUD +---- + +The following examples make use of a simple table + +.. code:: sql + + CREATE TABLE `users` ( + `id` int(11) NOT NULL AUTO_INCREMENT, + `email` varchar(255) COLLATE utf8_bin NOT NULL, + `password` varchar(255) COLLATE utf8_bin NOT NULL, + PRIMARY KEY (`id`) + ) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_bin + AUTO_INCREMENT=1 ; + + +.. code:: python + + import pymysql.cursors + + # Connect to the database + connection = pymysql.connect(host='localhost', + user='user', + password='passwd', + database='db', + charset='utf8mb4', + cursorclass=pymysql.cursors.DictCursor) + + with connection: + with connection.cursor() as cursor: + # Create a new record + sql = "INSERT INTO `users` (`email`, `password`) VALUES (%s, %s)" + cursor.execute(sql, ('webmaster@python.org', 'very-secret')) + + # connection is not autocommit by default. So you must commit to save + # your changes. + connection.commit() + + with connection.cursor() as cursor: + # Read a single record + sql = "SELECT `id`, `password` FROM `users` WHERE `email`=%s" + cursor.execute(sql, ('webmaster@python.org',)) + result = cursor.fetchone() + print(result) + + +This example will print: + +.. code:: python + + {'id': 1, 'password': 'very-secret'} diff --git a/docs/source/user/index.rst b/docs/source/user/index.rst new file mode 100644 index 000000000..17b9b07fb --- /dev/null +++ b/docs/source/user/index.rst @@ -0,0 +1,14 @@ +User Guide +------------ + +The PyMySQL user guide explains how to install PyMySQL and how to contribute to +the library as a developer. + + +.. toctree:: + :maxdepth: 1 + + installation + examples + resources + development diff --git a/docs/source/user/installation.rst b/docs/source/user/installation.rst new file mode 100644 index 000000000..9313f14d3 --- /dev/null +++ b/docs/source/user/installation.rst @@ -0,0 +1,32 @@ +.. _installation: + +============ +Installation +============ + +The last stable release is available on PyPI and can be installed with ``pip``:: + + $ python3 -m pip install PyMySQL + +To use "sha256_password" or "caching_sha2_password" for authenticate, +you need to install additional dependency:: + + $ python3 -m pip install PyMySQL[rsa] + +Requirements +------------- + +* Python -- one of the following: + + - CPython_ >= 3.7 + - Latest PyPy_ 3 + +* MySQL Server -- one of the following: + + - MySQL_ >= 5.7 + - MariaDB_ >= 10.3 + +.. _CPython: http://www.python.org/ +.. _PyPy: http://pypy.org/ +.. _MySQL: http://www.mysql.com/ +.. _MariaDB: https://mariadb.org/ diff --git a/docs/source/user/resources.rst b/docs/source/user/resources.rst new file mode 100644 index 000000000..19b3db931 --- /dev/null +++ b/docs/source/user/resources.rst @@ -0,0 +1,14 @@ +.. _resources: + +============ +Resources +============ + +DB-API 2.0: http://www.python.org/dev/peps/pep-0249 + +MySQL Reference Manuals: http://dev.mysql.com/doc/ + +MySQL client/server protocol: +http://dev.mysql.com/doc/internals/en/client-server-protocol.html + +PyMySQL mailing list: https://groups.google.com/forum/#!forum/pymysql-users diff --git a/example.py b/example.py index 3fe3ed56f..c12f103b5 100644 --- a/example.py +++ b/example.py @@ -1,21 +1,17 @@ #!/usr/bin/env python - -from __future__ import print_function - import pymysql -conn = pymysql.connect(host='localhost', port=3306, user='root', passwd='', db='mysql') +conn = pymysql.connect(host="localhost", port=3306, user="root", passwd="", db="mysql") cur = conn.cursor() cur.execute("SELECT Host,User FROM user") print(cur.description) - print() for row in cur: - print(row) + print(row) cur.close() conn.close() diff --git a/pymysql/__init__.py b/pymysql/__init__.py index 2236ff189..0ec7ae6eb 100644 --- a/pymysql/__init__.py +++ b/pymysql/__init__.py @@ -1,7 +1,7 @@ -''' +""" PyMySQL: A pure-Python MySQL client library. -Copyright (c) 2010, 2013 PyMySQL contributors +Copyright (c) 2010-2016 PyMySQL contributors Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal @@ -20,30 +20,66 @@ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +""" -''' - -VERSION = (0, 6, 7, None) +import sys -from ._compat import text_type, JYTHON, IRONPYTHON from .constants import FIELD_TYPE -from .converters import escape_dict, escape_sequence, escape_string -from .err import Warning, Error, InterfaceError, DataError, \ - DatabaseError, OperationalError, IntegrityError, InternalError, \ - NotSupportedError, ProgrammingError, MySQLError -from .times import Date, Time, Timestamp, \ - DateFromTicks, TimeFromTicks, TimestampFromTicks +from .err import ( + Warning, + Error, + InterfaceError, + DataError, + DatabaseError, + OperationalError, + IntegrityError, + InternalError, + NotSupportedError, + ProgrammingError, + MySQLError, +) +from .times import ( + Date, + Time, + Timestamp, + DateFromTicks, + TimeFromTicks, + TimestampFromTicks, +) + +# PyMySQL version. +# Used by setuptools and connection_attrs +VERSION = (1, 1, 2, "final") +VERSION_STRING = "1.1.2" + +### for mysqlclient compatibility +### Django checks mysqlclient version. +version_info = (1, 4, 6, "final", 1) +__version__ = "1.4.6" -import sys + +def get_client_info(): # for MySQLdb compatibility + return __version__ + + +def install_as_MySQLdb(): + """ + After this function is called, any application that imports MySQLdb + will unwittingly actually use pymysql. + """ + sys.modules["MySQLdb"] = sys.modules["pymysql"] +# end of mysqlclient compatibility code + threadsafety = 1 apilevel = "2.0" -paramstyle = "format" +paramstyle = "pyformat" -class DBAPISet(frozenset): +from . import connections # noqa: E402 +class DBAPISet(frozenset): def __ne__(self, other): if isinstance(other, set): return frozenset.__ne__(self, other) @@ -60,74 +96,88 @@ def __hash__(self): return frozenset.__hash__(self) -STRING = DBAPISet([FIELD_TYPE.ENUM, FIELD_TYPE.STRING, - FIELD_TYPE.VAR_STRING]) -BINARY = DBAPISet([FIELD_TYPE.BLOB, FIELD_TYPE.LONG_BLOB, - FIELD_TYPE.MEDIUM_BLOB, FIELD_TYPE.TINY_BLOB]) -NUMBER = DBAPISet([FIELD_TYPE.DECIMAL, FIELD_TYPE.DOUBLE, FIELD_TYPE.FLOAT, - FIELD_TYPE.INT24, FIELD_TYPE.LONG, FIELD_TYPE.LONGLONG, - FIELD_TYPE.TINY, FIELD_TYPE.YEAR]) -DATE = DBAPISet([FIELD_TYPE.DATE, FIELD_TYPE.NEWDATE]) -TIME = DBAPISet([FIELD_TYPE.TIME]) +STRING = DBAPISet([FIELD_TYPE.ENUM, FIELD_TYPE.STRING, FIELD_TYPE.VAR_STRING]) +BINARY = DBAPISet( + [ + FIELD_TYPE.BLOB, + FIELD_TYPE.LONG_BLOB, + FIELD_TYPE.MEDIUM_BLOB, + FIELD_TYPE.TINY_BLOB, + ] +) +NUMBER = DBAPISet( + [ + FIELD_TYPE.DECIMAL, + FIELD_TYPE.DOUBLE, + FIELD_TYPE.FLOAT, + FIELD_TYPE.INT24, + FIELD_TYPE.LONG, + FIELD_TYPE.LONGLONG, + FIELD_TYPE.TINY, + FIELD_TYPE.YEAR, + ] +) +DATE = DBAPISet([FIELD_TYPE.DATE, FIELD_TYPE.NEWDATE]) +TIME = DBAPISet([FIELD_TYPE.TIME]) TIMESTAMP = DBAPISet([FIELD_TYPE.TIMESTAMP, FIELD_TYPE.DATETIME]) -DATETIME = TIMESTAMP -ROWID = DBAPISet() +DATETIME = TIMESTAMP +ROWID = DBAPISet() + def Binary(x): """Return x as a binary type.""" - if isinstance(x, text_type) and not (JYTHON or IRONPYTHON): - return x.encode() return bytes(x) -def Connect(*args, **kwargs): - """ - Connect to the database; see connections.Connection.__init__() for - more information. - """ - from .connections import Connection - return Connection(*args, **kwargs) - -from pymysql import connections as _orig_conn -if _orig_conn.Connection.__init__.__doc__ is not None: - Connect.__doc__ = _orig_conn.Connection.__init__.__doc__ + (""" -See connections.Connection.__init__() for information about defaults. -""") -del _orig_conn - -def get_client_info(): # for MySQLdb compatibility - return '.'.join(map(str, VERSION)) -connect = Connection = Connect +def thread_safe(): + return True # match MySQLdb.thread_safe() -# we include a doctored version_info here for MySQLdb compatibility -version_info = (1,2,2,"final",0) +Connect = connect = Connection = connections.Connection NULL = "NULL" -__version__ = get_client_info() - -def thread_safe(): - return True # match MySQLdb.thread_safe() - -def install_as_MySQLdb(): - """ - After this function is called, any application that imports MySQLdb or - _mysql will unwittingly actually use - """ - sys.modules["MySQLdb"] = sys.modules["_mysql"] = sys.modules["pymysql"] __all__ = [ - 'BINARY', 'Binary', 'Connect', 'Connection', 'DATE', 'Date', - 'Time', 'Timestamp', 'DateFromTicks', 'TimeFromTicks', 'TimestampFromTicks', - 'DataError', 'DatabaseError', 'Error', 'FIELD_TYPE', 'IntegrityError', - 'InterfaceError', 'InternalError', 'MySQLError', 'NULL', 'NUMBER', - 'NotSupportedError', 'DBAPISet', 'OperationalError', 'ProgrammingError', - 'ROWID', 'STRING', 'TIME', 'TIMESTAMP', 'Warning', 'apilevel', 'connect', - 'connections', 'constants', 'converters', 'cursors', - 'escape_dict', 'escape_sequence', 'escape_string', 'get_client_info', - 'paramstyle', 'threadsafety', 'version_info', - + "BINARY", + "Binary", + "Connect", + "Connection", + "DATE", + "Date", + "Time", + "Timestamp", + "DateFromTicks", + "TimeFromTicks", + "TimestampFromTicks", + "DataError", + "DatabaseError", + "Error", + "FIELD_TYPE", + "IntegrityError", + "InterfaceError", + "InternalError", + "MySQLError", + "NULL", + "NUMBER", + "NotSupportedError", + "DBAPISet", + "OperationalError", + "ProgrammingError", + "ROWID", + "STRING", + "TIME", + "TIMESTAMP", + "Warning", + "apilevel", + "connect", + "connections", + "constants", + "converters", + "cursors", + "get_client_info", + "paramstyle", + "threadsafety", + "version_info", "install_as_MySQLdb", - - "NULL","__version__", - ] + "__version__", +] diff --git a/pymysql/_auth.py b/pymysql/_auth.py new file mode 100644 index 000000000..4790449b8 --- /dev/null +++ b/pymysql/_auth.py @@ -0,0 +1,272 @@ +""" +Implements auth methods +""" + +from .err import OperationalError + + +try: + from cryptography.hazmat.backends import default_backend + from cryptography.hazmat.primitives import serialization, hashes + from cryptography.hazmat.primitives.asymmetric import padding + + _have_cryptography = True +except ImportError: + _have_cryptography = False + +from functools import partial +import hashlib + + +DEBUG = False +SCRAMBLE_LENGTH = 20 +sha1_new = partial(hashlib.new, "sha1") + + +# mysql_native_password +# https://dev.mysql.com/doc/internals/en/secure-password-authentication.html#packet-Authentication::Native41 + + +def scramble_native_password(password, message): + """Scramble used for mysql_native_password""" + if not password: + return b"" + + stage1 = sha1_new(password).digest() + stage2 = sha1_new(stage1).digest() + s = sha1_new() + s.update(message[:SCRAMBLE_LENGTH]) + s.update(stage2) + result = s.digest() + return _my_crypt(result, stage1) + + +def _my_crypt(message1, message2): + result = bytearray(message1) + + for i in range(len(result)): + result[i] ^= message2[i] + + return bytes(result) + + +# MariaDB's client_ed25519-plugin +# https://mariadb.com/kb/en/library/connection/#client_ed25519-plugin + +_nacl_bindings = False + + +def _init_nacl(): + global _nacl_bindings + try: + from nacl import bindings + + _nacl_bindings = bindings + except ImportError: + raise RuntimeError( + "'pynacl' package is required for ed25519_password auth method" + ) + + +def _scalar_clamp(s32): + ba = bytearray(s32) + ba0 = bytes(bytearray([ba[0] & 248])) + ba31 = bytes(bytearray([(ba[31] & 127) | 64])) + return ba0 + bytes(s32[1:31]) + ba31 + + +def ed25519_password(password, scramble): + """Sign a random scramble with elliptic curve Ed25519. + + Secret and public key are derived from password. + """ + # variable names based on rfc8032 section-5.1.6 + # + if not _nacl_bindings: + _init_nacl() + + # h = SHA512(password) + h = hashlib.sha512(password).digest() + + # s = prune(first_half(h)) + s = _scalar_clamp(h[:32]) + + # r = SHA512(second_half(h) || M) + r = hashlib.sha512(h[32:] + scramble).digest() + + # R = encoded point [r]B + r = _nacl_bindings.crypto_core_ed25519_scalar_reduce(r) + R = _nacl_bindings.crypto_scalarmult_ed25519_base_noclamp(r) + + # A = encoded point [s]B + A = _nacl_bindings.crypto_scalarmult_ed25519_base_noclamp(s) + + # k = SHA512(R || A || M) + k = hashlib.sha512(R + A + scramble).digest() + + # S = (k * s + r) mod L + k = _nacl_bindings.crypto_core_ed25519_scalar_reduce(k) + ks = _nacl_bindings.crypto_core_ed25519_scalar_mul(k, s) + S = _nacl_bindings.crypto_core_ed25519_scalar_add(ks, r) + + # signature = R || S + return R + S + + +# sha256_password + + +def _roundtrip(conn, send_data): + conn.write_packet(send_data) + pkt = conn._read_packet() + pkt.check_error() + return pkt + + +def _xor_password(password, salt): + # Trailing NUL character will be added in Auth Switch Request. + # See https://github.com/mysql/mysql-server/blob/7d10c82196c8e45554f27c00681474a9fb86d137/sql/auth/sha2_password.cc#L939-L945 + salt = salt[:SCRAMBLE_LENGTH] + password_bytes = bytearray(password) + # salt = bytearray(salt) # for PY2 compat. + salt_len = len(salt) + for i in range(len(password_bytes)): + password_bytes[i] ^= salt[i % salt_len] + return bytes(password_bytes) + + +def sha2_rsa_encrypt(password, salt, public_key): + """Encrypt password with salt and public_key. + + Used for sha256_password and caching_sha2_password. + """ + if not _have_cryptography: + raise RuntimeError( + "'cryptography' package is required for sha256_password or" + + " caching_sha2_password auth methods" + ) + message = _xor_password(password + b"\0", salt) + rsa_key = serialization.load_pem_public_key(public_key, default_backend()) + return rsa_key.encrypt( + message, + padding.OAEP( + mgf=padding.MGF1(algorithm=hashes.SHA1()), + algorithm=hashes.SHA1(), + label=None, + ), + ) + + +def sha256_password_auth(conn, pkt): + if conn._secure: + if DEBUG: + print("sha256: Sending plain password") + data = conn.password + b"\0" + return _roundtrip(conn, data) + + if pkt.is_auth_switch_request(): + conn.salt = pkt.read_all() + if conn.salt.endswith(b"\0"): + conn.salt = conn.salt[:-1] + if not conn.server_public_key and conn.password: + # Request server public key + if DEBUG: + print("sha256: Requesting server public key") + pkt = _roundtrip(conn, b"\1") + + if pkt.is_extra_auth_data(): + conn.server_public_key = pkt._data[1:] + if DEBUG: + print("Received public key:\n", conn.server_public_key.decode("ascii")) + + if conn.password: + if not conn.server_public_key: + raise OperationalError("Couldn't receive server's public key") + + data = sha2_rsa_encrypt(conn.password, conn.salt, conn.server_public_key) + else: + data = b"" + + return _roundtrip(conn, data) + + +def scramble_caching_sha2(password, nonce): + # (bytes, bytes) -> bytes + """Scramble algorithm used in cached_sha2_password fast path. + + XOR(SHA256(password), SHA256(SHA256(SHA256(password)), nonce)) + """ + if not password: + return b"" + + p1 = hashlib.sha256(password).digest() + p2 = hashlib.sha256(p1).digest() + p3 = hashlib.sha256(p2 + nonce).digest() + + res = bytearray(p1) + for i in range(len(p3)): + res[i] ^= p3[i] + + return bytes(res) + + +def caching_sha2_password_auth(conn, pkt): + # No password fast path + if not conn.password: + return _roundtrip(conn, b"") + + if pkt.is_auth_switch_request(): + # Try from fast auth + conn.salt = pkt.read_all() + if conn.salt.endswith(b"\0"): # str.removesuffix is available in 3.9 + conn.salt = conn.salt[:-1] + if DEBUG: + print(f"caching sha2: Trying fast path. salt={conn.salt.hex()!r}") + scrambled = scramble_caching_sha2(conn.password, conn.salt) + pkt = _roundtrip(conn, scrambled) + # else: fast auth is tried in initial handshake + + if not pkt.is_extra_auth_data(): + raise OperationalError( + "caching sha2: Unknown packet for fast auth: %s" % pkt._data[:1] + ) + + # magic numbers: + # 2 - request public key + # 3 - fast auth succeeded + # 4 - need full auth + + pkt.advance(1) + n = pkt.read_uint8() + + if n == 3: + if DEBUG: + print("caching sha2: succeeded by fast path.") + pkt = conn._read_packet() + pkt.check_error() # pkt must be OK packet + return pkt + + if n != 4: + raise OperationalError("caching sha2: Unknown result for fast auth: %s" % n) + + if DEBUG: + print("caching sha2: Trying full auth...") + + if conn._secure: + if DEBUG: + print("caching sha2: Sending plain password via secure connection") + return _roundtrip(conn, conn.password + b"\0") + + if not conn.server_public_key: + pkt = _roundtrip(conn, b"\x02") # Request public key + if not pkt.is_extra_auth_data(): + raise OperationalError( + "caching sha2: Unknown packet for public key: %s" % pkt._data[:1] + ) + + conn.server_public_key = pkt._data[1:] + if DEBUG: + print(conn.server_public_key.decode("ascii")) + + data = sha2_rsa_encrypt(conn.password, conn.salt, conn.server_public_key) + pkt = _roundtrip(conn, data) diff --git a/pymysql/_compat.py b/pymysql/_compat.py deleted file mode 100644 index 0c5534677..000000000 --- a/pymysql/_compat.py +++ /dev/null @@ -1,18 +0,0 @@ -import sys - -PY2 = sys.version_info[0] == 2 -PYPY = hasattr(sys, 'pypy_translation_info') -JYTHON = sys.platform.startswith('java') -IRONPYTHON = sys.platform == 'cli' -CPYTHON = not PYPY and not JYTHON and not IRONPYTHON - -if PY2: - range_type = xrange - text_type = unicode - long_type = long - str_type = basestring -else: - range_type = range - text_type = str - long_type = int - str_type = str diff --git a/pymysql/_socketio.py b/pymysql/_socketio.py deleted file mode 100644 index 6a11d42e4..000000000 --- a/pymysql/_socketio.py +++ /dev/null @@ -1,134 +0,0 @@ -""" -SocketIO imported from socket module in Python 3. - -Copyright (c) 2001-2013 Python Software Foundation; All Rights Reserved. -""" - -from socket import * -import io -import errno - -__all__ = ['SocketIO'] - -EINTR = errno.EINTR -_blocking_errnos = (errno.EAGAIN, errno.EWOULDBLOCK) - -class SocketIO(io.RawIOBase): - - """Raw I/O implementation for stream sockets. - - This class supports the makefile() method on sockets. It provides - the raw I/O interface on top of a socket object. - """ - - # One might wonder why not let FileIO do the job instead. There are two - # main reasons why FileIO is not adapted: - # - it wouldn't work under Windows (where you can't used read() and - # write() on a socket handle) - # - it wouldn't work with socket timeouts (FileIO would ignore the - # timeout and consider the socket non-blocking) - - # XXX More docs - - def __init__(self, sock, mode): - if mode not in ("r", "w", "rw", "rb", "wb", "rwb"): - raise ValueError("invalid mode: %r" % mode) - io.RawIOBase.__init__(self) - self._sock = sock - if "b" not in mode: - mode += "b" - self._mode = mode - self._reading = "r" in mode - self._writing = "w" in mode - self._timeout_occurred = False - - def readinto(self, b): - """Read up to len(b) bytes into the writable buffer *b* and return - the number of bytes read. If the socket is non-blocking and no bytes - are available, None is returned. - - If *b* is non-empty, a 0 return value indicates that the connection - was shutdown at the other end. - """ - self._checkClosed() - self._checkReadable() - if self._timeout_occurred: - raise IOError("cannot read from timed out object") - while True: - try: - return self._sock.recv_into(b) - except timeout: - self._timeout_occurred = True - raise - except error as e: - n = e.args[0] - if n == EINTR: - continue - if n in _blocking_errnos: - return None - raise - - def write(self, b): - """Write the given bytes or bytearray object *b* to the socket - and return the number of bytes written. This can be less than - len(b) if not all data could be written. If the socket is - non-blocking and no bytes could be written None is returned. - """ - self._checkClosed() - self._checkWritable() - try: - return self._sock.send(b) - except error as e: - # XXX what about EINTR? - if e.args[0] in _blocking_errnos: - return None - raise - - def readable(self): - """True if the SocketIO is open for reading. - """ - if self.closed: - raise ValueError("I/O operation on closed socket.") - return self._reading - - def writable(self): - """True if the SocketIO is open for writing. - """ - if self.closed: - raise ValueError("I/O operation on closed socket.") - return self._writing - - def seekable(self): - """True if the SocketIO is open for seeking. - """ - if self.closed: - raise ValueError("I/O operation on closed socket.") - return super().seekable() - - def fileno(self): - """Return the file descriptor of the underlying socket. - """ - self._checkClosed() - return self._sock.fileno() - - @property - def name(self): - if not self.closed: - return self.fileno() - else: - return -1 - - @property - def mode(self): - return self._mode - - def close(self): - """Close the SocketIO object. This doesn't close the underlying - socket, except if all references to it have disappeared. - """ - if self.closed: - return - io.RawIOBase.close(self) - self._sock._decref_socketios() - self._sock = None - diff --git a/pymysql/charset.py b/pymysql/charset.py index 1cf7d9131..ec8e14e21 100644 --- a/pymysql/charset.py +++ b/pymysql/charset.py @@ -1,21 +1,29 @@ -MBLENGTH = { - 8:1, - 33:3, - 88:2, - 91:2 - } +# Internal use only. Do not use directly. +MBLENGTH = {8: 1, 33: 3, 88: 2, 91: 2} -class Charset(object): - def __init__(self, id, name, collation, is_default): + +class Charset: + def __init__(self, id, name, collation, is_default=False): self.id, self.name, self.collation = id, name, collation - self.is_default = is_default == 'Yes' + self.is_default = is_default + + def __repr__(self): + return ( + f"Charset(id={self.id}, name={self.name!r}, collation={self.collation!r})" + ) @property def encoding(self): name = self.name - if name == 'utf8mb4': - return 'utf8' + if name in ("utf8mb4", "utf8mb3"): + return "utf8" + if name == "latin1": + return "cp1252" + if name == "koi8r": + return "koi8_r" + if name == "koi8u": + return "koi8_u" return name @property @@ -26,237 +34,184 @@ def is_binary(self): class Charsets: def __init__(self): self._by_id = {} + self._by_name = {} def add(self, c): self._by_id[c.id] = c + if c.is_default: + self._by_name[c.name] = c def by_id(self, id): return self._by_id[id] def by_name(self, name): name = name.lower() - for c in self._by_id.values(): - if c.name == name and c.is_default: - return c + if name == "utf8": + name = "utf8mb4" + return self._by_name.get(name) + _charsets = Charsets() +charset_by_name = _charsets.by_name +charset_by_id = _charsets.by_id + """ +TODO: update this script. + Generated with: mysql -N -s -e "select id, character_set_name, collation_name, is_default from information_schema.collations order by id;" | python -c "import sys for l in sys.stdin.readlines(): - id, name, collation, is_default = l.split(chr(9)) - print '_charsets.add(Charset(%s, \'%s\', \'%s\', \'%s\'))' \ - % (id, name, collation, is_default.strip()) -" - + id, name, collation, is_default = l.split(chr(9)) + if is_default.strip() == "Yes": + print('_charsets.add(Charset(%s, \'%s\', \'%s\', True))' \ + % (id, name, collation)) + else: + print('_charsets.add(Charset(%s, \'%s\', \'%s\'))' \ + % (id, name, collation, bool(is_default.strip())) """ -_charsets.add(Charset(1, 'big5', 'big5_chinese_ci', 'Yes')) -_charsets.add(Charset(2, 'latin2', 'latin2_czech_cs', '')) -_charsets.add(Charset(3, 'dec8', 'dec8_swedish_ci', 'Yes')) -_charsets.add(Charset(4, 'cp850', 'cp850_general_ci', 'Yes')) -_charsets.add(Charset(5, 'latin1', 'latin1_german1_ci', '')) -_charsets.add(Charset(6, 'hp8', 'hp8_english_ci', 'Yes')) -_charsets.add(Charset(7, 'koi8r', 'koi8r_general_ci', 'Yes')) -_charsets.add(Charset(8, 'latin1', 'latin1_swedish_ci', 'Yes')) -_charsets.add(Charset(9, 'latin2', 'latin2_general_ci', 'Yes')) -_charsets.add(Charset(10, 'swe7', 'swe7_swedish_ci', 'Yes')) -_charsets.add(Charset(11, 'ascii', 'ascii_general_ci', 'Yes')) -_charsets.add(Charset(12, 'ujis', 'ujis_japanese_ci', 'Yes')) -_charsets.add(Charset(13, 'sjis', 'sjis_japanese_ci', 'Yes')) -_charsets.add(Charset(14, 'cp1251', 'cp1251_bulgarian_ci', '')) -_charsets.add(Charset(15, 'latin1', 'latin1_danish_ci', '')) -_charsets.add(Charset(16, 'hebrew', 'hebrew_general_ci', 'Yes')) -_charsets.add(Charset(18, 'tis620', 'tis620_thai_ci', 'Yes')) -_charsets.add(Charset(19, 'euckr', 'euckr_korean_ci', 'Yes')) -_charsets.add(Charset(20, 'latin7', 'latin7_estonian_cs', '')) -_charsets.add(Charset(21, 'latin2', 'latin2_hungarian_ci', '')) -_charsets.add(Charset(22, 'koi8u', 'koi8u_general_ci', 'Yes')) -_charsets.add(Charset(23, 'cp1251', 'cp1251_ukrainian_ci', '')) -_charsets.add(Charset(24, 'gb2312', 'gb2312_chinese_ci', 'Yes')) -_charsets.add(Charset(25, 'greek', 'greek_general_ci', 'Yes')) -_charsets.add(Charset(26, 'cp1250', 'cp1250_general_ci', 'Yes')) -_charsets.add(Charset(27, 'latin2', 'latin2_croatian_ci', '')) -_charsets.add(Charset(28, 'gbk', 'gbk_chinese_ci', 'Yes')) -_charsets.add(Charset(29, 'cp1257', 'cp1257_lithuanian_ci', '')) -_charsets.add(Charset(30, 'latin5', 'latin5_turkish_ci', 'Yes')) -_charsets.add(Charset(31, 'latin1', 'latin1_german2_ci', '')) -_charsets.add(Charset(32, 'armscii8', 'armscii8_general_ci', 'Yes')) -_charsets.add(Charset(33, 'utf8', 'utf8_general_ci', 'Yes')) -_charsets.add(Charset(34, 'cp1250', 'cp1250_czech_cs', '')) -_charsets.add(Charset(35, 'ucs2', 'ucs2_general_ci', 'Yes')) -_charsets.add(Charset(36, 'cp866', 'cp866_general_ci', 'Yes')) -_charsets.add(Charset(37, 'keybcs2', 'keybcs2_general_ci', 'Yes')) -_charsets.add(Charset(38, 'macce', 'macce_general_ci', 'Yes')) -_charsets.add(Charset(39, 'macroman', 'macroman_general_ci', 'Yes')) -_charsets.add(Charset(40, 'cp852', 'cp852_general_ci', 'Yes')) -_charsets.add(Charset(41, 'latin7', 'latin7_general_ci', 'Yes')) -_charsets.add(Charset(42, 'latin7', 'latin7_general_cs', '')) -_charsets.add(Charset(43, 'macce', 'macce_bin', '')) -_charsets.add(Charset(44, 'cp1250', 'cp1250_croatian_ci', '')) -_charsets.add(Charset(45, 'utf8mb4', 'utf8mb4_general_ci', 'Yes')) -_charsets.add(Charset(46, 'utf8mb4', 'utf8mb4_bin', '')) -_charsets.add(Charset(47, 'latin1', 'latin1_bin', '')) -_charsets.add(Charset(48, 'latin1', 'latin1_general_ci', '')) -_charsets.add(Charset(49, 'latin1', 'latin1_general_cs', '')) -_charsets.add(Charset(50, 'cp1251', 'cp1251_bin', '')) -_charsets.add(Charset(51, 'cp1251', 'cp1251_general_ci', 'Yes')) -_charsets.add(Charset(52, 'cp1251', 'cp1251_general_cs', '')) -_charsets.add(Charset(53, 'macroman', 'macroman_bin', '')) -_charsets.add(Charset(54, 'utf16', 'utf16_general_ci', 'Yes')) -_charsets.add(Charset(55, 'utf16', 'utf16_bin', '')) -_charsets.add(Charset(57, 'cp1256', 'cp1256_general_ci', 'Yes')) -_charsets.add(Charset(58, 'cp1257', 'cp1257_bin', '')) -_charsets.add(Charset(59, 'cp1257', 'cp1257_general_ci', 'Yes')) -_charsets.add(Charset(60, 'utf32', 'utf32_general_ci', 'Yes')) -_charsets.add(Charset(61, 'utf32', 'utf32_bin', '')) -_charsets.add(Charset(63, 'binary', 'binary', 'Yes')) -_charsets.add(Charset(64, 'armscii8', 'armscii8_bin', '')) -_charsets.add(Charset(65, 'ascii', 'ascii_bin', '')) -_charsets.add(Charset(66, 'cp1250', 'cp1250_bin', '')) -_charsets.add(Charset(67, 'cp1256', 'cp1256_bin', '')) -_charsets.add(Charset(68, 'cp866', 'cp866_bin', '')) -_charsets.add(Charset(69, 'dec8', 'dec8_bin', '')) -_charsets.add(Charset(70, 'greek', 'greek_bin', '')) -_charsets.add(Charset(71, 'hebrew', 'hebrew_bin', '')) -_charsets.add(Charset(72, 'hp8', 'hp8_bin', '')) -_charsets.add(Charset(73, 'keybcs2', 'keybcs2_bin', '')) -_charsets.add(Charset(74, 'koi8r', 'koi8r_bin', '')) -_charsets.add(Charset(75, 'koi8u', 'koi8u_bin', '')) -_charsets.add(Charset(77, 'latin2', 'latin2_bin', '')) -_charsets.add(Charset(78, 'latin5', 'latin5_bin', '')) -_charsets.add(Charset(79, 'latin7', 'latin7_bin', '')) -_charsets.add(Charset(80, 'cp850', 'cp850_bin', '')) -_charsets.add(Charset(81, 'cp852', 'cp852_bin', '')) -_charsets.add(Charset(82, 'swe7', 'swe7_bin', '')) -_charsets.add(Charset(83, 'utf8', 'utf8_bin', '')) -_charsets.add(Charset(84, 'big5', 'big5_bin', '')) -_charsets.add(Charset(85, 'euckr', 'euckr_bin', '')) -_charsets.add(Charset(86, 'gb2312', 'gb2312_bin', '')) -_charsets.add(Charset(87, 'gbk', 'gbk_bin', '')) -_charsets.add(Charset(88, 'sjis', 'sjis_bin', '')) -_charsets.add(Charset(89, 'tis620', 'tis620_bin', '')) -_charsets.add(Charset(90, 'ucs2', 'ucs2_bin', '')) -_charsets.add(Charset(91, 'ujis', 'ujis_bin', '')) -_charsets.add(Charset(92, 'geostd8', 'geostd8_general_ci', 'Yes')) -_charsets.add(Charset(93, 'geostd8', 'geostd8_bin', '')) -_charsets.add(Charset(94, 'latin1', 'latin1_spanish_ci', '')) -_charsets.add(Charset(95, 'cp932', 'cp932_japanese_ci', 'Yes')) -_charsets.add(Charset(96, 'cp932', 'cp932_bin', '')) -_charsets.add(Charset(97, 'eucjpms', 'eucjpms_japanese_ci', 'Yes')) -_charsets.add(Charset(98, 'eucjpms', 'eucjpms_bin', '')) -_charsets.add(Charset(99, 'cp1250', 'cp1250_polish_ci', '')) -_charsets.add(Charset(101, 'utf16', 'utf16_unicode_ci', '')) -_charsets.add(Charset(102, 'utf16', 'utf16_icelandic_ci', '')) -_charsets.add(Charset(103, 'utf16', 'utf16_latvian_ci', '')) -_charsets.add(Charset(104, 'utf16', 'utf16_romanian_ci', '')) -_charsets.add(Charset(105, 'utf16', 'utf16_slovenian_ci', '')) -_charsets.add(Charset(106, 'utf16', 'utf16_polish_ci', '')) -_charsets.add(Charset(107, 'utf16', 'utf16_estonian_ci', '')) -_charsets.add(Charset(108, 'utf16', 'utf16_spanish_ci', '')) -_charsets.add(Charset(109, 'utf16', 'utf16_swedish_ci', '')) -_charsets.add(Charset(110, 'utf16', 'utf16_turkish_ci', '')) -_charsets.add(Charset(111, 'utf16', 'utf16_czech_ci', '')) -_charsets.add(Charset(112, 'utf16', 'utf16_danish_ci', '')) -_charsets.add(Charset(113, 'utf16', 'utf16_lithuanian_ci', '')) -_charsets.add(Charset(114, 'utf16', 'utf16_slovak_ci', '')) -_charsets.add(Charset(115, 'utf16', 'utf16_spanish2_ci', '')) -_charsets.add(Charset(116, 'utf16', 'utf16_roman_ci', '')) -_charsets.add(Charset(117, 'utf16', 'utf16_persian_ci', '')) -_charsets.add(Charset(118, 'utf16', 'utf16_esperanto_ci', '')) -_charsets.add(Charset(119, 'utf16', 'utf16_hungarian_ci', '')) -_charsets.add(Charset(120, 'utf16', 'utf16_sinhala_ci', '')) -_charsets.add(Charset(128, 'ucs2', 'ucs2_unicode_ci', '')) -_charsets.add(Charset(129, 'ucs2', 'ucs2_icelandic_ci', '')) -_charsets.add(Charset(130, 'ucs2', 'ucs2_latvian_ci', '')) -_charsets.add(Charset(131, 'ucs2', 'ucs2_romanian_ci', '')) -_charsets.add(Charset(132, 'ucs2', 'ucs2_slovenian_ci', '')) -_charsets.add(Charset(133, 'ucs2', 'ucs2_polish_ci', '')) -_charsets.add(Charset(134, 'ucs2', 'ucs2_estonian_ci', '')) -_charsets.add(Charset(135, 'ucs2', 'ucs2_spanish_ci', '')) -_charsets.add(Charset(136, 'ucs2', 'ucs2_swedish_ci', '')) -_charsets.add(Charset(137, 'ucs2', 'ucs2_turkish_ci', '')) -_charsets.add(Charset(138, 'ucs2', 'ucs2_czech_ci', '')) -_charsets.add(Charset(139, 'ucs2', 'ucs2_danish_ci', '')) -_charsets.add(Charset(140, 'ucs2', 'ucs2_lithuanian_ci', '')) -_charsets.add(Charset(141, 'ucs2', 'ucs2_slovak_ci', '')) -_charsets.add(Charset(142, 'ucs2', 'ucs2_spanish2_ci', '')) -_charsets.add(Charset(143, 'ucs2', 'ucs2_roman_ci', '')) -_charsets.add(Charset(144, 'ucs2', 'ucs2_persian_ci', '')) -_charsets.add(Charset(145, 'ucs2', 'ucs2_esperanto_ci', '')) -_charsets.add(Charset(146, 'ucs2', 'ucs2_hungarian_ci', '')) -_charsets.add(Charset(147, 'ucs2', 'ucs2_sinhala_ci', '')) -_charsets.add(Charset(159, 'ucs2', 'ucs2_general_mysql500_ci', '')) -_charsets.add(Charset(160, 'utf32', 'utf32_unicode_ci', '')) -_charsets.add(Charset(161, 'utf32', 'utf32_icelandic_ci', '')) -_charsets.add(Charset(162, 'utf32', 'utf32_latvian_ci', '')) -_charsets.add(Charset(163, 'utf32', 'utf32_romanian_ci', '')) -_charsets.add(Charset(164, 'utf32', 'utf32_slovenian_ci', '')) -_charsets.add(Charset(165, 'utf32', 'utf32_polish_ci', '')) -_charsets.add(Charset(166, 'utf32', 'utf32_estonian_ci', '')) -_charsets.add(Charset(167, 'utf32', 'utf32_spanish_ci', '')) -_charsets.add(Charset(168, 'utf32', 'utf32_swedish_ci', '')) -_charsets.add(Charset(169, 'utf32', 'utf32_turkish_ci', '')) -_charsets.add(Charset(170, 'utf32', 'utf32_czech_ci', '')) -_charsets.add(Charset(171, 'utf32', 'utf32_danish_ci', '')) -_charsets.add(Charset(172, 'utf32', 'utf32_lithuanian_ci', '')) -_charsets.add(Charset(173, 'utf32', 'utf32_slovak_ci', '')) -_charsets.add(Charset(174, 'utf32', 'utf32_spanish2_ci', '')) -_charsets.add(Charset(175, 'utf32', 'utf32_roman_ci', '')) -_charsets.add(Charset(176, 'utf32', 'utf32_persian_ci', '')) -_charsets.add(Charset(177, 'utf32', 'utf32_esperanto_ci', '')) -_charsets.add(Charset(178, 'utf32', 'utf32_hungarian_ci', '')) -_charsets.add(Charset(179, 'utf32', 'utf32_sinhala_ci', '')) -_charsets.add(Charset(192, 'utf8', 'utf8_unicode_ci', '')) -_charsets.add(Charset(193, 'utf8', 'utf8_icelandic_ci', '')) -_charsets.add(Charset(194, 'utf8', 'utf8_latvian_ci', '')) -_charsets.add(Charset(195, 'utf8', 'utf8_romanian_ci', '')) -_charsets.add(Charset(196, 'utf8', 'utf8_slovenian_ci', '')) -_charsets.add(Charset(197, 'utf8', 'utf8_polish_ci', '')) -_charsets.add(Charset(198, 'utf8', 'utf8_estonian_ci', '')) -_charsets.add(Charset(199, 'utf8', 'utf8_spanish_ci', '')) -_charsets.add(Charset(200, 'utf8', 'utf8_swedish_ci', '')) -_charsets.add(Charset(201, 'utf8', 'utf8_turkish_ci', '')) -_charsets.add(Charset(202, 'utf8', 'utf8_czech_ci', '')) -_charsets.add(Charset(203, 'utf8', 'utf8_danish_ci', '')) -_charsets.add(Charset(204, 'utf8', 'utf8_lithuanian_ci', '')) -_charsets.add(Charset(205, 'utf8', 'utf8_slovak_ci', '')) -_charsets.add(Charset(206, 'utf8', 'utf8_spanish2_ci', '')) -_charsets.add(Charset(207, 'utf8', 'utf8_roman_ci', '')) -_charsets.add(Charset(208, 'utf8', 'utf8_persian_ci', '')) -_charsets.add(Charset(209, 'utf8', 'utf8_esperanto_ci', '')) -_charsets.add(Charset(210, 'utf8', 'utf8_hungarian_ci', '')) -_charsets.add(Charset(211, 'utf8', 'utf8_sinhala_ci', '')) -_charsets.add(Charset(223, 'utf8', 'utf8_general_mysql500_ci', '')) -_charsets.add(Charset(224, 'utf8mb4', 'utf8mb4_unicode_ci', '')) -_charsets.add(Charset(225, 'utf8mb4', 'utf8mb4_icelandic_ci', '')) -_charsets.add(Charset(226, 'utf8mb4', 'utf8mb4_latvian_ci', '')) -_charsets.add(Charset(227, 'utf8mb4', 'utf8mb4_romanian_ci', '')) -_charsets.add(Charset(228, 'utf8mb4', 'utf8mb4_slovenian_ci', '')) -_charsets.add(Charset(229, 'utf8mb4', 'utf8mb4_polish_ci', '')) -_charsets.add(Charset(230, 'utf8mb4', 'utf8mb4_estonian_ci', '')) -_charsets.add(Charset(231, 'utf8mb4', 'utf8mb4_spanish_ci', '')) -_charsets.add(Charset(232, 'utf8mb4', 'utf8mb4_swedish_ci', '')) -_charsets.add(Charset(233, 'utf8mb4', 'utf8mb4_turkish_ci', '')) -_charsets.add(Charset(234, 'utf8mb4', 'utf8mb4_czech_ci', '')) -_charsets.add(Charset(235, 'utf8mb4', 'utf8mb4_danish_ci', '')) -_charsets.add(Charset(236, 'utf8mb4', 'utf8mb4_lithuanian_ci', '')) -_charsets.add(Charset(237, 'utf8mb4', 'utf8mb4_slovak_ci', '')) -_charsets.add(Charset(238, 'utf8mb4', 'utf8mb4_spanish2_ci', '')) -_charsets.add(Charset(239, 'utf8mb4', 'utf8mb4_roman_ci', '')) -_charsets.add(Charset(240, 'utf8mb4', 'utf8mb4_persian_ci', '')) -_charsets.add(Charset(241, 'utf8mb4', 'utf8mb4_esperanto_ci', '')) -_charsets.add(Charset(242, 'utf8mb4', 'utf8mb4_hungarian_ci', '')) -_charsets.add(Charset(243, 'utf8mb4', 'utf8mb4_sinhala_ci', '')) - - -charset_by_name = _charsets.by_name -charset_by_id = _charsets.by_id - -def charset_to_encoding(name): - """Convert MySQL's charset name to Python's codec name""" - if name == 'utf8mb4': - return 'utf8' - return name +_charsets.add(Charset(1, "big5", "big5_chinese_ci", True)) +_charsets.add(Charset(2, "latin2", "latin2_czech_cs")) +_charsets.add(Charset(3, "dec8", "dec8_swedish_ci", True)) +_charsets.add(Charset(4, "cp850", "cp850_general_ci", True)) +_charsets.add(Charset(5, "latin1", "latin1_german1_ci")) +_charsets.add(Charset(6, "hp8", "hp8_english_ci", True)) +_charsets.add(Charset(7, "koi8r", "koi8r_general_ci", True)) +_charsets.add(Charset(8, "latin1", "latin1_swedish_ci", True)) +_charsets.add(Charset(9, "latin2", "latin2_general_ci", True)) +_charsets.add(Charset(10, "swe7", "swe7_swedish_ci", True)) +_charsets.add(Charset(11, "ascii", "ascii_general_ci", True)) +_charsets.add(Charset(12, "ujis", "ujis_japanese_ci", True)) +_charsets.add(Charset(13, "sjis", "sjis_japanese_ci", True)) +_charsets.add(Charset(14, "cp1251", "cp1251_bulgarian_ci")) +_charsets.add(Charset(15, "latin1", "latin1_danish_ci")) +_charsets.add(Charset(16, "hebrew", "hebrew_general_ci", True)) +_charsets.add(Charset(18, "tis620", "tis620_thai_ci", True)) +_charsets.add(Charset(19, "euckr", "euckr_korean_ci", True)) +_charsets.add(Charset(20, "latin7", "latin7_estonian_cs")) +_charsets.add(Charset(21, "latin2", "latin2_hungarian_ci")) +_charsets.add(Charset(22, "koi8u", "koi8u_general_ci", True)) +_charsets.add(Charset(23, "cp1251", "cp1251_ukrainian_ci")) +_charsets.add(Charset(24, "gb2312", "gb2312_chinese_ci", True)) +_charsets.add(Charset(25, "greek", "greek_general_ci", True)) +_charsets.add(Charset(26, "cp1250", "cp1250_general_ci", True)) +_charsets.add(Charset(27, "latin2", "latin2_croatian_ci")) +_charsets.add(Charset(28, "gbk", "gbk_chinese_ci", True)) +_charsets.add(Charset(29, "cp1257", "cp1257_lithuanian_ci")) +_charsets.add(Charset(30, "latin5", "latin5_turkish_ci", True)) +_charsets.add(Charset(31, "latin1", "latin1_german2_ci")) +_charsets.add(Charset(32, "armscii8", "armscii8_general_ci", True)) +_charsets.add(Charset(33, "utf8mb3", "utf8mb3_general_ci", True)) +_charsets.add(Charset(34, "cp1250", "cp1250_czech_cs")) +_charsets.add(Charset(36, "cp866", "cp866_general_ci", True)) +_charsets.add(Charset(37, "keybcs2", "keybcs2_general_ci", True)) +_charsets.add(Charset(38, "macce", "macce_general_ci", True)) +_charsets.add(Charset(39, "macroman", "macroman_general_ci", True)) +_charsets.add(Charset(40, "cp852", "cp852_general_ci", True)) +_charsets.add(Charset(41, "latin7", "latin7_general_ci", True)) +_charsets.add(Charset(42, "latin7", "latin7_general_cs")) +_charsets.add(Charset(43, "macce", "macce_bin")) +_charsets.add(Charset(44, "cp1250", "cp1250_croatian_ci")) +_charsets.add(Charset(45, "utf8mb4", "utf8mb4_general_ci", True)) +_charsets.add(Charset(46, "utf8mb4", "utf8mb4_bin")) +_charsets.add(Charset(47, "latin1", "latin1_bin")) +_charsets.add(Charset(48, "latin1", "latin1_general_ci")) +_charsets.add(Charset(49, "latin1", "latin1_general_cs")) +_charsets.add(Charset(50, "cp1251", "cp1251_bin")) +_charsets.add(Charset(51, "cp1251", "cp1251_general_ci", True)) +_charsets.add(Charset(52, "cp1251", "cp1251_general_cs")) +_charsets.add(Charset(53, "macroman", "macroman_bin")) +_charsets.add(Charset(57, "cp1256", "cp1256_general_ci", True)) +_charsets.add(Charset(58, "cp1257", "cp1257_bin")) +_charsets.add(Charset(59, "cp1257", "cp1257_general_ci", True)) +_charsets.add(Charset(63, "binary", "binary", True)) +_charsets.add(Charset(64, "armscii8", "armscii8_bin")) +_charsets.add(Charset(65, "ascii", "ascii_bin")) +_charsets.add(Charset(66, "cp1250", "cp1250_bin")) +_charsets.add(Charset(67, "cp1256", "cp1256_bin")) +_charsets.add(Charset(68, "cp866", "cp866_bin")) +_charsets.add(Charset(69, "dec8", "dec8_bin")) +_charsets.add(Charset(70, "greek", "greek_bin")) +_charsets.add(Charset(71, "hebrew", "hebrew_bin")) +_charsets.add(Charset(72, "hp8", "hp8_bin")) +_charsets.add(Charset(73, "keybcs2", "keybcs2_bin")) +_charsets.add(Charset(74, "koi8r", "koi8r_bin")) +_charsets.add(Charset(75, "koi8u", "koi8u_bin")) +_charsets.add(Charset(76, "utf8mb3", "utf8mb3_tolower_ci")) +_charsets.add(Charset(77, "latin2", "latin2_bin")) +_charsets.add(Charset(78, "latin5", "latin5_bin")) +_charsets.add(Charset(79, "latin7", "latin7_bin")) +_charsets.add(Charset(80, "cp850", "cp850_bin")) +_charsets.add(Charset(81, "cp852", "cp852_bin")) +_charsets.add(Charset(82, "swe7", "swe7_bin")) +_charsets.add(Charset(83, "utf8mb3", "utf8mb3_bin")) +_charsets.add(Charset(84, "big5", "big5_bin")) +_charsets.add(Charset(85, "euckr", "euckr_bin")) +_charsets.add(Charset(86, "gb2312", "gb2312_bin")) +_charsets.add(Charset(87, "gbk", "gbk_bin")) +_charsets.add(Charset(88, "sjis", "sjis_bin")) +_charsets.add(Charset(89, "tis620", "tis620_bin")) +_charsets.add(Charset(91, "ujis", "ujis_bin")) +_charsets.add(Charset(92, "geostd8", "geostd8_general_ci", True)) +_charsets.add(Charset(93, "geostd8", "geostd8_bin")) +_charsets.add(Charset(94, "latin1", "latin1_spanish_ci")) +_charsets.add(Charset(95, "cp932", "cp932_japanese_ci", True)) +_charsets.add(Charset(96, "cp932", "cp932_bin")) +_charsets.add(Charset(97, "eucjpms", "eucjpms_japanese_ci", True)) +_charsets.add(Charset(98, "eucjpms", "eucjpms_bin")) +_charsets.add(Charset(99, "cp1250", "cp1250_polish_ci")) +_charsets.add(Charset(192, "utf8mb3", "utf8mb3_unicode_ci")) +_charsets.add(Charset(193, "utf8mb3", "utf8mb3_icelandic_ci")) +_charsets.add(Charset(194, "utf8mb3", "utf8mb3_latvian_ci")) +_charsets.add(Charset(195, "utf8mb3", "utf8mb3_romanian_ci")) +_charsets.add(Charset(196, "utf8mb3", "utf8mb3_slovenian_ci")) +_charsets.add(Charset(197, "utf8mb3", "utf8mb3_polish_ci")) +_charsets.add(Charset(198, "utf8mb3", "utf8mb3_estonian_ci")) +_charsets.add(Charset(199, "utf8mb3", "utf8mb3_spanish_ci")) +_charsets.add(Charset(200, "utf8mb3", "utf8mb3_swedish_ci")) +_charsets.add(Charset(201, "utf8mb3", "utf8mb3_turkish_ci")) +_charsets.add(Charset(202, "utf8mb3", "utf8mb3_czech_ci")) +_charsets.add(Charset(203, "utf8mb3", "utf8mb3_danish_ci")) +_charsets.add(Charset(204, "utf8mb3", "utf8mb3_lithuanian_ci")) +_charsets.add(Charset(205, "utf8mb3", "utf8mb3_slovak_ci")) +_charsets.add(Charset(206, "utf8mb3", "utf8mb3_spanish2_ci")) +_charsets.add(Charset(207, "utf8mb3", "utf8mb3_roman_ci")) +_charsets.add(Charset(208, "utf8mb3", "utf8mb3_persian_ci")) +_charsets.add(Charset(209, "utf8mb3", "utf8mb3_esperanto_ci")) +_charsets.add(Charset(210, "utf8mb3", "utf8mb3_hungarian_ci")) +_charsets.add(Charset(211, "utf8mb3", "utf8mb3_sinhala_ci")) +_charsets.add(Charset(212, "utf8mb3", "utf8mb3_german2_ci")) +_charsets.add(Charset(213, "utf8mb3", "utf8mb3_croatian_ci")) +_charsets.add(Charset(214, "utf8mb3", "utf8mb3_unicode_520_ci")) +_charsets.add(Charset(215, "utf8mb3", "utf8mb3_vietnamese_ci")) +_charsets.add(Charset(223, "utf8mb3", "utf8mb3_general_mysql500_ci")) +_charsets.add(Charset(224, "utf8mb4", "utf8mb4_unicode_ci")) +_charsets.add(Charset(225, "utf8mb4", "utf8mb4_icelandic_ci")) +_charsets.add(Charset(226, "utf8mb4", "utf8mb4_latvian_ci")) +_charsets.add(Charset(227, "utf8mb4", "utf8mb4_romanian_ci")) +_charsets.add(Charset(228, "utf8mb4", "utf8mb4_slovenian_ci")) +_charsets.add(Charset(229, "utf8mb4", "utf8mb4_polish_ci")) +_charsets.add(Charset(230, "utf8mb4", "utf8mb4_estonian_ci")) +_charsets.add(Charset(231, "utf8mb4", "utf8mb4_spanish_ci")) +_charsets.add(Charset(232, "utf8mb4", "utf8mb4_swedish_ci")) +_charsets.add(Charset(233, "utf8mb4", "utf8mb4_turkish_ci")) +_charsets.add(Charset(234, "utf8mb4", "utf8mb4_czech_ci")) +_charsets.add(Charset(235, "utf8mb4", "utf8mb4_danish_ci")) +_charsets.add(Charset(236, "utf8mb4", "utf8mb4_lithuanian_ci")) +_charsets.add(Charset(237, "utf8mb4", "utf8mb4_slovak_ci")) +_charsets.add(Charset(238, "utf8mb4", "utf8mb4_spanish2_ci")) +_charsets.add(Charset(239, "utf8mb4", "utf8mb4_roman_ci")) +_charsets.add(Charset(240, "utf8mb4", "utf8mb4_persian_ci")) +_charsets.add(Charset(241, "utf8mb4", "utf8mb4_esperanto_ci")) +_charsets.add(Charset(242, "utf8mb4", "utf8mb4_hungarian_ci")) +_charsets.add(Charset(243, "utf8mb4", "utf8mb4_sinhala_ci")) +_charsets.add(Charset(244, "utf8mb4", "utf8mb4_german2_ci")) +_charsets.add(Charset(245, "utf8mb4", "utf8mb4_croatian_ci")) +_charsets.add(Charset(246, "utf8mb4", "utf8mb4_unicode_520_ci")) +_charsets.add(Charset(247, "utf8mb4", "utf8mb4_vietnamese_ci")) +_charsets.add(Charset(248, "gb18030", "gb18030_chinese_ci", True)) +_charsets.add(Charset(249, "gb18030", "gb18030_bin")) +_charsets.add(Charset(250, "gb18030", "gb18030_unicode_520_ci")) +_charsets.add(Charset(255, "utf8mb4", "utf8mb4_0900_ai_ci")) diff --git a/pymysql/connections.py b/pymysql/connections.py index 5cdea41c6..99fcfcd0b 100644 --- a/pymysql/connections.py +++ b/pymysql/connections.py @@ -1,14 +1,8 @@ # Python implementation of the MySQL client-server protocol # http://dev.mysql.com/doc/internals/en/client-server-protocol.html # Error codes: -# http://dev.mysql.com/doc/refman/5.5/en/error-messages-client.html -from __future__ import print_function -from ._compat import PY2, range_type, text_type, str_type, JYTHON, IRONPYTHON - +# https://dev.mysql.com/doc/refman/5.5/en/error-handling.html import errno -from functools import partial -import hashlib -import io import os import socket import struct @@ -16,17 +10,26 @@ import traceback import warnings -from .charset import MBLENGTH, charset_by_name, charset_by_id -from .constants import CLIENT, COMMAND, FIELD_TYPE, SERVER_STATUS -from .converters import ( - escape_item, encoders, decoders, escape_string, through) +from . import _auth + +from .charset import charset_by_name, charset_by_id +from .constants import CLIENT, COMMAND, CR, ER, FIELD_TYPE, SERVER_STATUS +from . import converters from .cursors import Cursor from .optionfile import Parser -from .util import byte2int, int2byte -from . import err +from .protocol import ( + dump_packet, + MysqlPacket, + FieldDescriptorPacket, + OKPacketWrapper, + EOFPacketWrapper, + LoadLocalPacketWrapper, +) +from . import err, VERSION_STRING try: import ssl + SSL_ENABLED = True except ImportError: ssl = None @@ -34,56 +37,19 @@ try: import getpass + DEFAULT_USER = getpass.getuser() del getpass -except ImportError: +except (ImportError, KeyError, OSError): + # When there's no entry in OS database for a current user: + # KeyError is raised in Python 3.12 and below. + # OSError is raised in Python 3.13+ DEFAULT_USER = None - DEBUG = False +_DEFAULT_AUTH_PLUGIN = None # if this is not None, use it instead of server's default. -_py_version = sys.version_info[:2] - - -# socket.makefile() in Python 2 is not usable because very inefficient and -# bad behavior about timeout. -# XXX: ._socketio doesn't work under IronPython. -if _py_version == (2, 7) and not IRONPYTHON: - # read method of file-like returned by sock.makefile() is very slow. - # So we copy io-based one from Python 3. - from ._socketio import SocketIO - - def _makefile(sock, mode): - return io.BufferedReader(SocketIO(sock, mode)) -elif _py_version == (2, 6): - # Python 2.6 doesn't have fast io module. - # So we make original one. - class SockFile(object): - def __init__(self, sock): - self._sock = sock - - def read(self, n): - read = self._sock.recv(n) - if len(read) == n: - return read - while True: - data = self._sock.recv(n-len(read)) - if not data: - return read - read += data - if len(read) == n: - return read - - def _makefile(sock, mode): - assert mode == 'rb' - return SockFile(sock) -else: - # socket.makefile in Python 3 is nice. - def _makefile(sock, mode): - return sock.makefile(mode) - - -TEXT_TYPES = set([ +TEXT_TYPES = { FIELD_TYPE.BIT, FIELD_TYPE.BLOB, FIELD_TYPE.LONG_BLOB, @@ -92,497 +58,183 @@ def _makefile(sock, mode): FIELD_TYPE.TINY_BLOB, FIELD_TYPE.VAR_STRING, FIELD_TYPE.VARCHAR, - FIELD_TYPE.GEOMETRY]) - -sha_new = partial(hashlib.new, 'sha1') - -NULL_COLUMN = 251 -UNSIGNED_CHAR_COLUMN = 251 -UNSIGNED_SHORT_COLUMN = 252 -UNSIGNED_INT24_COLUMN = 253 -UNSIGNED_INT64_COLUMN = 254 - -DEFAULT_CHARSET = 'latin1' - -MAX_PACKET_LEN = 2**24-1 - - -def dump_packet(data): # pragma: no cover - def is_ascii(data): - if 65 <= byte2int(data) <= 122: - if isinstance(data, int): - return chr(data) - return data - return '.' - - try: - print("packet length:", len(data)) - print("method call[1]:", sys._getframe(1).f_code.co_name) - print("method call[2]:", sys._getframe(2).f_code.co_name) - print("method call[3]:", sys._getframe(3).f_code.co_name) - print("method call[4]:", sys._getframe(4).f_code.co_name) - print("method call[5]:", sys._getframe(5).f_code.co_name) - print("-" * 88) - except ValueError: - pass - dump_data = [data[i:i+16] for i in range_type(0, min(len(data), 256), 16)] - for d in dump_data: - print(' '.join(map(lambda x: "{:02X}".format(byte2int(x)), d)) + - ' ' * (16 - len(d)) + ' ' * 2 + - ' '.join(map(lambda x: "{}".format(is_ascii(x)), d))) - print("-" * 88) - print() - - -def _scramble(password, message): - if not password: - return b'\0' - if DEBUG: print('password=' + str(password)) - stage1 = sha_new(password).digest() - stage2 = sha_new(stage1).digest() - s = sha_new() - s.update(message) - s.update(stage2) - result = s.digest() - return _my_crypt(result, stage1) - - -def _my_crypt(message1, message2): - length = len(message1) - result = struct.pack('B', length) - for i in range_type(length): - x = (struct.unpack('B', message1[i:i+1])[0] ^ - struct.unpack('B', message2[i:i+1])[0]) - result += struct.pack('B', x) - return result - -# old_passwords support ported from libmysql/password.c -SCRAMBLE_LENGTH_323 = 8 - - -class RandStruct_323(object): - def __init__(self, seed1, seed2): - self.max_value = 0x3FFFFFFF - self.seed1 = seed1 % self.max_value - self.seed2 = seed2 % self.max_value - - def my_rnd(self): - self.seed1 = (self.seed1 * 3 + self.seed2) % self.max_value - self.seed2 = (self.seed1 + self.seed2 + 33) % self.max_value - return float(self.seed1) / float(self.max_value) - - -def _scramble_323(password, message): - hash_pass = _hash_password_323(password) - hash_message = _hash_password_323(message[:SCRAMBLE_LENGTH_323]) - hash_pass_n = struct.unpack(">LL", hash_pass) - hash_message_n = struct.unpack(">LL", hash_message) - - rand_st = RandStruct_323(hash_pass_n[0] ^ hash_message_n[0], - hash_pass_n[1] ^ hash_message_n[1]) - outbuf = io.BytesIO() - for _ in range_type(min(SCRAMBLE_LENGTH_323, len(message))): - outbuf.write(int2byte(int(rand_st.my_rnd() * 31) + 64)) - extra = int2byte(int(rand_st.my_rnd() * 31)) - out = outbuf.getvalue() - outbuf = io.BytesIO() - for c in out: - outbuf.write(int2byte(byte2int(c) ^ byte2int(extra))) - return outbuf.getvalue() - - -def _hash_password_323(password): - nr = 1345345333 - add = 7 - nr2 = 0x12345671 - - for c in [byte2int(x) for x in password if x not in (' ', '\t')]: - nr ^= (((nr & 63) + add) * c) + (nr << 8) & 0xFFFFFFFF - nr2 = (nr2 + ((nr2 << 8) ^ nr)) & 0xFFFFFFFF - add = (add + c) & 0xFFFFFFFF - - r1 = nr & ((1 << 31) - 1) # kill sign bits - r2 = nr2 & ((1 << 31) - 1) - return struct.pack(">LL", r1, r2) - - -def pack_int24(n): - return struct.pack(' len(self._data): - raise Exception('Invalid advance amount (%s) for cursor. ' - 'Position=%s' % (length, new_position)) - self._position = new_position - - def rewind(self, position=0): - """Set the position of the data buffer cursor to 'position'.""" - if position < 0 or position > len(self._data): - raise Exception("Invalid position to rewind cursor to: %s." % position) - self._position = position - - def get_bytes(self, position, length=1): - """Get 'length' bytes starting at 'position'. - - Position is start of payload (first four packet header bytes are not - included) starting at index '0'. - - No error checking is done. If requesting outside end of buffer - an empty string (or string shorter than 'length') may be returned! - """ - return self._data[position:(position+length)] - - if PY2: - def read_uint8(self): - result = ord(self._data[self._position]) - self._position += 1 - return result - else: - def read_uint8(self): - result = self._data[self._position] - self._position += 1 - return result - - def read_uint16(self): - result = struct.unpack_from('`_ in the + specification. """ - socket = None - - def __init__(self, host="localhost", user=None, password="", - database=None, port=3306, unix_socket=None, - charset='', sql_mode=None, - read_default_file=None, conv=decoders, use_unicode=None, - client_flag=0, cursorclass=Cursor, init_command=None, - connect_timeout=None, ssl=None, read_default_group=None, - compress=None, named_pipe=None, no_delay=None, - autocommit=False, db=None, passwd=None, local_infile=False, - max_allowed_packet=16*1024*1024, defer_connect=False): - """ - Establish a connection to the MySQL database. Accepts several - arguments: - - host: Host where the database server is located - user: Username to log in as - password: Password to use. - database: Database to use, None to not use a particular one. - port: MySQL port to use, default is usually OK. - unix_socket: Optionally, you can use a unix socket rather than TCP/IP. - charset: Charset you want to use. - sql_mode: Default SQL_MODE to use. - read_default_file: - Specifies my.cnf file to read these parameters from under the [client] section. - conv: - Decoders dictionary to use instead of the default one. - This is used to provide custom marshalling of types. See converters. - use_unicode: - Whether or not to default to unicode strings. - This option defaults to true for Py3k. - client_flag: Custom flags to send to MySQL. Find potential values in constants.CLIENT. - cursorclass: Custom cursor class to use. - init_command: Initial SQL statement to run when connection is established. - connect_timeout: Timeout before throwing an exception when connecting. - ssl: - A dict of arguments similar to mysql_ssl_set()'s parameters. - For now the capath and cipher arguments are not supported. - read_default_group: Group to read from in the configuration file. - compress; Not supported - named_pipe: Not supported - no_delay: Disable Nagle's algorithm on the socket. (deprecated, default: True) - autocommit: Autocommit mode. None means use server default. (default: False) - local_infile: Boolean to enable the use of LOAD DATA LOCAL command. (default: False) - max_allowed_packet: Max size of packet sent to server in bytes. (default: 16MB) - defer_connect: Don't explicitly connect on contruction - wait for connect call. - (default: False) - - db: Alias for database. (for compatibility to MySQLdb) - passwd: Alias for password. (for compatibility to MySQLdb) - """ - if no_delay is not None: - warnings.warn("no_delay option is deprecated", DeprecationWarning) - no_delay = bool(no_delay) - else: - no_delay = True - - if use_unicode is None and sys.version_info[0] > 2: - use_unicode = True - + _sock = None + _rfile = None + _auth_plugin_name = "" + _closed = False + _secure = False + + def __init__( + self, + *, + user=None, # The first four arguments is based on DB-API 2.0 recommendation. + password="", + host=None, + database=None, + unix_socket=None, + port=0, + charset="", + collation=None, + sql_mode=None, + read_default_file=None, + conv=None, + use_unicode=True, + client_flag=0, + cursorclass=Cursor, + init_command=None, + connect_timeout=10, + read_default_group=None, + autocommit=False, + local_infile=False, + max_allowed_packet=16 * 1024 * 1024, + defer_connect=False, + auth_plugin_map=None, + read_timeout=None, + write_timeout=None, + bind_address=None, + binary_prefix=False, + program_name=None, + server_public_key=None, + ssl=None, + ssl_ca=None, + ssl_cert=None, + ssl_disabled=None, + ssl_key=None, + ssl_key_password=None, + ssl_verify_cert=None, + ssl_verify_identity=None, + compress=None, # not supported + named_pipe=None, # not supported + passwd=None, # deprecated + db=None, # deprecated + ): if db is not None and database is None: + # We will raise warning in 2022 or later. + # See https://github.com/PyMySQL/PyMySQL/issues/939 + # warnings.warn("'db' is deprecated, use 'database'", DeprecationWarning, 3) database = db if passwd is not None and not password: + # We will raise warning in 2022 or later. + # See https://github.com/PyMySQL/PyMySQL/issues/939 + # warnings.warn( + # "'passwd' is deprecated, use 'password'", DeprecationWarning, 3 + # ) password = passwd if compress or named_pipe: - raise NotImplementedError("compress and named_pipe arguments are not supported") + raise NotImplementedError( + "compress and named_pipe arguments are not supported" + ) - if local_infile: + self._local_infile = bool(local_infile) + if self._local_infile: client_flag |= CLIENT.LOCAL_FILES - if ssl and ('capath' in ssl or 'cipher' in ssl): - raise NotImplementedError('ssl options capath and cipher are not supported') - - self.ssl = False - if ssl: - if not SSL_ENABLED: - raise NotImplementedError("ssl module not found") - self.ssl = True - client_flag |= CLIENT.SSL - for k in ('key', 'cert', 'ca'): - v = None - if k in ssl: - v = ssl[k] - setattr(self, k, v) - if read_default_group and not read_default_file: if sys.platform.startswith("win"): read_default_file = "c:\\my.ini" @@ -610,80 +262,196 @@ def _config(key, arg): database = _config("database", database) unix_socket = _config("socket", unix_socket) port = int(_config("port", port)) + bind_address = _config("bind-address", bind_address) charset = _config("default-character-set", charset) + if not ssl: + ssl = {} + if isinstance(ssl, dict): + for key in ["ca", "capath", "cert", "key", "password", "cipher"]: + value = _config("ssl-" + key, ssl.get(key)) + if value: + ssl[key] = value - self.host = host - self.port = port + self.ssl = False + if not ssl_disabled: + if ssl_ca or ssl_cert or ssl_key or ssl_verify_cert or ssl_verify_identity: + ssl = { + "ca": ssl_ca, + "check_hostname": bool(ssl_verify_identity), + "verify_mode": ssl_verify_cert + if ssl_verify_cert is not None + else False, + } + if ssl_cert is not None: + ssl["cert"] = ssl_cert + if ssl_key is not None: + ssl["key"] = ssl_key + if ssl_key_password is not None: + ssl["password"] = ssl_key_password + if ssl: + if not SSL_ENABLED: + raise NotImplementedError("ssl module not found") + self.ssl = True + client_flag |= CLIENT.SSL + self.ctx = self._create_ssl_ctx(ssl) + + self.host = host or "localhost" + self.port = port or 3306 + if type(self.port) is not int: + raise ValueError("port should be of type int") self.user = user or DEFAULT_USER - self.password = password or "" + self.password = password or b"" + if isinstance(self.password, str): + self.password = self.password.encode("latin1") self.db = database - self.no_delay = no_delay self.unix_socket = unix_socket - if charset: - self.charset = charset - self.use_unicode = True - else: - self.charset = DEFAULT_CHARSET - self.use_unicode = False - - if use_unicode is not None: - self.use_unicode = use_unicode + self.bind_address = bind_address + if not (0 < connect_timeout <= 31536000): + raise ValueError("connect_timeout should be >0 and <=31536000") + self.connect_timeout = connect_timeout or None + if read_timeout is not None and read_timeout <= 0: + raise ValueError("read_timeout should be > 0") + self._read_timeout = read_timeout + if write_timeout is not None and write_timeout <= 0: + raise ValueError("write_timeout should be > 0") + self._write_timeout = write_timeout + + self.charset = charset or DEFAULT_CHARSET + self.collation = collation + self.use_unicode = use_unicode self.encoding = charset_by_name(self.charset).encoding - client_flag |= CLIENT.CAPABILITIES | CLIENT.MULTI_STATEMENTS + client_flag |= CLIENT.CAPABILITIES if self.db: client_flag |= CLIENT.CONNECT_WITH_DB + self.client_flag = client_flag self.cursorclass = cursorclass - self.connect_timeout = connect_timeout self._result = None self._affected_rows = 0 self.host_info = "Not connected" - #: specified autocommit mode. None means use server default. + # specified autocommit mode. None means use server default. self.autocommit_mode = autocommit - self.encoders = encoders # Need for MySQLdb compatibility. - self.decoders = conv + if conv is None: + conv = converters.conversions + + # Need for MySQLdb compatibility. + self.encoders = {k: v for (k, v) in conv.items() if type(k) is not int} + self.decoders = {k: v for (k, v) in conv.items() if type(k) is int} self.sql_mode = sql_mode self.init_command = init_command self.max_allowed_packet = max_allowed_packet + self._auth_plugin_map = auth_plugin_map or {} + self._binary_prefix = binary_prefix + self.server_public_key = server_public_key + + self._connect_attrs = { + "_client_name": "pymysql", + "_client_version": VERSION_STRING, + "_pid": str(os.getpid()), + } + + if program_name: + self._connect_attrs["program_name"] = program_name + if defer_connect: - self.socket = None + self._sock = None else: self.connect() + def __enter__(self): + return self + + def __exit__(self, *exc_info): + del exc_info + self.close() + + def _create_ssl_ctx(self, sslp): + if isinstance(sslp, ssl.SSLContext): + return sslp + ca = sslp.get("ca") + capath = sslp.get("capath") + hasnoca = ca is None and capath is None + ctx = ssl.create_default_context(cafile=ca, capath=capath) + + # Python 3.13 enables VERIFY_X509_STRICT by default. + # But self signed certificates that are generated by MySQL automatically + # doesn't pass the verification. + ctx.verify_flags &= ~ssl.VERIFY_X509_STRICT + + ctx.check_hostname = not hasnoca and sslp.get("check_hostname", True) + verify_mode_value = sslp.get("verify_mode") + if verify_mode_value is None: + ctx.verify_mode = ssl.CERT_NONE if hasnoca else ssl.CERT_REQUIRED + elif isinstance(verify_mode_value, bool): + ctx.verify_mode = ssl.CERT_REQUIRED if verify_mode_value else ssl.CERT_NONE + else: + if isinstance(verify_mode_value, str): + verify_mode_value = verify_mode_value.lower() + if verify_mode_value in ("none", "0", "false", "no"): + ctx.verify_mode = ssl.CERT_NONE + elif verify_mode_value == "optional": + ctx.verify_mode = ssl.CERT_OPTIONAL + elif verify_mode_value in ("required", "1", "true", "yes"): + ctx.verify_mode = ssl.CERT_REQUIRED + else: + ctx.verify_mode = ssl.CERT_NONE if hasnoca else ssl.CERT_REQUIRED + if "cert" in sslp: + ctx.load_cert_chain( + sslp["cert"], keyfile=sslp.get("key"), password=sslp.get("password") + ) + if "cipher" in sslp: + ctx.set_ciphers(sslp["cipher"]) + ctx.options |= ssl.OP_NO_SSLv2 + ctx.options |= ssl.OP_NO_SSLv3 + return ctx + def close(self): - """Send the quit message and close the socket""" - if self.socket is None: + """ + Send the quit message and close the socket. + + See `Connection.close() `_ + in the specification. + + :raise Error: If the connection is already closed. + """ + if self._closed: raise err.Error("Already closed") - send_data = struct.pack('`_ + in the specification. + """ self._execute_command(COMMAND.COM_QUERY, "COMMIT") self._read_ok_packet() def rollback(self): - """Roll back the current transaction""" + """ + Roll back the current transaction. + + See `Connection.rollback() `_ + in the specification. + """ self._execute_command(COMMAND.COM_QUERY, "ROLLBACK") self._read_ok_packet() def show_warnings(self): - """SHOW WARNINGS""" + """Send the "SHOW WARNINGS" SQL command.""" self._execute_command(COMMAND.COM_QUERY, "SHOW WARNINGS") result = MySQLResult(self) result.read() return result.rows def select_db(self, db): - '''Set current db''' + """ + Set current db. + + :param db: The name of the db. + """ self._execute_command(COMMAND.COM_INIT_DB, db) self._read_ok_packet() def escape(self, obj, mapping=None): - """Escape whatever value you pass to it""" - if isinstance(obj, str_type): + """Escape whatever value is passed. + + Non-standard, for internal use; do not use this in your applications. + """ + if isinstance(obj, str): return "'" + self.escape_string(obj) + "'" - return escape_item(obj, self.charset, mapping=mapping) + if isinstance(obj, (bytes, bytearray)): + ret = self._quote_bytes(obj) + if self._binary_prefix: + ret = "_binary" + ret + return ret + return converters.escape_item(obj, self.charset, mapping=mapping) def literal(self, obj): - '''Alias for escape()''' - return self.escape(obj) + """Alias for escape(). + + Non-standard, for internal use; do not use this in your applications. + """ + return self.escape(obj, self.encoders) def escape_string(self, s): - if (self.server_status & - SERVER_STATUS.SERVER_STATUS_NO_BACKSLASH_ESCAPES): + if self.server_status & SERVER_STATUS.SERVER_STATUS_NO_BACKSLASH_ESCAPES: return s.replace("'", "''") - return escape_string(s) + return converters.escape_string(s) + + def _quote_bytes(self, s): + if self.server_status & SERVER_STATUS.SERVER_STATUS_NO_BACKSLASH_ESCAPES: + return "'{}'".format( + s.replace(b"'", b"''").decode("ascii", "surrogateescape") + ) + return converters.escape_bytes(s) def cursor(self, cursor=None): - """Create a new cursor to execute queries with""" + """ + Create a new cursor to execute queries with. + + :param cursor: The type of cursor to create. None means use Cursor. + :type cursor: :py:class:`Cursor`, :py:class:`SSCursor`, :py:class:`DictCursor`, + or :py:class:`SSDictCursor`. + """ if cursor: return cursor(self) return self.cursorclass(self) - def __enter__(self): - """Context manager that returns a Cursor""" - return self.cursor() - - def __exit__(self, exc, value, traceback): - """On successful exit, commit. On exception, rollback""" - if exc: - self.rollback() - else: - self.commit() - # The following methods are INTERNAL USE ONLY (called from Cursor) def query(self, sql, unbuffered=False): # if DEBUG: # print("DEBUG: sending query:", sql) - if isinstance(sql, text_type) and not (JYTHON or IRONPYTHON): - if PY2: - sql = sql.encode(self.encoding) - else: - sql = sql.encode(self.encoding, 'surrogateescape') + if isinstance(sql, str): + sql = sql.encode(self.encoding, "surrogateescape") self._execute_command(COMMAND.COM_QUERY, sql) self._affected_rows = self._read_query_result(unbuffered=unbuffered) return self._affected_rows @@ -789,13 +583,20 @@ def affected_rows(self): return self._affected_rows def kill(self, thread_id): - arg = struct.pack('= 5: + # https://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::HandshakeResponse + if int(self.server_version.split(".", 1)[0]) >= 5: self.client_flag |= CLIENT.MULTI_RESULTS if self.user is None: raise ValueError("Did not specify a username") charset_id = charset_by_name(self.charset).id - if isinstance(self.user, text_type): + if isinstance(self.user, str): self.user = self.user.encode(self.encoding) - data_init = struct.pack('=5.0) + data += authresp + b"\0" - if self.db: - if isinstance(self.db, text_type): + if self.db and self.server_capabilities & CLIENT.CONNECT_WITH_DB: + if isinstance(self.db, str): self.db = self.db.encode(self.encoding) - data += self.db + int2byte(0) + data += self.db + b"\0" - data = pack_int24(len(data)) + int2byte(next_packet) + data - next_packet += 2 + if self.server_capabilities & CLIENT.PLUGIN_AUTH: + data += (plugin_name or b"") + b"\0" - if DEBUG: dump_packet(data) - self._write_bytes(data) + if self.server_capabilities & CLIENT.CONNECT_ATTRS: + connect_attrs = b"" + for k, v in self._connect_attrs.items(): + k = k.encode("utf-8") + connect_attrs += _lenenc_int(len(k)) + k + v = v.encode("utf-8") + connect_attrs += _lenenc_int(len(v)) + v + data += _lenenc_int(len(connect_attrs)) + connect_attrs + self.write_packet(data) auth_packet = self._read_packet() - # if old_passwords is enabled the packet will be 1 byte long and - # have the octet 254 + # if authentication method isn't accepted the first byte + # will have the octet 254 + if auth_packet.is_auth_switch_request(): + if DEBUG: + print("received auth switch") + # https://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::AuthSwitchRequest + auth_packet.read_uint8() # 0xfe packet identifier + plugin_name = auth_packet.read_string() + if ( + self.server_capabilities & CLIENT.PLUGIN_AUTH + and plugin_name is not None + ): + auth_packet = self._process_auth(plugin_name, auth_packet) + else: + raise err.OperationalError("received unknown auth switch request") + elif auth_packet.is_extra_auth_data(): + if DEBUG: + print("received extra data") + # https://dev.mysql.com/doc/internals/en/successful-authentication.html + if self._auth_plugin_name == "caching_sha2_password": + auth_packet = _auth.caching_sha2_password_auth(self, auth_packet) + elif self._auth_plugin_name == "sha256_password": + auth_packet = _auth.sha256_password_auth(self, auth_packet) + else: + raise err.OperationalError( + "Received extra packet for auth method %r", self._auth_plugin_name + ) + + if DEBUG: + print("Succeed to auth") + + def _process_auth(self, plugin_name, auth_packet): + handler = self._get_auth_plugin_handler(plugin_name) + if handler: + try: + return handler.authenticate(auth_packet) + except AttributeError: + if plugin_name != b"dialog": + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_CANNOT_LOAD, + f"Authentication plugin '{plugin_name}'" + f" not loaded: - {type(handler)!r} missing authenticate method", + ) + if plugin_name == b"caching_sha2_password": + return _auth.caching_sha2_password_auth(self, auth_packet) + elif plugin_name == b"sha256_password": + return _auth.sha256_password_auth(self, auth_packet) + elif plugin_name == b"mysql_native_password": + data = _auth.scramble_native_password(self.password, auth_packet.read_all()) + elif plugin_name == b"client_ed25519": + data = _auth.ed25519_password(self.password, auth_packet.read_all()) + elif plugin_name == b"mysql_old_password": + data = ( + _auth.scramble_old_password(self.password, auth_packet.read_all()) + + b"\0" + ) + elif plugin_name == b"mysql_clear_password": + # https://dev.mysql.com/doc/internals/en/clear-text-authentication.html + data = self.password + b"\0" + elif plugin_name == b"dialog": + pkt = auth_packet + while True: + flag = pkt.read_uint8() + echo = (flag & 0x06) == 0x02 + last = (flag & 0x01) == 0x01 + prompt = pkt.read_all() + + if prompt == b"Password: ": + self.write_packet(self.password + b"\0") + elif handler: + resp = "no response - TypeError within plugin.prompt method" + try: + resp = handler.prompt(echo, prompt) + self.write_packet(resp + b"\0") + except AttributeError: + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_CANNOT_LOAD, + f"Authentication plugin '{plugin_name}'" + f" not loaded: - {handler!r} missing prompt method", + ) + except TypeError: + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_ERR, + f"Authentication plugin '{plugin_name}'" + f" {handler!r} didn't respond with string. Returned '{resp!r}' to prompt {prompt!r}", + ) + else: + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_CANNOT_LOAD, + f"Authentication plugin '{plugin_name}' not configured", + ) + pkt = self._read_packet() + pkt.check_error() + if pkt.is_ok_packet() or last: + break + return pkt + else: + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_CANNOT_LOAD, + "Authentication plugin '%s' not configured" % plugin_name, + ) - if auth_packet.is_eof_packet(): - # send legacy handshake - data = _scramble_323(self.password.encode('latin1'), self.salt) + b'\0' - data = pack_int24(len(data)) + int2byte(next_packet) + data - self._write_bytes(data) - auth_packet = self._read_packet() + self.write_packet(data) + pkt = self._read_packet() + pkt.check_error() + return pkt + + def _get_auth_plugin_handler(self, plugin_name): + plugin_class = self._auth_plugin_map.get(plugin_name) + if not plugin_class and isinstance(plugin_name, bytes): + plugin_class = self._auth_plugin_map.get(plugin_name.decode("ascii")) + if plugin_class: + try: + handler = plugin_class(self) + except TypeError: + raise err.OperationalError( + CR.CR_AUTH_PLUGIN_CANNOT_LOAD, + f"Authentication plugin '{plugin_name}'" + f" not loaded: - {plugin_class!r} cannot be constructed with connection object", + ) + else: + handler = None + return handler # _mysql support def thread_id(self): @@ -1061,34 +1099,41 @@ def _get_server_information(self): packet = self._read_packet() data = packet.get_all_data() - if DEBUG: dump_packet(data) - self.protocol_version = byte2int(data[i:i+1]) + self.protocol_version = data[i] i += 1 - server_end = data.find(int2byte(0), i) - self.server_version = data[i:server_end].decode('latin1') + server_end = data.find(b"\0", i) + self.server_version = data[i:server_end].decode("latin1") i = server_end + 1 - self.server_thread_id = struct.unpack('= i + 6: - lang, stat, cap_h, salt_len = struct.unpack('= i + salt_len: # salt_len includes auth_plugin_data_part_1 and filler - self.salt += data[i:i+salt_len] - # TODO: AUTH PLUGIN NAME may appeare here. + self.salt += data[i : i + salt_len] + i += salt_len + + i += 1 + # AUTH PLUGIN NAME may appear here. + if self.server_capabilities & CLIENT.PLUGIN_AUTH and len(data) >= i: + # Due to Bug#59453 the auth-plugin-name is missing the terminating + # NUL-char in versions prior to 5.5.10 and 5.6.2. + # ref: https://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::Handshake + # didn't use version checks as mariadb is corrected and reports + # earlier than those two. + server_end = data.find(b"\0", i) + if server_end < 0: # pragma: no cover - very specific upstream bug + # not found \0 and last field so take it all + self._auth_plugin_name = data[i:].decode("utf-8") + else: + self._auth_plugin_name = data[i:server_end].decode("utf-8") + + if _DEFAULT_AUTH_PLUGIN is not None: # for tests + self._auth_plugin_name = _DEFAULT_AUTH_PLUGIN def get_server_info(self): return self.server_version @@ -1114,9 +1177,11 @@ def get_server_info(self): NotSupportedError = err.NotSupportedError -class MySQLResult(object): - +class MySQLResult: def __init__(self, connection): + """ + :type connection: Connection + """ self.connection = connection self.affected_rows = None self.insert_id = None @@ -1144,16 +1209,23 @@ def read(self): else: self._read_result_packet(first_packet) finally: - self.connection = False + self.connection = None def init_unbuffered_query(self): - self.unbuffered_active = True + """ + :raise OperationalError: If the connection to the MySQL server is lost. + :raise InternalError: + """ first_packet = self.connection._read_packet() if first_packet.is_ok_packet(): - self._read_ok_packet(first_packet) - self.unbuffered_active = False self.connection = None + self._read_ok_packet(first_packet) + elif first_packet.is_load_local_packet(): + try: + self._read_load_local_packet(first_packet) + finally: + self.connection = None else: self.field_count = first_packet.read_length_encoded_integer() self._get_descriptions() @@ -1162,6 +1234,7 @@ def init_unbuffered_query(self): # value of a 64bit unsigned integer. Since we're emulating MySQLdb, # we set it to this instead of None, which would be preferred. self.affected_rows = 18446744073709551615 + self.unbuffered_active = True def _read_ok_packet(self, first_packet): ok_packet = OKPacketWrapper(first_packet) @@ -1173,22 +1246,40 @@ def _read_ok_packet(self, first_packet): self.has_next = ok_packet.has_next def _read_load_local_packet(self, first_packet): + if not self.connection._local_infile: + raise RuntimeError( + "**WARN**: Received LOAD_LOCAL packet but local_infile option is false." + ) load_packet = LoadLocalPacketWrapper(first_packet) sender = LoadLocalFile(load_packet.filename, self.connection) - sender.send_data() + try: + sender.send_data() + except: + self.connection._read_packet() # skip ok packet + raise ok_packet = self.connection._read_packet() - if not ok_packet.is_ok_packet(): - raise err.OperationalError(2014, "Commands Out of Sync") + if ( + not ok_packet.is_ok_packet() + ): # pragma: no cover - upstream induced protocol error + raise err.OperationalError( + CR.CR_COMMANDS_OUT_OF_SYNC, + "Commands Out of Sync", + ) self._read_ok_packet(ok_packet) def _check_packet_is_eof(self, packet): - if packet.is_eof_packet(): - eof_packet = EOFPacketWrapper(packet) - self.warning_count = eof_packet.warning_count - self.has_next = eof_packet.has_next - return True - return False + if not packet.is_eof_packet(): + return False + # TODO: Support CLIENT.DEPRECATE_EOF + # 1) Add DEPRECATE_EOF to CAPABILITIES + # 2) Mask CAPABILITIES with server_capabilities + # 3) if server_capabilities & CLIENT.DEPRECATE_EOF: + # use OKPacketWrapper instead of EOFPacketWrapper + wp = EOFPacketWrapper(packet) + self.warning_count = wp.warning_count + self.has_next = wp.has_next + return True def _read_result_packet(self, first_packet): self.field_count = first_packet.read_length_encoded_integer() @@ -1218,7 +1309,20 @@ def _finish_unbuffered_query(self): # in fact, no way to stop MySQL from sending all the data after # executing a query, so we just spin, and wait for an EOF packet. while self.unbuffered_active: - packet = self.connection._read_packet() + try: + packet = self.connection._read_packet() + except err.OperationalError as e: + if e.args[0] in ( + ER.QUERY_TIMEOUT, + ER.STATEMENT_TIMEOUT, + ): + # if the query timed out we can simply ignore this error + self.unbuffered_active = False + self.connection = None + return + + raise + if self._check_packet_is_eof(packet): self.unbuffered_active = False self.connection = None # release reference to kill cyclic reference. @@ -1239,11 +1343,17 @@ def _read_rowdata_packet(self): def _read_row_from_packet(self, packet): row = [] for encoding, converter in self.converters: - data = packet.read_length_coded_string() + try: + data = packet.read_length_coded_string() + except IndexError: + # No more columns in this row + # See https://github.com/PyMySQL/PyMySQL/pull/434 + break if data is not None: if encoding is not None: data = data.decode(encoding) - if DEBUG: print("DEBUG: DATA = ", data) + if DEBUG: + print("DEBUG: DATA = ", data) if converter is not None: data = converter(data) row.append(data) @@ -1254,64 +1364,72 @@ def _get_descriptions(self): self.fields = [] self.converters = [] use_unicode = self.connection.use_unicode + conn_encoding = self.connection.encoding description = [] - for i in range_type(self.field_count): + + for i in range(self.field_count): field = self.connection._read_packet(FieldDescriptorPacket) self.fields.append(field) description.append(field.description()) field_type = field.type_code if use_unicode: - if field_type in TEXT_TYPES: - charset = charset_by_id(field.charsetnr) - if charset.is_binary: + if field_type == FIELD_TYPE.JSON: + # When SELECT from JSON column: charset = binary + # When SELECT CAST(... AS JSON): charset = connection encoding + # This behavior is different from TEXT / BLOB. + # We should decode result by connection encoding regardless charsetnr. + # See https://github.com/PyMySQL/PyMySQL/issues/488 + encoding = conn_encoding # SELECT CAST(... AS JSON) + elif field_type in TEXT_TYPES: + if field.charsetnr == 63: # binary # TEXTs with charset=binary means BINARY types. encoding = None else: - encoding = charset.encoding + encoding = conn_encoding else: - encoding = 'ascii' + # Integers, Dates and Times, and other basic data is encoded in ascii + encoding = "ascii" else: encoding = None converter = self.connection.decoders.get(field_type) - if converter is through: + if converter is converters.through: converter = None - if DEBUG: print("DEBUG: field={}, converter={}".format(field, converter)) + if DEBUG: + print(f"DEBUG: field={field}, converter={converter}") self.converters.append((encoding, converter)) eof_packet = self.connection._read_packet() - assert eof_packet.is_eof_packet(), 'Protocol error, expecting EOF' + assert eof_packet.is_eof_packet(), "Protocol error, expecting EOF" self.description = tuple(description) -class LoadLocalFile(object): +class LoadLocalFile: def __init__(self, filename, connection): self.filename = filename self.connection = connection def send_data(self): """Send data packets from the local file to the server""" - if not self.connection.socket: - raise err.InterfaceError("(0, '')") + if not self.connection._sock: + raise err.InterfaceError(0, "") + conn: Connection = self.connection - # sequence id is 2 as we already sent a query packet - seq_id = 2 try: - with open(self.filename, 'rb') as open_file: - chunk_size = self.connection.max_allowed_packet - packet = b"" - + with open(self.filename, "rb") as open_file: + packet_size = min( + conn.max_allowed_packet, 16 * 1024 + ) # 16KB is efficient enough while True: - chunk = open_file.read(chunk_size) + chunk = open_file.read(packet_size) if not chunk: break - packet = struct.pack('>> datetime_or_None('2007-02-25 23:06:20') + >>> convert_datetime('2007-02-25 23:06:20') datetime.datetime(2007, 2, 25, 23, 6, 20) - >>> datetime_or_None('2007-02-25T23:06:20') + >>> convert_datetime('2007-02-25T23:06:20') datetime.datetime(2007, 2, 25, 23, 6, 20) - Illegal values are returned as None: - - >>> datetime_or_None('2007-02-31T23:06:20') is None - True - >>> datetime_or_None('0000-00-00 00:00:00') is None - True + Illegal values are returned as str: + >>> convert_datetime('2007-02-31T23:06:20') + '2007-02-31T23:06:20' + >>> convert_datetime('0000-00-00 00:00:00') + '0000-00-00 00:00:00' """ - if ' ' in obj: - sep = ' ' - elif 'T' in obj: - sep = 'T' - else: + if isinstance(obj, (bytes, bytearray)): + obj = obj.decode("ascii") + + m = DATETIME_RE.match(obj) + if not m: return convert_date(obj) try: - ymd, hms = obj.split(sep, 1) - usecs = '0' - if '.' in hms: - hms, usecs = hms.split('.') - usecs = float('0.' + usecs) * 1e6 - return datetime.datetime(*[ int(x) for x in ymd.split('-')+hms.split(':')+[usecs] ]) + groups = list(m.groups()) + groups[-1] = _convert_second_fraction(groups[-1]) + return datetime.datetime(*[int(x) for x in groups]) except ValueError: return convert_date(obj) +TIMEDELTA_RE = re.compile(r"(-)?(\d{1,3}):(\d{1,2}):(\d{1,2})(?:.(\d{1,6}))?") + + def convert_timedelta(obj): """Returns a TIME column as a timedelta object: - >>> timedelta_or_None('25:06:17') - datetime.timedelta(1, 3977) - >>> timedelta_or_None('-25:06:17') - datetime.timedelta(-2, 83177) + >>> convert_timedelta('25:06:17') + datetime.timedelta(days=1, seconds=3977) + >>> convert_timedelta('-25:06:17') + datetime.timedelta(days=-2, seconds=82423) - Illegal values are returned as None: + Illegal values are returned as string: - >>> timedelta_or_None('random crap') is None - True + >>> convert_timedelta('random crap') + 'random crap' Note that MySQL always returns TIME columns as (+|-)HH:MM:SS, but can accept values as (+|-)DD HH:MM:SS. The latter format will not be parsed correctly by this function. """ + if isinstance(obj, (bytes, bytearray)): + obj = obj.decode("ascii") + + m = TIMEDELTA_RE.match(obj) + if not m: + return obj + try: - microseconds = 0 - if "." in obj: - (obj, tail) = obj.split('.') - microseconds = float('0.' + tail) * 1e6 - hours, minutes, seconds = obj.split(':') - negate = 1 - if hours.startswith("-"): - hours = hours[1:] - negate = -1 - tdelta = datetime.timedelta( - hours = int(hours), - minutes = int(minutes), - seconds = int(seconds), - microseconds = int(microseconds) - ) * negate + groups = list(m.groups()) + groups[-1] = _convert_second_fraction(groups[-1]) + negate = -1 if groups[0] else 1 + hours, minutes, seconds, microseconds = groups[1:] + + tdelta = ( + datetime.timedelta( + hours=int(hours), + minutes=int(minutes), + seconds=int(seconds), + microseconds=int(microseconds), + ) + * negate + ) return tdelta except ValueError: - return None + return obj + + +TIME_RE = re.compile(r"(\d{1,2}):(\d{1,2}):(\d{1,2})(?:.(\d{1,6}))?") + def convert_time(obj): """Returns a TIME column as a time object: - >>> time_or_None('15:06:17') + >>> convert_time('15:06:17') datetime.time(15, 6, 17) - Illegal values are returned as None: + Illegal values are returned as str: - >>> time_or_None('-25:06:17') is None - True - >>> time_or_None('random crap') is None - True + >>> convert_time('-25:06:17') + '-25:06:17' + >>> convert_time('random crap') + 'random crap' Note that MySQL always returns TIME columns as (+|-)HH:MM:SS, but can accept values as (+|-)DD HH:MM:SS. The latter format will not @@ -204,111 +253,71 @@ def convert_time(obj): to be treated as time-of-day and not a time offset, then you can use set this function as the converter for FIELD_TYPE.TIME. """ - try: - microseconds = 0 - if "." in obj: - (obj, tail) = obj.split('.') - microseconds = float('0.' + tail) * 1e6 - hours, minutes, seconds = obj.split(':') - return datetime.time(hour=int(hours), minute=int(minutes), - second=int(seconds), microsecond=int(microseconds)) - except ValueError: - return None - -def convert_date(obj): - """Returns a DATE column as a date object: - - >>> date_or_None('2007-02-26') - datetime.date(2007, 2, 26) - - Illegal values are returned as None: + if isinstance(obj, (bytes, bytearray)): + obj = obj.decode("ascii") - >>> date_or_None('2007-02-31') is None - True - >>> date_or_None('0000-00-00') is None - True + m = TIME_RE.match(obj) + if not m: + return obj - """ try: - return datetime.date(*[ int(x) for x in obj.split('-', 2) ]) + groups = list(m.groups()) + groups[-1] = _convert_second_fraction(groups[-1]) + hours, minutes, seconds, microseconds = groups + return datetime.time( + hour=int(hours), + minute=int(minutes), + second=int(seconds), + microsecond=int(microseconds), + ) except ValueError: - return None - - -def convert_mysql_timestamp(timestamp): - """Convert a MySQL TIMESTAMP to a Timestamp object. - - MySQL >= 4.1 returns TIMESTAMP in the same format as DATETIME: + return obj - >>> mysql_timestamp_converter('2007-02-25 22:32:17') - datetime.datetime(2007, 2, 25, 22, 32, 17) - MySQL < 4.1 uses a big string of numbers: - - >>> mysql_timestamp_converter('20070225223217') - datetime.datetime(2007, 2, 25, 22, 32, 17) +def convert_date(obj): + """Returns a DATE column as a date object: - Illegal values are returned as None: + >>> convert_date('2007-02-26') + datetime.date(2007, 2, 26) - >>> mysql_timestamp_converter('2007-02-31 22:32:17') is None - True - >>> mysql_timestamp_converter('00000000000000') is None - True + Illegal values are returned as str: + >>> convert_date('2007-02-31') + '2007-02-31' + >>> convert_date('0000-00-00') + '0000-00-00' """ - if timestamp[4] == '-': - return convert_datetime(timestamp) - timestamp += "0"*(14-len(timestamp)) # padding - year, month, day, hour, minute, second = \ - int(timestamp[:4]), int(timestamp[4:6]), int(timestamp[6:8]), \ - int(timestamp[8:10]), int(timestamp[10:12]), int(timestamp[12:14]) + if isinstance(obj, (bytes, bytearray)): + obj = obj.decode("ascii") try: - return datetime.datetime(year, month, day, hour, minute, second) + return datetime.date(*[int(x) for x in obj.split("-", 2)]) except ValueError: - return None - -def convert_set(s): - return set(s.split(",")) + return obj def through(x): return x -#def convert_bit(b): +# def convert_bit(b): # b = "\x00" * (8 - len(b)) + b # pad w/ zeroes # return struct.unpack(">Q", b)[0] -# +# # the snippet above is right, but MySQLdb doesn't process bits, # so we shouldn't either convert_bit = through -def convert_characters(connection, field, data): - field_charset = charset_by_id(field.charsetnr).name - encoding = charset_to_encoding(field_charset) - if field.flags & FLAG.SET: - return convert_set(data.decode(encoding)) - if field.flags & FLAG.BINARY: - return data - - if connection.use_unicode: - data = data.decode(encoding) - elif connection.charset != field_charset: - data = data.decode(encoding) - data = data.encode(connection.encoding) - return data - encoders = { bool: escape_bool, int: escape_int, - long_type: escape_int, float: escape_float, str: escape_str, - text_type: escape_unicode, + bytes: escape_bytes, tuple: escape_sequence, list: escape_sequence, set: escape_sequence, + frozenset: escape_sequence, dict: escape_dict, type(None): escape_None, datetime.date: escape_date, @@ -316,11 +325,9 @@ def convert_characters(connection, field, data): datetime.timedelta: escape_timedelta, datetime.time: escape_time, time.struct_time: escape_struct_time, - Decimal: escape_object, + Decimal: Decimal2Literal, } -if not PY2 or JYTHON or IRONPYTHON: - encoders[bytes] = escape_bytes decoders = { FIELD_TYPE.BIT: convert_bit, @@ -332,11 +339,10 @@ def convert_characters(connection, field, data): FIELD_TYPE.LONGLONG: int, FIELD_TYPE.INT24: int, FIELD_TYPE.YEAR: int, - FIELD_TYPE.TIMESTAMP: convert_mysql_timestamp, + FIELD_TYPE.TIMESTAMP: convert_datetime, FIELD_TYPE.DATETIME: convert_datetime, FIELD_TYPE.TIME: convert_timedelta, FIELD_TYPE.DATE: convert_date, - FIELD_TYPE.SET: convert_set, FIELD_TYPE.BLOB: through, FIELD_TYPE.TINY_BLOB: through, FIELD_TYPE.MEDIUM_BLOB: through, @@ -350,7 +356,8 @@ def convert_characters(connection, field, data): # for MySQLdb compatibility -conversions = decoders +conversions = encoders.copy() +conversions.update(decoders) +Thing2Literal = escape_str -def Thing2Literal(obj): - return escape_str(str(obj)) +# Run doctests with `pytest --doctest-modules pymysql/converters.py` diff --git a/pymysql/cursors.py b/pymysql/cursors.py index 266e13705..8be05ca23 100644 --- a/pymysql/cursors.py +++ b/pymysql/cursors.py @@ -1,38 +1,39 @@ -# -*- coding: utf-8 -*- -from __future__ import print_function, absolute_import -from functools import partial import re import warnings - -from ._compat import range_type, text_type, PY2 - from . import err #: Regular expression for :meth:`Cursor.executemany`. -#: executemany only suports simple bulk insert. +#: executemany only supports simple bulk insert. #: You can use it to load large dataset. -RE_INSERT_VALUES = re.compile(r"""(INSERT\s.+\sVALUES\s+)(\(\s*%s\s*(?:,\s*%s\s*)*\))(\s*(?:ON DUPLICATE.*)?)\Z""", - re.IGNORECASE | re.DOTALL) +RE_INSERT_VALUES = re.compile( + r"\s*((?:INSERT|REPLACE)\b.+\bVALUES?\s*)" + + r"(\(\s*(?:%s|%\(.+\)s)\s*(?:,\s*(?:%s|%\(.+\)s)\s*)*\))" + + r"(\s*(?:ON DUPLICATE.*)?);?\s*\Z", + re.IGNORECASE | re.DOTALL, +) + +class Cursor: + """ + This is the object used to interact with the database. + + Do not create an instance of a Cursor yourself. Call + connections.Connection.cursor(). -class Cursor(object): - ''' - This is the object you use to interact with the database. - ''' + See `Cursor `_ in + the specification. + """ - #: Max stetement size which :meth:`executemany` generates. + #: Max statement size which :meth:`executemany` generates. #: #: Max size of allowed statement is max_allowed_packet - packet_header_size. #: Default value of max_allowed_packet is 1048576. max_stmt_length = 1024000 def __init__(self, connection): - ''' - Do not create an instance of a Cursor yourself. Call - connections.Connection.cursor(). - ''' self.connection = connection + self.warning_count = 0 self.description = None self.rownumber = 0 self.rowcount = -1 @@ -42,9 +43,9 @@ def __init__(self, connection): self._rows = None def close(self): - ''' + """ Closing a cursor just exhausts all remaining data. - ''' + """ conn = self.connection if conn is None: return @@ -80,13 +81,15 @@ def setoutputsizes(self, *args): """Does nothing, required by DB API.""" def _nextset(self, unbuffered=False): - """Get the next query set""" + """Get the next query set.""" conn = self._get_db() current_result = self._result if current_result is None or current_result is not conn._result: return None if not current_result.has_next: return None + self._result = None + self._clear_result() conn.next_result(unbuffered=unbuffered) self._do_get_result() return True @@ -94,42 +97,33 @@ def _nextset(self, unbuffered=False): def nextset(self): return self._nextset(False) - def _ensure_bytes(self, x, encoding=None): - if isinstance(x, text_type): - x = x.encode(encoding) - elif isinstance(x, (tuple, list)): - x = type(x)(self._ensure_bytes(v, encoding=encoding) for v in x) - return x - def _escape_args(self, args, conn): - ensure_bytes = partial(self._ensure_bytes, encoding=conn.encoding) - if isinstance(args, (tuple, list)): - if PY2: - args = tuple(map(ensure_bytes, args)) - return tuple(conn.escape(arg) for arg in args) + return tuple(conn.literal(arg) for arg in args) elif isinstance(args, dict): - if PY2: - args = dict((ensure_bytes(key), ensure_bytes(val)) for - (key, val) in args.items()) - return dict((key, conn.escape(val)) for (key, val) in args.items()) + return {key: conn.literal(val) for (key, val) in args.items()} else: # If it's not a dictionary let's try escaping it anyways. # Worst case it will throw a Value error - if PY2: - ensure_bytes(args) return conn.escape(args) def mogrify(self, query, args=None): """ - Returns the exact string that is sent to the database by calling the + Returns the exact string that would be sent to the database by calling the execute() method. + :param query: Query to mogrify. + :type query: str + + :param args: Parameters used with query. (optional) + :type args: tuple, list or dict + + :return: The query with argument binding applied. + :rtype: str + This method follows the extension to the DB API 2.0 followed by Psycopg. """ conn = self._get_db() - if PY2: # Use bytes on Python 2 always - query = self._ensure_bytes(query, encoding=conn.encoding) if args is not None: query = query % self._escape_args(args, conn) @@ -137,7 +131,20 @@ def mogrify(self, query, args=None): return query def execute(self, query, args=None): - '''Execute a query''' + """Execute a query. + + :param query: Query to execute. + :type query: str + + :param args: Parameters used with query. (optional) + :type args: tuple, list or dict + + :return: Number of affected rows. + :rtype: int + + If args is a list or tuple, %s can be used as a placeholder in the query. + If args is a dict, %(name)s can be used as a placeholder in the query. + """ while self.nextset(): pass @@ -148,69 +155,80 @@ def execute(self, query, args=None): return result def executemany(self, query, args): - """Run several data against one query + """Run several data against one query. + + :param query: Query to execute. + :type query: str + + :param args: Sequence of sequences or mappings. It is used as parameter. + :type args: tuple or list + + :return: Number of rows affected, if any. + :rtype: int or None - PyMySQL can execute bulkinsert for query like 'INSERT ... VALUES (%s)'. - In other form of queries, just run :meth:`execute` many times. + This method improves performance on multiple-row INSERT and + REPLACE. Otherwise it is equivalent to looping over args with + execute(). """ if not args: return m = RE_INSERT_VALUES.match(query) if m: - q_prefix = m.group(1) + q_prefix = m.group(1) % () q_values = m.group(2).rstrip() - q_postfix = m.group(3) or '' - assert q_values[0] == '(' and q_values[-1] == ')' - return self._do_execute_many(q_prefix, q_values, q_postfix, args, - self.max_stmt_length, - self._get_db().encoding) + q_postfix = m.group(3) or "" + assert q_values[0] == "(" and q_values[-1] == ")" + return self._do_execute_many( + q_prefix, + q_values, + q_postfix, + args, + self.max_stmt_length, + self._get_db().encoding, + ) self.rowcount = sum(self.execute(query, arg) for arg in args) return self.rowcount - def _do_execute_many(self, prefix, values, postfix, args, max_stmt_length, encoding): + def _do_execute_many( + self, prefix, values, postfix, args, max_stmt_length, encoding + ): conn = self._get_db() escape = self._escape_args - if isinstance(prefix, text_type): + if isinstance(prefix, str): prefix = prefix.encode(encoding) - if PY2 and isinstance(values, text_type): - values = values.encode(encoding) - if isinstance(postfix, text_type): + if isinstance(postfix, str): postfix = postfix.encode(encoding) sql = bytearray(prefix) args = iter(args) v = values % escape(next(args), conn) - if isinstance(v, text_type): - if PY2: - v = v.encode(encoding) - else: - v = v.encode(encoding, 'surrogateescape') + if isinstance(v, str): + v = v.encode(encoding, "surrogateescape") sql += v rows = 0 for arg in args: v = values % escape(arg, conn) - if isinstance(v, text_type): - if PY2: - v = v.encode(encoding) - else: - v = v.encode(encoding, 'surrogateescape') + if isinstance(v, str): + v = v.encode(encoding, "surrogateescape") if len(sql) + len(v) + len(postfix) + 1 > max_stmt_length: rows += self.execute(sql + postfix) sql = bytearray(prefix) else: - sql += b',' + sql += b"," sql += v rows += self.execute(sql + postfix) self.rowcount = rows return rows def callproc(self, procname, args=()): - """Execute stored procedure procname with args + """Execute stored procedure procname with args. - procname -- string, name of procedure to execute on server + :param procname: Name of procedure to execute on server. + :type procname: str - args -- Sequence of parameters to use with procedure + :param args: Sequence of parameters to use with procedure. + :type args: tuple or list Returns the original args. @@ -234,20 +252,26 @@ def callproc(self, procname, args=()): disconnected. """ conn = self._get_db() - for index, arg in enumerate(args): - q = "SET @_%s_%d=%s" % (procname, index, conn.escape(arg)) - self._query(q) + if args: + fmt = f"@_{procname}_%d=%s" + self._query( + "SET %s" + % ",".join( + fmt % (index, conn.escape(arg)) for index, arg in enumerate(args) + ) + ) self.nextset() - q = "CALL %s(%s)" % (procname, - ','.join(['@_%s_%d' % (procname, i) - for i in range_type(len(args))])) + q = "CALL {}({})".format( + procname, + ",".join(["@_%s_%d" % (procname, i) for i in range(len(args))]), + ) self._query(q) self._executed = q return args def fetchone(self): - ''' Fetch the next row ''' + """Fetch the next row.""" self._check_executed() if self._rows is None or self.rownumber >= len(self._rows): return None @@ -256,32 +280,34 @@ def fetchone(self): return result def fetchmany(self, size=None): - ''' Fetch several rows ''' + """Fetch several rows.""" self._check_executed() if self._rows is None: + # Django expects () for EOF. + # https://github.com/django/django/blob/0c1518ee429b01c145cf5b34eab01b0b92f8c246/django/db/backends/mysql/features.py#L8 return () end = self.rownumber + (size or self.arraysize) - result = self._rows[self.rownumber:end] + result = self._rows[self.rownumber : end] self.rownumber = min(end, len(self._rows)) return result def fetchall(self): - ''' Fetch all the rows ''' + """Fetch all the rows.""" self._check_executed() if self._rows is None: - return () + return [] if self.rownumber: - result = self._rows[self.rownumber:] + result = self._rows[self.rownumber :] else: result = self._rows self.rownumber = len(self._rows) return result - def scroll(self, value, mode='relative'): + def scroll(self, value, mode="relative"): self._check_executed() - if mode == 'relative': + if mode == "relative": r = self.rownumber + value - elif mode == 'absolute': + elif mode == "absolute": r = value else: raise err.ProgrammingError("unknown scroll mode %s" % mode) @@ -292,65 +318,78 @@ def scroll(self, value, mode='relative'): def _query(self, q): conn = self._get_db() - self._last_executed = q + self._clear_result() conn.query(q) self._do_get_result() return self.rowcount + def _clear_result(self): + self.rownumber = 0 + self._result = None + + self.rowcount = 0 + self.warning_count = 0 + self.description = None + self.lastrowid = None + self._rows = None + def _do_get_result(self): conn = self._get_db() - self.rownumber = 0 self._result = result = conn._result self.rowcount = result.affected_rows + self.warning_count = result.warning_count self.description = result.description self.lastrowid = result.insert_id self._rows = result.rows - if result.warning_count > 0: - self._show_warnings(conn) - - def _show_warnings(self, conn): - if self._result and self._result.has_next: - return - ws = conn.show_warnings() - if ws is None: - return - for w in ws: - msg = w[-1] - if PY2: - if isinstance(msg, unicode): - msg = msg.encode('utf-8', 'replace') - warnings.warn(str(msg), err.Warning, 4) - def __iter__(self): - return iter(self.fetchone, None) - - Warning = err.Warning - Error = err.Error - InterfaceError = err.InterfaceError - DatabaseError = err.DatabaseError - DataError = err.DataError - OperationalError = err.OperationalError - IntegrityError = err.IntegrityError - InternalError = err.InternalError - ProgrammingError = err.ProgrammingError - NotSupportedError = err.NotSupportedError + return self + def __next__(self): + row = self.fetchone() + if row is None: + raise StopIteration + return row -class DictCursorMixin(object): + def __getattr__(self, name): + # DB-API 2.0 optional extension says these errors can be accessed + # via Connection object. But MySQLdb had defined them on Cursor object. + if name in ( + "Warning", + "Error", + "InterfaceError", + "DatabaseError", + "DataError", + "OperationalError", + "IntegrityError", + "InternalError", + "ProgrammingError", + "NotSupportedError", + ): + # Deprecated since v1.1 + warnings.warn( + "PyMySQL errors hould be accessed from `pymysql` package", + DeprecationWarning, + stacklevel=2, + ) + return getattr(err, name) + raise AttributeError(name) + + +class DictCursorMixin: # You can override this to use OrderedDict or other dict-like types. dict_type = dict def _do_get_result(self): - super(DictCursorMixin, self)._do_get_result() + super()._do_get_result() fields = [] if self.description: for f in self._result.fields: name = f.name if name in fields: - name = f.table_name + '.' + name + name = f.table_name + "." + name fields.append(name) self._fields = fields @@ -373,8 +412,8 @@ class SSCursor(Cursor): or for connections to remote servers over a slow network. Instead of copying every row of data into a buffer, this will fetch - rows as needed. The upside of this, is the client uses much less memory, - and rows are returned much faster when traveling over a slow network, + rows as needed. The upside of this is the client uses much less memory, + and rows are returned much faster when traveling over a slow network or if the result set is very big. There are limitations, though. The MySQL protocol doesn't support @@ -400,9 +439,11 @@ def close(self): finally: self.connection = None + __del__ = close + def _query(self, q): conn = self._get_db() - self._last_executed = q + self._clear_result() conn.query(q, unbuffered=True) self._do_get_result() return self.rowcount @@ -411,14 +452,15 @@ def nextset(self): return self._nextset(unbuffered=True) def read_next(self): - """ Read next row """ + """Read next row.""" return self._conv_row(self._result._read_rowdata_packet_unbuffered()) def fetchone(self): - """ Fetch next row """ + """Fetch next row.""" self._check_executed() row = self.read_next() if row is None: + self.warning_count = self._result.warning_count return None self.rownumber += 1 return row @@ -439,42 +481,46 @@ def fetchall_unbuffered(self): """ return iter(self.fetchone, None) - def __iter__(self): - return self.fetchall_unbuffered() - def fetchmany(self, size=None): - """ Fetch many """ + """Fetch many.""" self._check_executed() if size is None: size = self.arraysize rows = [] - for i in range_type(size): + for i in range(size): row = self.read_next() if row is None: + self.warning_count = self._result.warning_count break rows.append(row) self.rownumber += 1 + if not rows: + # Django expects () for EOF. + # https://github.com/django/django/blob/0c1518ee429b01c145cf5b34eab01b0b92f8c246/django/db/backends/mysql/features.py#L8 + return () return rows - def scroll(self, value, mode='relative'): + def scroll(self, value, mode="relative"): self._check_executed() - if mode == 'relative': + if mode == "relative": if value < 0: raise err.NotSupportedError( - "Backwards scrolling not supported by this cursor") + "Backwards scrolling not supported by this cursor" + ) - for _ in range_type(value): + for _ in range(value): self.read_next() self.rownumber += value - elif mode == 'absolute': + elif mode == "absolute": if value < self.rownumber: raise err.NotSupportedError( - "Backwards scrolling not supported by this cursor") + "Backwards scrolling not supported by this cursor" + ) end = value - self.rownumber - for _ in range_type(end): + for _ in range(end): self.read_next() self.rownumber = value else: @@ -482,4 +528,4 @@ def scroll(self, value, mode='relative'): class SSDictCursor(DictCursorMixin, SSCursor): - """ An unbuffered cursor, which returns results as a dictionary """ + """An unbuffered cursor, which returns results as a dictionary""" diff --git a/pymysql/err.py b/pymysql/err.py index 9b6f24e0d..dac65d3be 100644 --- a/pymysql/err.py +++ b/pymysql/err.py @@ -68,53 +68,83 @@ class NotSupportedError(DatabaseError): error_map = {} + def _map_error(exc, *errors): for error in errors: error_map[error] = exc -_map_error(ProgrammingError, ER.DB_CREATE_EXISTS, ER.SYNTAX_ERROR, - ER.PARSE_ERROR, ER.NO_SUCH_TABLE, ER.WRONG_DB_NAME, - ER.WRONG_TABLE_NAME, ER.FIELD_SPECIFIED_TWICE, - ER.INVALID_GROUP_FUNC_USE, ER.UNSUPPORTED_EXTENSION, - ER.TABLE_MUST_HAVE_COLUMNS, ER.CANT_DO_THIS_DURING_AN_TRANSACTION) -_map_error(DataError, ER.WARN_DATA_TRUNCATED, ER.WARN_NULL_TO_NOTNULL, - ER.WARN_DATA_OUT_OF_RANGE, ER.NO_DEFAULT, ER.PRIMARY_CANT_HAVE_NULL, - ER.DATA_TOO_LONG, ER.DATETIME_FUNCTION_OVERFLOW) -_map_error(IntegrityError, ER.DUP_ENTRY, ER.NO_REFERENCED_ROW, - ER.NO_REFERENCED_ROW_2, ER.ROW_IS_REFERENCED, ER.ROW_IS_REFERENCED_2, - ER.CANNOT_ADD_FOREIGN, ER.BAD_NULL_ERROR) -_map_error(NotSupportedError, ER.WARNING_NOT_COMPLETE_ROLLBACK, - ER.NOT_SUPPORTED_YET, ER.FEATURE_DISABLED, ER.UNKNOWN_STORAGE_ENGINE) -_map_error(OperationalError, ER.DBACCESS_DENIED_ERROR, ER.ACCESS_DENIED_ERROR, - ER.CON_COUNT_ERROR, ER.TABLEACCESS_DENIED_ERROR, - ER.COLUMNACCESS_DENIED_ERROR) - -del _map_error, ER - - -def _get_error_info(data): - errno = struct.unpack('= 2 and value[0] == value[-1] == quote: return value[1:-1] return value + def optionxform(self, key): + return key.lower().replace("_", "-") + def get(self, section, option): value = configparser.RawConfigParser.get(self, section, option) return self.__remove_quotes(value) diff --git a/pymysql/protocol.py b/pymysql/protocol.py new file mode 100644 index 000000000..98fde6d0c --- /dev/null +++ b/pymysql/protocol.py @@ -0,0 +1,356 @@ +# Python implementation of low level MySQL client-server protocol +# http://dev.mysql.com/doc/internals/en/client-server-protocol.html + +from .charset import MBLENGTH +from .constants import FIELD_TYPE, SERVER_STATUS +from . import err + +import struct +import sys + + +DEBUG = False + +NULL_COLUMN = 251 +UNSIGNED_CHAR_COLUMN = 251 +UNSIGNED_SHORT_COLUMN = 252 +UNSIGNED_INT24_COLUMN = 253 +UNSIGNED_INT64_COLUMN = 254 + + +def dump_packet(data): # pragma: no cover + def printable(data): + if 32 <= data < 127: + return chr(data) + return "." + + try: + print("packet length:", len(data)) + for i in range(1, 7): + f = sys._getframe(i) + print("call[%d]: %s (line %d)" % (i, f.f_code.co_name, f.f_lineno)) + print("-" * 66) + except ValueError: + pass + dump_data = [data[i : i + 16] for i in range(0, min(len(data), 256), 16)] + for d in dump_data: + print( + " ".join(f"{x:02X}" for x in d) + + " " * (16 - len(d)) + + " " * 2 + + "".join(printable(x) for x in d) + ) + print("-" * 66) + print() + + +class MysqlPacket: + """Representation of a MySQL response packet. + + Provides an interface for reading/parsing the packet results. + """ + + __slots__ = ("_position", "_data") + + def __init__(self, data, encoding): + self._position = 0 + self._data = data + + def get_all_data(self): + return self._data + + def read(self, size): + """Read the first 'size' bytes in packet and advance cursor past them.""" + result = self._data[self._position : (self._position + size)] + if len(result) != size: + error = ( + "Result length not requested length:\n" + f"Expected={size}. Actual={len(result)}. Position: {self._position}. Data Length: {len(self._data)}" + ) + if DEBUG: + print(error) + self.dump() + raise AssertionError(error) + self._position += size + return result + + def read_all(self): + """Read all remaining data in the packet. + + (Subsequent read() will return errors.) + """ + result = self._data[self._position :] + self._position = None # ensure no subsequent read() + return result + + def advance(self, length): + """Advance the cursor in data buffer 'length' bytes.""" + new_position = self._position + length + if new_position < 0 or new_position > len(self._data): + raise Exception( + f"Invalid advance amount ({length}) for cursor. Position={new_position}" + ) + self._position = new_position + + def rewind(self, position=0): + """Set the position of the data buffer cursor to 'position'.""" + if position < 0 or position > len(self._data): + raise Exception("Invalid position to rewind cursor to: %s." % position) + self._position = position + + def get_bytes(self, position, length=1): + """Get 'length' bytes starting at 'position'. + + Position is start of payload (first four packet header bytes are not + included) starting at index '0'. + + No error checking is done. If requesting outside end of buffer + an empty string (or string shorter than 'length') may be returned! + """ + return self._data[position : (position + length)] + + def read_uint8(self): + result = self._data[self._position] + self._position += 1 + return result + + def read_uint16(self): + result = struct.unpack_from("= 7 + + def is_eof_packet(self): + # http://dev.mysql.com/doc/internals/en/generic-response-packets.html#packet-EOF_Packet + # Caution: \xFE may be LengthEncodedInteger. + # If \xFE is LengthEncodedInteger header, 8bytes followed. + return self._data[0] == 0xFE and len(self._data) < 9 + + def is_auth_switch_request(self): + # http://dev.mysql.com/doc/internals/en/connection-phase-packets.html#packet-Protocol::AuthSwitchRequest + return self._data[0] == 0xFE + + def is_extra_auth_data(self): + # https://dev.mysql.com/doc/internals/en/successful-authentication.html + return self._data[0] == 1 + + def is_resultset_packet(self): + field_count = self._data[0] + return 1 <= field_count <= 250 + + def is_load_local_packet(self): + return self._data[0] == 0xFB + + def is_error_packet(self): + return self._data[0] == 0xFF + + def check_error(self): + if self.is_error_packet(): + self.raise_for_error() + + def raise_for_error(self): + self.rewind() + self.advance(1) # field_count == error (we already know that) + errno = self.read_uint16() + if DEBUG: + print("errno =", errno) + err.raise_mysql_exception(self._data) + + def dump(self): + dump_packet(self._data) + + +class FieldDescriptorPacket(MysqlPacket): + """A MysqlPacket that represents a specific column's metadata in the result. + + Parsing is automatically done and the results are exported via public + attributes on the class such as: db, table_name, name, length, type_code. + """ + + def __init__(self, data, encoding): + MysqlPacket.__init__(self, data, encoding) + self._parse_field_descriptor(encoding) + + def _parse_field_descriptor(self, encoding): + """Parse the 'Field Descriptor' (Metadata) packet. + + This is compatible with MySQL 4.1+ (not compatible with MySQL 4.0). + """ + self.catalog = self.read_length_coded_string() + self.db = self.read_length_coded_string() + self.table_name = self.read_length_coded_string().decode(encoding) + self.org_table = self.read_length_coded_string().decode(encoding) + self.name = self.read_length_coded_string().decode(encoding) + self.org_name = self.read_length_coded_string().decode(encoding) + ( + self.charsetnr, + self.length, + self.type_code, + self.flags, + self.scale, + ) = self.read_struct("= version_tuple - def setUp(self): - self.connections = [] - for params in self.databases: - self.connections.append(pymysql.connect(**params)) - self.addCleanup(self._teardown_connections) + def get_mysql_vendor(self, conn): + server_version = conn.get_server_info() + + if "MariaDB" in server_version: + return "mariadb" + + return "mysql" + + _connections = None + + @property + def connections(self): + if self._connections is None: + self._connections = [] + for params in self.databases: + self._connections.append(pymysql.connect(**params)) + self.addCleanup(self._teardown_connections) + return self._connections + + def connect(self, **params): + p = self.databases[0].copy() + p.update(params) + conn = pymysql.connect(**p) + + @self.addCleanup + def teardown(): + if conn.open: + conn.close() + + return conn def _teardown_connections(self): - for connection in self.connections: - connection.close() + if self._connections: + for connection in self._connections: + if connection.open: + connection.close() + self._connections = None def safe_create_table(self, connection, tablename, ddl, cleanup=True): """create a table. @@ -62,7 +98,7 @@ def safe_create_table(self, connection, tablename, ddl, cleanup=True): with warnings.catch_warnings(): warnings.simplefilter("ignore") - cursor.execute("drop table if exists `%s`" % (tablename,)) + cursor.execute(f"drop table if exists `{tablename}`") cursor.execute(ddl) cursor.close() if cleanup: @@ -72,15 +108,5 @@ def drop_table(self, connection, tablename): cursor = connection.cursor() with warnings.catch_warnings(): warnings.simplefilter("ignore") - cursor.execute("drop table if exists `%s`" % (tablename,)) + cursor.execute(f"drop table if exists `{tablename}`") cursor.close() - - def safe_gc_collect(self): - """Ensure cycles are collected via gc. - - Runs additional times on non-CPython platforms. - - """ - gc.collect() - if not CPYTHON: - gc.collect() diff --git a/pymysql/tests/test_DictCursor.py b/pymysql/tests/test_DictCursor.py index 08d188e1f..4e545792a 100644 --- a/pymysql/tests/test_DictCursor.py +++ b/pymysql/tests/test_DictCursor.py @@ -6,44 +6,50 @@ class TestDictCursor(base.PyMySQLTestCase): - bob = {'name': 'bob', 'age': 21, 'DOB': datetime.datetime(1990, 2, 6, 23, 4, 56)} - jim = {'name': 'jim', 'age': 56, 'DOB': datetime.datetime(1955, 5, 9, 13, 12, 45)} - fred = {'name': 'fred', 'age': 100, 'DOB': datetime.datetime(1911, 9, 12, 1, 1, 1)} + bob = {"name": "bob", "age": 21, "DOB": datetime.datetime(1990, 2, 6, 23, 4, 56)} + jim = {"name": "jim", "age": 56, "DOB": datetime.datetime(1955, 5, 9, 13, 12, 45)} + fred = {"name": "fred", "age": 100, "DOB": datetime.datetime(1911, 9, 12, 1, 1, 1)} cursor_type = pymysql.cursors.DictCursor def setUp(self): - super(TestDictCursor, self).setUp() - self.conn = conn = self.connections[0] + super().setUp() + self.conn = conn = self.connect() c = conn.cursor(self.cursor_type) - # create a table ane some data to query + # create a table and some data to query with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists dictcursor") - c.execute("""CREATE TABLE dictcursor (name char(20), age int , DOB datetime)""") - data = [("bob", 21, "1990-02-06 23:04:56"), - ("jim", 56, "1955-05-09 13:12:45"), - ("fred", 100, "1911-09-12 01:01:01")] + # include in filterwarnings since for unbuffered dict cursor warning for lack of table + # will only be propagated at start of next execute() call + c.execute( + """CREATE TABLE dictcursor (name char(20), age int , DOB datetime)""" + ) + data = [ + ("bob", 21, "1990-02-06 23:04:56"), + ("jim", 56, "1955-05-09 13:12:45"), + ("fred", 100, "1911-09-12 01:01:01"), + ] c.executemany("insert into dictcursor values (%s,%s,%s)", data) def tearDown(self): c = self.conn.cursor() c.execute("drop table dictcursor") - super(TestDictCursor, self).tearDown() + super().tearDown() def _ensure_cursor_expired(self, cursor): pass def test_DictCursor(self): bob, jim, fred = self.bob.copy(), self.jim.copy(), self.fred.copy() - #all assert test compare to the structure as would come out from MySQLdb + # all assert test compare to the structure as would come out from MySQLdb conn = self.conn c = conn.cursor(self.cursor_type) # try an update which should return no rows c.execute("update dictcursor set age=20 where name='bob'") - bob['age'] = 20 + bob["age"] = 20 # pull back the single row dict for bob and check c.execute("SELECT * from dictcursor where name='bob'") r = c.fetchone() @@ -53,19 +59,23 @@ def test_DictCursor(self): # same again, but via fetchall => tuple) c.execute("SELECT * from dictcursor where name='bob'") r = c.fetchall() - self.assertEqual([bob], r, "fetch a 1 row result via fetchall failed via DictCursor") + self.assertEqual( + [bob], r, "fetch a 1 row result via fetchall failed via DictCursor" + ) # same test again but iterate over the c.execute("SELECT * from dictcursor where name='bob'") for r in c: - self.assertEqual(bob, r, "fetch a 1 row result via iteration failed via DictCursor") + self.assertEqual( + bob, r, "fetch a 1 row result via iteration failed via DictCursor" + ) # get all 3 row via fetchall c.execute("SELECT * from dictcursor") r = c.fetchall() - self.assertEqual([bob,jim,fred], r, "fetchall failed via DictCursor") - #same test again but do a list comprehension + self.assertEqual([bob, jim, fred], r, "fetchall failed via DictCursor") + # same test again but do a list comprehension c.execute("SELECT * from dictcursor") r = list(c) - self.assertEqual([bob,jim,fred], r, "DictCursor should be iterable") + self.assertEqual([bob, jim, fred], r, "DictCursor should be iterable") # get all 2 row via fetchmany c.execute("SELECT * from dictcursor") r = c.fetchmany(2) @@ -73,12 +83,13 @@ def test_DictCursor(self): self._ensure_cursor_expired(c) def test_custom_dict(self): - class MyDict(dict): pass + class MyDict(dict): + pass class MyDictCursor(self.cursor_type): dict_type = MyDict - keys = ['name', 'age', 'DOB'] + keys = ["name", "age", "DOB"] bob = MyDict([(k, self.bob[k]) for k in keys]) jim = MyDict([(k, self.jim[k]) for k in keys]) fred = MyDict([(k, self.fred[k]) for k in keys]) @@ -91,18 +102,15 @@ class MyDictCursor(self.cursor_type): cur.execute("SELECT * FROM dictcursor") r = cur.fetchall() - self.assertEqual([bob, jim, fred], r, - "fetchall failed via MyDictCursor") + self.assertEqual([bob, jim, fred], r, "fetchall failed via MyDictCursor") cur.execute("SELECT * FROM dictcursor") r = list(cur) - self.assertEqual([bob, jim, fred], r, - "list failed via MyDictCursor") + self.assertEqual([bob, jim, fred], r, "list failed via MyDictCursor") cur.execute("SELECT * FROM dictcursor") r = cur.fetchmany(2) - self.assertEqual([bob, jim], r, - "list failed via MyDictCursor") + self.assertEqual([bob, jim], r, "list failed via MyDictCursor") self._ensure_cursor_expired(cur) @@ -112,6 +120,8 @@ class TestSSDictCursor(TestDictCursor): def _ensure_cursor_expired(self, cursor): list(cursor.fetchall_unbuffered()) + if __name__ == "__main__": import unittest + unittest.main() diff --git a/pymysql/tests/test_SSCursor.py b/pymysql/tests/test_SSCursor.py index e6d6cf530..d5e6e2bce 100644 --- a/pymysql/tests/test_SSCursor.py +++ b/pymysql/tests/test_SSCursor.py @@ -1,110 +1,236 @@ -import sys +import pytest + +from pymysql.tests import base +import pymysql.cursors +from pymysql.constants import CLIENT, ER -try: - from pymysql.tests import base - import pymysql.cursors -except Exception: - # For local testing from top-level directory, without installing - sys.path.append('../pymysql') - from pymysql.tests import base - import pymysql.cursors class TestSSCursor(base.PyMySQLTestCase): def test_SSCursor(self): affected_rows = 18446744073709551615 - conn = self.connections[0] + conn = self.connect(client_flag=CLIENT.MULTI_STATEMENTS) data = [ - ('America', '', 'America/Jamaica'), - ('America', '', 'America/Los_Angeles'), - ('America', '', 'America/Lima'), - ('America', '', 'America/New_York'), - ('America', '', 'America/Menominee'), - ('America', '', 'America/Havana'), - ('America', '', 'America/El_Salvador'), - ('America', '', 'America/Costa_Rica'), - ('America', '', 'America/Denver'), - ('America', '', 'America/Detroit'),] - - try: - cursor = conn.cursor(pymysql.cursors.SSCursor) - - # Create table - cursor.execute(('CREATE TABLE tz_data (' - 'region VARCHAR(64),' - 'zone VARCHAR(64),' - 'name VARCHAR(64))')) - - conn.begin() - # Test INSERT - for i in data: - cursor.execute('INSERT INTO tz_data VALUES (%s, %s, %s)', i) - self.assertEqual(conn.affected_rows(), 1, 'affected_rows does not match') + ("America", "", "America/Jamaica"), + ("America", "", "America/Los_Angeles"), + ("America", "", "America/Lima"), + ("America", "", "America/New_York"), + ("America", "", "America/Menominee"), + ("America", "", "America/Havana"), + ("America", "", "America/El_Salvador"), + ("America", "", "America/Costa_Rica"), + ("America", "", "America/Denver"), + ("America", "", "America/Detroit"), + ] + + cursor = conn.cursor(pymysql.cursors.SSCursor) + + # Create table + cursor.execute( + "CREATE TABLE tz_data (region VARCHAR(64), zone VARCHAR(64), name VARCHAR(64))" + ) + + conn.begin() + # Test INSERT + for i in data: + cursor.execute("INSERT INTO tz_data VALUES (%s, %s, %s)", i) + self.assertEqual(conn.affected_rows(), 1, "affected_rows does not match") + conn.commit() + + # Test fetchone() + iter = 0 + cursor.execute("SELECT * FROM tz_data") + while True: + row = cursor.fetchone() + if row is None: + break + iter += 1 + + # Test cursor.rowcount + self.assertEqual( + cursor.rowcount, + affected_rows, + "cursor.rowcount != %s" % (str(affected_rows)), + ) + + # Test cursor.rownumber + self.assertEqual( + cursor.rownumber, iter, "cursor.rowcount != %s" % (str(iter)) + ) + + # Test row came out the same as it went in + self.assertEqual((row in data), True, "Row not found in source data") + + # Test fetchall + cursor.execute("SELECT * FROM tz_data") + self.assertEqual( + len(cursor.fetchall()), + len(data), + "fetchall failed. Number of rows does not match", + ) + + # Test fetchmany + cursor.execute("SELECT * FROM tz_data") + self.assertEqual( + len(cursor.fetchmany(2)), + 2, + "fetchmany failed. Number of rows does not match", + ) + + # So MySQLdb won't throw "Commands out of sync" + while True: + res = cursor.fetchone() + if res is None: + break + + # Test update, affected_rows() + cursor.execute("UPDATE tz_data SET zone = %s", ["Foo"]) + conn.commit() + self.assertEqual( + cursor.rowcount, + len(data), + "Update failed. affected_rows != %s" % (str(len(data))), + ) + + # Test executemany + cursor.executemany("INSERT INTO tz_data VALUES (%s, %s, %s)", data) + self.assertEqual( + cursor.rowcount, + len(data), + "executemany failed. cursor.rowcount != %s" % (str(len(data))), + ) + + # Test multiple datasets + cursor.execute("SELECT 1; SELECT 2; SELECT 3") + self.assertListEqual(list(cursor), [(1,)]) + self.assertTrue(cursor.nextset()) + self.assertListEqual(list(cursor), [(2,)]) + self.assertTrue(cursor.nextset()) + self.assertListEqual(list(cursor), [(3,)]) + self.assertFalse(cursor.nextset()) + + cursor.execute("DROP TABLE IF EXISTS tz_data") + cursor.close() + + def test_execution_time_limit(self): + # this method is similarly implemented in test_cursor + + conn = self.connect() + + # table creation and filling is SSCursor only as it's not provided by self.setUp() + self.safe_create_table( + conn, + "test", + "create table test (data varchar(10))", + ) + with conn.cursor() as cur: + cur.execute( + "insert into test (data) values " + "('row1'), ('row2'), ('row3'), ('row4'), ('row5')" + ) conn.commit() - # Test fetchone() - iter = 0 - cursor.execute('SELECT * FROM tz_data') - while True: - row = cursor.fetchone() - if row is None: - break - iter += 1 - - # Test cursor.rowcount - self.assertEqual(cursor.rowcount, affected_rows, - 'cursor.rowcount != %s' % (str(affected_rows))) - - # Test cursor.rownumber - self.assertEqual(cursor.rownumber, iter, - 'cursor.rowcount != %s' % (str(iter))) - - # Test row came out the same as it went in - self.assertEqual((row in data), True, - 'Row not found in source data') - - # Test fetchall - cursor.execute('SELECT * FROM tz_data') - self.assertEqual(len(cursor.fetchall()), len(data), - 'fetchall failed. Number of rows does not match') - - # Test fetchmany - cursor.execute('SELECT * FROM tz_data') - self.assertEqual(len(cursor.fetchmany(2)), 2, - 'fetchmany failed. Number of rows does not match') - - # So MySQLdb won't throw "Commands out of sync" - while True: - res = cursor.fetchone() - if res is None: - break - - # Test update, affected_rows() - cursor.execute('UPDATE tz_data SET zone = %s', ['Foo']) - conn.commit() - self.assertEqual(cursor.rowcount, len(data), - 'Update failed. affected_rows != %s' % (str(len(data)))) - - # Test executemany - cursor.executemany('INSERT INTO tz_data VALUES (%s, %s, %s)', data) - self.assertEqual(cursor.rowcount, len(data), - 'executemany failed. cursor.rowcount != %s' % (str(len(data)))) - - # Test multiple datasets - cursor.execute('SELECT 1; SELECT 2; SELECT 3') - self.assertListEqual(list(cursor), [(1, )]) - self.assertTrue(cursor.nextset()) - self.assertListEqual(list(cursor), [(2, )]) - self.assertTrue(cursor.nextset()) - self.assertListEqual(list(cursor), [(3, )]) - self.assertFalse(cursor.nextset()) - - finally: - cursor.execute('DROP TABLE tz_data') - cursor.close() + db_type = self.get_mysql_vendor(conn) + + with conn.cursor(pymysql.cursors.SSCursor) as cur: + # MySQL MAX_EXECUTION_TIME takes ms + # MariaDB max_statement_time takes seconds as int/float, introduced in 10.1 + + # this will sleep 0.01 seconds per row + if db_type == "mysql": + sql = ( + "SELECT /*+ MAX_EXECUTION_TIME(2000) */ data, sleep(0.01) FROM test" + ) + else: + sql = "SET STATEMENT max_statement_time=2 FOR SELECT data, sleep(0.01) FROM test" + + cur.execute(sql) + # unlike Cursor, SSCursor returns a list of tuples here + self.assertEqual( + cur.fetchall(), + [ + ("row1", 0), + ("row2", 0), + ("row3", 0), + ("row4", 0), + ("row5", 0), + ], + ) + + if db_type == "mysql": + sql = ( + "SELECT /*+ MAX_EXECUTION_TIME(2000) */ data, sleep(0.01) FROM test" + ) + else: + sql = "SET STATEMENT max_statement_time=2 FOR SELECT data, sleep(0.01) FROM test" + cur.execute(sql) + self.assertEqual(cur.fetchone(), ("row1", 0)) + + # this discards the previous unfinished query and raises an + # incomplete unbuffered query warning + with pytest.warns(UserWarning): + cur.execute("SELECT 1") + self.assertEqual(cur.fetchone(), (1,)) + + # SSCursor will not read the EOF packet until we try to read + # another row. Skipping this will raise an incomplete unbuffered + # query warning in the next cur.execute(). + self.assertEqual(cur.fetchone(), None) + + if db_type == "mysql": + sql = "SELECT /*+ MAX_EXECUTION_TIME(1) */ data, sleep(1) FROM test" + else: + sql = "SET STATEMENT max_statement_time=0.001 FOR SELECT data, sleep(1) FROM test" + with pytest.raises(pymysql.err.OperationalError) as cm: + # in an unbuffered cursor the OperationalError may not show up + # until fetching the entire result + cur.execute(sql) + cur.fetchall() + + if db_type == "mysql": + # this constant was only introduced in MySQL 5.7, not sure + # what was returned before, may have been ER_QUERY_INTERRUPTED + self.assertEqual(cm.value.args[0], ER.QUERY_TIMEOUT) + else: + self.assertEqual(cm.value.args[0], ER.STATEMENT_TIMEOUT) + + # connection should still be fine at this point + cur.execute("SELECT 1") + self.assertEqual(cur.fetchone(), (1,)) + + def test_warnings(self): + con = self.connect() + cur = con.cursor(pymysql.cursors.SSCursor) + cur.execute("DROP TABLE IF EXISTS `no_exists_table`") + self.assertEqual(cur.warning_count, 1) + + cur.execute("SHOW WARNINGS") + w = cur.fetchone() + self.assertEqual(w[1], ER.BAD_TABLE_ERROR) + self.assertIn( + "no_exists_table", + w[2], + ) + + # ensure unbuffered result is finished + self.assertIsNone(cur.fetchone()) + + cur.execute("SELECT 1") + self.assertEqual(cur.fetchone(), (1,)) + self.assertIsNone(cur.fetchone()) + + self.assertEqual(cur.warning_count, 0) + + cur.execute("SELECT CAST('abc' AS SIGNED)") + # this ensures fully retrieving the unbuffered result + rows = cur.fetchmany(2) + self.assertEqual(len(rows), 1) + self.assertEqual(cur.warning_count, 1) + __all__ = ["TestSSCursor"] if __name__ == "__main__": import unittest + unittest.main() diff --git a/pymysql/tests/test_basic.py b/pymysql/tests/test_basic.py index 579d7fd25..0fe13b59d 100644 --- a/pymysql/tests/test_basic.py +++ b/pymysql/tests/test_basic.py @@ -1,14 +1,11 @@ -import pymysql.cursors - -from pymysql.tests import base -from pymysql import util -from pymysql.err import ProgrammingError - -import time import datetime -import warnings +import json +import time -from unittest2 import SkipTest +import pytest + +import pymysql.cursors +from pymysql.tests import base __all__ = ["TestConversion", "TestCursor", "TestBulkInserts"] @@ -16,54 +13,105 @@ class TestConversion(base.PyMySQLTestCase): def test_datatypes(self): - """ test every data type """ - conn = self.connections[0] + """test every data type""" + conn = self.connect() c = conn.cursor() - c.execute("create table test_datatypes (b bit, i int, l bigint, f real, s varchar(32), u varchar(32), bb blob, d date, dt datetime, ts timestamp, td time, t time, st datetime)") + c.execute( + """ +create table test_datatypes ( + b bit, + i int, + l bigint, + f real, + s varchar(32), + u varchar(32), + bb blob, + d date, + dt datetime, + ts timestamp, + td time, + t time, + st datetime) +""" + ) try: # insert values - v = (True, -3, 123456789012, 5.7, "hello'\" world", u"Espa\xc3\xb1ol", "binary\x00data".encode(conn.charset), datetime.date(1988,2,2), datetime.datetime(2014, 5, 15, 7, 45, 57), datetime.timedelta(5,6), datetime.time(16,32), time.localtime()) - c.execute("insert into test_datatypes (b,i,l,f,s,u,bb,d,dt,td,t,st) values (%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s)", v) + v = ( + True, + -3, + 123456789012, + 5.7, + "hello'\" world", + "Espa\xc3\xb1ol", + "binary\x00data".encode(conn.encoding), + datetime.date(1988, 2, 2), + datetime.datetime(2014, 5, 15, 7, 45, 57), + datetime.timedelta(5, 6), + datetime.time(16, 32), + time.localtime(), + ) + c.execute( + "insert into test_datatypes (b,i,l,f,s,u,bb,d,dt,td,t,st) values" + " (%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s)", + v, + ) c.execute("select b,i,l,f,s,u,bb,d,dt,td,t,st from test_datatypes") r = c.fetchone() - self.assertEqual(util.int2byte(1), r[0]) + self.assertEqual(b"\x01", r[0]) self.assertEqual(v[1:10], r[1:10]) - self.assertEqual(datetime.timedelta(0, 60 * (v[10].hour * 60 + v[10].minute)), r[10]) + self.assertEqual( + datetime.timedelta(0, 60 * (v[10].hour * 60 + v[10].minute)), r[10] + ) self.assertEqual(datetime.datetime(*v[-1][:6]), r[-1]) c.execute("delete from test_datatypes") # check nulls - c.execute("insert into test_datatypes (b,i,l,f,s,u,bb,d,dt,td,t,st) values (%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s)", [None] * 12) + c.execute( + "insert into test_datatypes (b,i,l,f,s,u,bb,d,dt,td,t,st)" + " values (%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s,%s)", + [None] * 12, + ) c.execute("select b,i,l,f,s,u,bb,d,dt,td,t,st from test_datatypes") r = c.fetchone() self.assertEqual(tuple([None] * 12), r) c.execute("delete from test_datatypes") - # check sequence type - c.execute("insert into test_datatypes (i, l) values (2,4), (6,8), (10,12)") - c.execute("select l from test_datatypes where i in %s order by i", ((2,6),)) - r = c.fetchall() - self.assertEqual(((4,),(8,)), r) + # check sequences type + for seq_type in (tuple, list, set, frozenset): + c.execute( + "insert into test_datatypes (i, l) values (2,4), (6,8), (10,12)" + ) + seq = seq_type([2, 6]) + c.execute( + "select l from test_datatypes where i in %s order by i", (seq,) + ) + r = c.fetchall() + self.assertEqual(((4,), (8,)), r) + c.execute("delete from test_datatypes") + finally: c.execute("drop table test_datatypes") def test_dict(self): - """ test dict escaping """ - conn = self.connections[0] + """test dict escaping""" + conn = self.connect() c = conn.cursor() c.execute("create table test_dict (a integer, b integer, c integer)") try: - c.execute("insert into test_dict (a,b,c) values (%(a)s, %(b)s, %(c)s)", {"a":1,"b":2,"c":3}) + c.execute( + "insert into test_dict (a,b,c) values (%(a)s, %(b)s, %(c)s)", + {"a": 1, "b": 2, "c": 3}, + ) c.execute("select a,b,c from test_dict") - self.assertEqual((1,2,3), c.fetchone()) + self.assertEqual((1, 2, 3), c.fetchone()) finally: c.execute("drop table test_dict") def test_string(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() c.execute("create table test_dict (a text)") test_value = "I am a test string" @@ -75,7 +123,7 @@ def test_string(self): c.execute("drop table test_dict") def test_integer(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() c.execute("create table test_dict (a integer)") test_value = 12345 @@ -86,55 +134,69 @@ def test_integer(self): finally: c.execute("drop table test_dict") - def test_blob(self): + def test_binary(self): """test binary data""" - data = bytes(bytearray(range(256)) * 4) - conn = self.connections[0] + data = bytes(bytearray(range(255))) + conn = self.connect() self.safe_create_table( - conn, "test_blob", "create table test_blob (b blob)") + conn, "test_binary", "create table test_binary (b binary(255))" + ) with conn.cursor() as c: - c.execute("insert into test_blob (b) values (%s)", (data,)) + c.execute("insert into test_binary (b) values (_binary %s)", (data,)) + c.execute("select b from test_binary") + self.assertEqual(data, c.fetchone()[0]) + + def test_blob(self): + """test blob data""" + data = bytes(bytearray(range(256)) * 4) + conn = self.connect() + self.safe_create_table(conn, "test_blob", "create table test_blob (b blob)") + + with conn.cursor() as c: + c.execute("insert into test_blob (b) values (_binary %s)", (data,)) c.execute("select b from test_blob") self.assertEqual(data, c.fetchone()[0]) def test_untyped(self): - """ test conversion of null, empty string """ - conn = self.connections[0] + """test conversion of null, empty string""" + conn = self.connect() c = conn.cursor() c.execute("select null,''") - self.assertEqual((None,u''), c.fetchone()) + self.assertEqual((None, ""), c.fetchone()) c.execute("select '',null") - self.assertEqual((u'',None), c.fetchone()) + self.assertEqual(("", None), c.fetchone()) def test_timedelta(self): - """ test timedelta conversion """ - conn = self.connections[0] + """test timedelta conversion""" + conn = self.connect() c = conn.cursor() - c.execute("select time('12:30'), time('23:12:59'), time('23:12:59.05100'), time('-12:30'), time('-23:12:59'), time('-23:12:59.05100'), time('-00:30')") - self.assertEqual((datetime.timedelta(0, 45000), - datetime.timedelta(0, 83579), - datetime.timedelta(0, 83579, 51000), - -datetime.timedelta(0, 45000), - -datetime.timedelta(0, 83579), - -datetime.timedelta(0, 83579, 51000), - -datetime.timedelta(0, 1800)), - c.fetchone()) + c.execute( + "select time('12:30'), time('23:12:59'), time('23:12:59.05100')," + + " time('-12:30'), time('-23:12:59'), time('-23:12:59.05100'), time('-00:30')" + ) + self.assertEqual( + ( + datetime.timedelta(0, 45000), + datetime.timedelta(0, 83579), + datetime.timedelta(0, 83579, 51000), + -datetime.timedelta(0, 45000), + -datetime.timedelta(0, 83579), + -datetime.timedelta(0, 83579, 51000), + -datetime.timedelta(0, 1800), + ), + c.fetchone(), + ) def test_datetime_microseconds(self): - """ test datetime conversion w microseconds""" + """test datetime conversion w microseconds""" - conn = self.connections[0] - if not self.mysql_server_is(conn, (5, 6, 4)): - raise SkipTest("target backend does not support microseconds") + conn = self.connect() c = conn.cursor() dt = datetime.datetime(2013, 11, 12, 9, 9, 9, 123450) c.execute("create table test_datetime (id int, ts datetime(6))") try: - c.execute( - "insert into test_datetime values (%s, %s)", - (1, dt) - ) + c.execute("insert into test_datetime values (%s, %s)", (1, dt)) c.execute("select ts from test_datetime") self.assertEqual((dt,), c.fetchone()) finally: @@ -147,7 +209,7 @@ class TestCursor(base.PyMySQLTestCase): # compatible with the DB-API 2.0 spec and has not broken # any unit tests for anything we've tried. - #def test_description(self): + # def test_description(self): # """ test description attribute """ # # result is from MySQLdb module # r = (('Host', 254, 11, 60, 60, 0, 0), @@ -189,15 +251,15 @@ class TestCursor(base.PyMySQLTestCase): # ('max_updates', 3, 1, 11, 11, 0, 0), # ('max_connections', 3, 1, 11, 11, 0, 0), # ('max_user_connections', 3, 1, 11, 11, 0, 0)) - # conn = self.connections[0] + # conn = self.connect() # c = conn.cursor() # c.execute("select * from mysql.user") # # self.assertEqual(r, c.description) def test_fetch_no_result(self): - """ test a fetchone() with no rows """ - conn = self.connections[0] + """test a fetchone() with no rows""" + conn = self.connect() c = conn.cursor() c.execute("create table test_nr (b varchar(32))") try: @@ -208,87 +270,132 @@ def test_fetch_no_result(self): c.execute("drop table test_nr") def test_aggregates(self): - """ test aggregate functions """ - conn = self.connections[0] + """test aggregate functions""" + conn = self.connect() c = conn.cursor() try: - c.execute('create table test_aggregates (i integer)') + c.execute("create table test_aggregates (i integer)") for i in range(0, 10): - c.execute('insert into test_aggregates (i) values (%s)', (i,)) - c.execute('select sum(i) from test_aggregates') - r, = c.fetchone() - self.assertEqual(sum(range(0,10)), r) + c.execute("insert into test_aggregates (i) values (%s)", (i,)) + c.execute("select sum(i) from test_aggregates") + (r,) = c.fetchone() + self.assertEqual(sum(range(0, 10)), r) finally: - c.execute('drop table test_aggregates') + c.execute("drop table test_aggregates") def test_single_tuple(self): - """ test a single tuple """ - conn = self.connections[0] + """test a single tuple""" + conn = self.connect() c = conn.cursor() self.safe_create_table( - conn, 'mystuff', - "create table mystuff (id integer primary key)") + conn, "mystuff", "create table mystuff (id integer primary key)" + ) c.execute("insert into mystuff (id) values (1)") c.execute("insert into mystuff (id) values (2)") c.execute("select id from mystuff where id in %s", ((1,),)) self.assertEqual([(1,)], list(c.fetchall())) c.close() + def test_json(self): + args = self.databases[0].copy() + args["charset"] = "utf8mb4" + conn = pymysql.connect(**args) + # MariaDB only has limited JSON support, stores data as longtext + # https://mariadb.com/kb/en/json-data-type/ + if not self.mysql_server_is(conn, (5, 7, 0)): + pytest.skip("JSON type is only supported on MySQL >= 5.7") -class TestBulkInserts(base.PyMySQLTestCase): + self.safe_create_table( + conn, + "test_json", + """\ +create table test_json ( + id int not null, + json JSON not null, + primary key (id) +);""", + ) + cur = conn.cursor() + + json_str = '{"hello": "こんにちは"}' + cur.execute("INSERT INTO test_json (id, `json`) values (42, %s)", (json_str,)) + cur.execute("SELECT `json` from `test_json` WHERE `id`=42") + res = cur.fetchone()[0] + self.assertEqual(json.loads(res), json.loads(json_str)) + + if self.get_mysql_vendor(conn) == "mysql": + cur.execute("SELECT CAST(%s AS JSON) AS x", (json_str,)) + res = cur.fetchone()[0] + self.assertEqual(json.loads(res), json.loads(json_str)) + +class TestBulkInserts(base.PyMySQLTestCase): cursor_type = pymysql.cursors.DictCursor def setUp(self): - super(TestBulkInserts, self).setUp() - self.conn = conn = self.connections[0] - c = conn.cursor(self.cursor_type) + super().setUp() + self.conn = conn = self.connect() - # create a table ane some data to query - self.safe_create_table(conn, 'bulkinsert', """\ + # create a table and some data to query + self.safe_create_table( + conn, + "bulkinsert", + """\ CREATE TABLE bulkinsert ( -id int(11), +id int, name char(20), age int, height int, PRIMARY KEY (id) ) -""") +""", + ) def _verify_records(self, data): - conn = self.connections[0] + conn = self.connect() cursor = conn.cursor() cursor.execute("SELECT id, name, age, height from bulkinsert") result = cursor.fetchall() self.assertEqual(sorted(data), sorted(result)) def test_bulk_insert(self): - conn = self.connections[0] + conn = self.connect() cursor = conn.cursor() data = [(0, "bob", 21, 123), (1, "jim", 56, 45), (2, "fred", 100, 180)] - cursor.executemany("insert into bulkinsert (id, name, age, height) " - "values (%s,%s,%s,%s)", data) + cursor.executemany( + "insert into bulkinsert (id, name, age, height) values (%s,%s,%s,%s)", + data, + ) self.assertEqual( - cursor._last_executed, bytearray( - b"insert into bulkinsert (id, name, age, height) values " - b"(0,'bob',21,123),(1,'jim',56,45),(2,'fred',100,180)")) - cursor.execute('commit') + cursor._executed, + bytearray( + b"insert into bulkinsert (id, name, age, height) values " + b"(0,'bob',21,123),(1,'jim',56,45),(2,'fred',100,180)" + ), + ) + cursor.execute("commit") self._verify_records(data) def test_bulk_insert_multiline_statement(self): - conn = self.connections[0] + conn = self.connect() cursor = conn.cursor() data = [(0, "bob", 21, 123), (1, "jim", 56, 45), (2, "fred", 100, 180)] - cursor.executemany("""insert + cursor.executemany( + """insert into bulkinsert (id, name, age, height) values (%s, %s , %s, %s ) - """, data) - self.assertEqual(cursor._last_executed.strip(), bytearray(b"""insert + """, + data, + ) + self.assertEqual( + cursor._executed.strip(), + bytearray( + b"""insert into bulkinsert (id, name, age, height) values (0, @@ -297,33 +404,43 @@ def test_bulk_insert_multiline_statement(self): 'jim' , 56, 45 ),(2, 'fred' , 100, -180 )""")) - cursor.execute('commit') +180 )""" + ), + ) + cursor.execute("commit") self._verify_records(data) def test_bulk_insert_single_record(self): - conn = self.connections[0] + conn = self.connect() cursor = conn.cursor() data = [(0, "bob", 21, 123)] - cursor.executemany("insert into bulkinsert (id, name, age, height) " - "values (%s,%s,%s,%s)", data) - cursor.execute('commit') + cursor.executemany( + "insert into bulkinsert (id, name, age, height) values (%s,%s,%s,%s)", + data, + ) + cursor.execute("commit") self._verify_records(data) def test_issue_288(self): - """executemany should work with "insert ... on update" """ - conn = self.connections[0] + """executemany should work with "insert ... on update""" + conn = self.connect() cursor = conn.cursor() data = [(0, "bob", 21, 123), (1, "jim", 56, 45), (2, "fred", 100, 180)] - cursor.executemany("""insert + cursor.executemany( + """insert into bulkinsert (id, name, age, height) values (%s, %s , %s, %s ) on duplicate key update age = values(age) - """, data) - self.assertEqual(cursor._last_executed.strip(), bytearray(b"""insert + """, + data, + ) + self.assertEqual( + cursor._executed.strip(), + bytearray( + b"""insert into bulkinsert (id, name, age, height) values (0, @@ -333,16 +450,8 @@ def test_issue_288(self): 45 ),(2, 'fred' , 100, 180 ) on duplicate key update -age = values(age)""")) - cursor.execute('commit') +age = values(age)""" + ), + ) + cursor.execute("commit") self._verify_records(data) - - def test_warnings(self): - con = self.connections[0] - cur = con.cursor() - with warnings.catch_warnings(record=True) as ws: - warnings.simplefilter("always") - cur.execute("drop table if exists no_exists_table") - self.assertEqual(len(ws), 1) - self.assertEqual(ws[0].category, pymysql.Warning) - self.assertTrue(u"no_exists_table" in str(ws[0].message)) diff --git a/pymysql/tests/test_charset.py b/pymysql/tests/test_charset.py new file mode 100644 index 000000000..1dbe6fffa --- /dev/null +++ b/pymysql/tests/test_charset.py @@ -0,0 +1,44 @@ +import pymysql.charset + + +def test_utf8(): + utf8mb3 = pymysql.charset.charset_by_name("utf8mb3") + assert utf8mb3.name == "utf8mb3" + assert utf8mb3.collation == "utf8mb3_general_ci" + assert ( + repr(utf8mb3) + == "Charset(id=33, name='utf8mb3', collation='utf8mb3_general_ci')" + ) + + # MySQL 8.0 changed the default collation for utf8mb4. + # But we use old default for compatibility. + utf8mb4 = pymysql.charset.charset_by_name("utf8mb4") + assert utf8mb4.name == "utf8mb4" + assert utf8mb4.collation == "utf8mb4_general_ci" + assert ( + repr(utf8mb4) + == "Charset(id=45, name='utf8mb4', collation='utf8mb4_general_ci')" + ) + + # utf8 is alias of utf8mb4 since MySQL 8.0, and PyMySQL v1.1. + lowercase_utf8 = pymysql.charset.charset_by_name("utf8") + assert lowercase_utf8 == utf8mb4 + + # Regardless of case, UTF8 (which is special cased) should resolve to the same thing + uppercase_utf8 = pymysql.charset.charset_by_name("UTF8") + mixedcase_utf8 = pymysql.charset.charset_by_name("UtF8") + assert uppercase_utf8 == lowercase_utf8 + assert mixedcase_utf8 == lowercase_utf8 + + +def test_case_sensitivity(): + lowercase_latin1 = pymysql.charset.charset_by_name("latin1") + assert lowercase_latin1 is not None + + # lowercase and uppercase should resolve to the same charset + uppercase_latin1 = pymysql.charset.charset_by_name("LATIN1") + assert uppercase_latin1 == lowercase_latin1 + + # lowercase and mixed case should resolve to the same charset + mixedcase_latin1 = pymysql.charset.charset_by_name("LaTiN1") + assert mixedcase_latin1 == lowercase_latin1 diff --git a/pymysql/tests/test_connection.py b/pymysql/tests/test_connection.py index 203f8276d..1a16c982a 100644 --- a/pymysql/tests/test_connection.py +++ b/pymysql/tests/test_connection.py @@ -1,32 +1,476 @@ import datetime -import decimal +import ssl +import pytest import time -import sys -import unittest2 +from unittest import mock + import pymysql from pymysql.tests import base +from pymysql.constants import CLIENT + + +class TempUser: + def __init__(self, c, user, db, auth=None, authdata=None, password=None): + self._c = c + self._user = user + self._db = db + create = "CREATE USER " + user + if password is not None: + create += " IDENTIFIED BY '%s'" % password + elif auth is not None: + create += " IDENTIFIED WITH %s" % auth + if authdata is not None: + create += " AS '%s'" % authdata + try: + c.execute(create) + self._created = True + except pymysql.err.InternalError: + # already exists - TODO need to check the same plugin applies + self._created = False + try: + c.execute(f"GRANT SELECT ON {db}.* TO {user}") + self._grant = True + except pymysql.err.InternalError: + self._grant = False + + def __enter__(self): + return self + + def __exit__(self, exc_type, exc_value, traceback): + if self._grant: + self._c.execute(f"REVOKE SELECT ON {self._db}.* FROM {self._user}") + if self._created: + self._c.execute("DROP USER %s" % self._user) + + +class TestAuthentication(base.PyMySQLTestCase): + socket_auth = False + socket_found = False + two_questions_found = False + three_attempts_found = False + pam_found = False + mysql_old_password_found = False + sha256_password_found = False + ed25519_found = False + + import os + + osuser = os.environ.get("USER") + + # socket auth requires the current user and for the connection to be a socket + # rest do grants @localhost due to incomplete logic - TODO change to @% then + db = base.PyMySQLTestCase.databases[0].copy() + + socket_auth = db.get("unix_socket") is not None and db.get("host") in ( + "localhost", + "127.0.0.1", + ) + + cur = pymysql.connect(**db).cursor() + del db["user"] + cur.execute("SHOW PLUGINS") + for r in cur: + if (r[1], r[2]) != ("ACTIVE", "AUTHENTICATION"): + continue + if r[3] == "auth_socket.so" or r[0] == "unix_socket": + socket_plugin_name = r[0] + socket_found = True + elif r[3] == "dialog_examples.so": + if r[0] == "two_questions": + two_questions_found = True + elif r[0] == "three_attempts": + three_attempts_found = True + elif r[0] == "pam": + pam_found = True + pam_plugin_name = r[3].split(".")[0] + if pam_plugin_name == "auth_pam": + pam_plugin_name = "pam" + # MySQL: authentication_pam + # https://dev.mysql.com/doc/refman/5.5/en/pam-authentication-plugin.html + + # MariaDB: pam + # https://mariadb.com/kb/en/mariadb/pam-authentication-plugin/ + + # Names differ but functionality is close + elif r[0] == "mysql_old_password": + mysql_old_password_found = True + elif r[0] == "sha256_password": + sha256_password_found = True + elif r[0] == "ed25519": + ed25519_found = True + # else: + # print("plugin: %r" % r[0]) + + def test_plugin(self): + conn = self.connect() + cur = conn.cursor() + cur.execute( + "select plugin from mysql.user where concat(user, '@', host)=current_user()" + ) + for r in cur: + self.assertIn(conn._auth_plugin_name, (r[0], "mysql_native_password")) + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(socket_found, reason="socket plugin already installed") + def testSocketAuthInstallPlugin(self): + # needs plugin. lets install it. + cur = self.connect().cursor() + try: + cur.execute("install plugin auth_socket soname 'auth_socket.so'") + TestAuthentication.socket_found = True + self.socket_plugin_name = "auth_socket" + self.realtestSocketAuth() + except pymysql.err.InternalError: + try: + cur.execute("install soname 'auth_socket'") + TestAuthentication.socket_found = True + self.socket_plugin_name = "unix_socket" + self.realtestSocketAuth() + except pymysql.err.InternalError: + TestAuthentication.socket_found = False + pytest.skip("we couldn't install the socket plugin") + finally: + if TestAuthentication.socket_found: + cur.execute("uninstall plugin %s" % self.socket_plugin_name) + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(not socket_found, reason="no socket plugin") + def testSocketAuth(self): + self.realtestSocketAuth() + + def realtestSocketAuth(self): + with TempUser( + self.connect().cursor(), + TestAuthentication.osuser + "@localhost", + self.databases[0]["database"], + self.socket_plugin_name, + ): + pymysql.connect(user=TestAuthentication.osuser, **self.db) + + class Dialog: + fail = False + + def __init__(self, con): + self.fail = TestAuthentication.Dialog.fail + pass + + def prompt(self, echo, prompt): + if self.fail: + self.fail = False + return b"bad guess at a password" + return self.m.get(prompt) + + class DialogHandler: + def __init__(self, con): + self.con = con + + def authenticate(self, pkt): + while True: + flag = pkt.read_uint8() + # echo = (flag & 0x06) == 0x02 + last = (flag & 0x01) == 0x01 + prompt = pkt.read_all() + + if prompt == b"Password, please:": + self.con.write_packet(b"stillnotverysecret\0") + else: + self.con.write_packet(b"no idea what to do with this prompt\0") + pkt = self.con._read_packet() + pkt.check_error() + if pkt.is_ok_packet() or last: + break + return pkt + + class DefectiveHandler: + def __init__(self, con): + self.con = con + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif( + two_questions_found, reason="two_questions plugin already installed" + ) + def testDialogAuthTwoQuestionsInstallPlugin(self): + # needs plugin. lets install it. + cur = self.connect().cursor() + try: + cur.execute("install plugin two_questions soname 'dialog_examples.so'") + TestAuthentication.two_questions_found = True + self.realTestDialogAuthTwoQuestions() + except pymysql.err.InternalError: + pytest.skip("we couldn't install the two_questions plugin") + finally: + if TestAuthentication.two_questions_found: + cur.execute("uninstall plugin two_questions") + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(not two_questions_found, reason="no two questions auth plugin") + def testDialogAuthTwoQuestions(self): + self.realTestDialogAuthTwoQuestions() + + def realTestDialogAuthTwoQuestions(self): + TestAuthentication.Dialog.fail = False + TestAuthentication.Dialog.m = { + b"Password, please:": b"notverysecret", + b"Are you sure ?": b"yes, of course", + } + with TempUser( + self.connect().cursor(), + "pymysql_2q@localhost", + self.databases[0]["database"], + "two_questions", + "notverysecret", + ): + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect(user="pymysql_2q", **self.db) + pymysql.connect( + user="pymysql_2q", + auth_plugin_map={b"dialog": TestAuthentication.Dialog}, + **self.db, + ) + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif( + three_attempts_found, reason="three_attempts plugin already installed" + ) + def testDialogAuthThreeAttemptsQuestionsInstallPlugin(self): + # needs plugin. lets install it. + cur = self.connect().cursor() + try: + cur.execute("install plugin three_attempts soname 'dialog_examples.so'") + TestAuthentication.three_attempts_found = True + self.realTestDialogAuthThreeAttempts() + except pymysql.err.InternalError: + pytest.skip("we couldn't install the three_attempts plugin") + finally: + if TestAuthentication.three_attempts_found: + cur.execute("uninstall plugin three_attempts") + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(not three_attempts_found, reason="no three attempts plugin") + def testDialogAuthThreeAttempts(self): + self.realTestDialogAuthThreeAttempts() + + def realTestDialogAuthThreeAttempts(self): + TestAuthentication.Dialog.m = {b"Password, please:": b"stillnotverysecret"} + TestAuthentication.Dialog.fail = ( + True # fail just once. We've got three attempts after all + ) + with TempUser( + self.connect().cursor(), + "pymysql_3a@localhost", + self.databases[0]["database"], + "three_attempts", + "stillnotverysecret", + ): + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"dialog": TestAuthentication.Dialog}, + **self.db, + ) + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"dialog": TestAuthentication.DialogHandler}, + **self.db, + ) + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user="pymysql_3a", auth_plugin_map={b"dialog": object}, **self.db + ) + + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"dialog": TestAuthentication.DefectiveHandler}, + **self.db, + ) + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"notdialogplugin": TestAuthentication.Dialog}, + **self.db, + ) + TestAuthentication.Dialog.m = {b"Password, please:": b"I do not know"} + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"dialog": TestAuthentication.Dialog}, + **self.db, + ) + TestAuthentication.Dialog.m = {b"Password, please:": None} + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user="pymysql_3a", + auth_plugin_map={b"dialog": TestAuthentication.Dialog}, + **self.db, + ) + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(pam_found, reason="pam plugin already installed") + @pytest.mark.skipif( + os.environ.get("PASSWORD") is None, reason="PASSWORD env var required" + ) + @pytest.mark.skipif( + os.environ.get("PAMSERVICE") is None, reason="PAMSERVICE env var required" + ) + def testPamAuthInstallPlugin(self): + # needs plugin. lets install it. + cur = self.connect().cursor() + try: + cur.execute("install plugin pam soname 'auth_pam.so'") + TestAuthentication.pam_found = True + self.realTestPamAuth() + except pymysql.err.InternalError: + pytest.skip("we couldn't install the auth_pam plugin") + finally: + if TestAuthentication.pam_found: + cur.execute("uninstall plugin pam") + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif(not pam_found, reason="no pam plugin") + @pytest.mark.skipif( + os.environ.get("PASSWORD") is None, reason="PASSWORD env var required" + ) + @pytest.mark.skipif( + os.environ.get("PAMSERVICE") is None, reason="PAMSERVICE env var required" + ) + def testPamAuth(self): + self.realTestPamAuth() + + def realTestPamAuth(self): + db = self.db.copy() + import os + + db["password"] = os.environ.get("PASSWORD") + cur = self.connect().cursor() + try: + cur.execute("show grants for " + TestAuthentication.osuser + "@localhost") + grants = cur.fetchone()[0] + cur.execute("drop user " + TestAuthentication.osuser + "@localhost") + except pymysql.OperationalError as e: + # assuming the user doesn't exist which is ok too + self.assertEqual(1045, e.args[0]) + grants = None + with TempUser( + cur, + TestAuthentication.osuser + "@localhost", + self.databases[0]["database"], + "pam", + os.environ.get("PAMSERVICE"), + ): + try: + pymysql.connect(user=TestAuthentication.osuser, **db) + db["password"] = "very bad guess at password" + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user=TestAuthentication.osuser, + auth_plugin_map={ + b"mysql_cleartext_password": TestAuthentication.DefectiveHandler + }, + **self.db, + ) + except pymysql.OperationalError as e: + self.assertEqual(1045, e.args[0]) + # we had 'bad guess at password' work with pam. Well at least we get + # a permission denied here + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect( + user=TestAuthentication.osuser, + auth_plugin_map={ + b"mysql_cleartext_password": TestAuthentication.DefectiveHandler + }, + **self.db, + ) + if grants: + # recreate the user + cur.execute(grants) + + @pytest.mark.skipif(not socket_auth, reason="connection to unix_socket required") + @pytest.mark.skipif( + not sha256_password_found, + reason="no sha256 password authentication plugin found", + ) + def testAuthSHA256(self): + conn = self.connect() + c = conn.cursor() + with TempUser( + c, + "pymysql_sha256@localhost", + self.databases[0]["database"], + "sha256_password", + ): + c.execute("SET PASSWORD FOR 'pymysql_sha256'@'localhost' ='Sh@256Pa33'") + c.execute("FLUSH PRIVILEGES") + db = self.db.copy() + db["password"] = "Sh@256Pa33" + # Although SHA256 is supported, need the configuration of public key of + # the mysql server. Currently will get error by this test. + with self.assertRaises(pymysql.err.OperationalError): + pymysql.connect(user="pymysql_sha256", **db) + + @pytest.mark.skipif(not ed25519_found, reason="no ed25519 authention plugin") + def testAuthEd25519(self): + db = self.db.copy() + del db["password"] + conn = self.connect() + c = conn.cursor() + c.execute("select ed25519_password(''), ed25519_password('ed25519_password')") + for r in c: + empty_pass = r[0].decode("ascii") + non_empty_pass = r[1].decode("ascii") + + with TempUser( + c, + "pymysql_ed25519", + self.databases[0]["database"], + "ed25519", + empty_pass, + ): + pymysql.connect(user="pymysql_ed25519", password="", **db) + + with TempUser( + c, + "pymysql_ed25519", + self.databases[0]["database"], + "ed25519", + non_empty_pass, + ): + pymysql.connect(user="pymysql_ed25519", password="ed25519_password", **db) class TestConnection(base.PyMySQLTestCase): def test_utf8mb4(self): """This test requires MySQL >= 5.5""" arg = self.databases[0].copy() - arg['charset'] = 'utf8mb4' - conn = pymysql.connect(**arg) + arg["charset"] = "utf8mb4" + pymysql.connect(**arg) + + def test_set_character_set(self): + con = self.connect() + cur = con.cursor() + + con.set_character_set("latin1") + cur.execute("SELECT @@character_set_connection") + self.assertEqual(cur.fetchone(), ("latin1",)) + self.assertEqual(con.encoding, "cp1252") + + con.set_character_set("utf8mb4", "utf8mb4_general_ci") + cur.execute("SELECT @@character_set_connection, @@collation_connection") + self.assertEqual(cur.fetchone(), ("utf8mb4", "utf8mb4_general_ci")) + self.assertEqual(con.encoding, "utf8") def test_largedata(self): """Large query and response (>=16MB)""" - cur = self.connections[0].cursor() + cur = self.connect().cursor() cur.execute("SELECT @@max_allowed_packet") - if cur.fetchone()[0] < 16*1024*1024 + 10: + if cur.fetchone()[0] < 16 * 1024 * 1024 + 10: print("Set max_allowed_packet to bigger than 17MB") return - t = 'a' * (16*1024*1024) + t = "a" * (16 * 1024 * 1024) cur.execute("SELECT '" + t + "'") assert cur.fetchone()[0] == t def test_autocommit(self): - con = self.connections[0] + con = self.connect() self.assertFalse(con.get_autocommit()) cur = con.cursor() @@ -39,16 +483,16 @@ def test_autocommit(self): self.assertEqual(cur.fetchone()[0], 0) def test_select_db(self): - con = self.connections[0] - current_db = self.databases[0]['db'] - other_db = self.databases[1]['db'] + con = self.connect() + current_db = self.databases[0]["database"] + other_db = self.databases[1]["database"] cur = con.cursor() - cur.execute('SELECT database()') + cur.execute("SELECT database()") self.assertEqual(cur.fetchone()[0], current_db) con.select_db(other_db) - cur.execute('SELECT database()') + cur.execute("SELECT database()") self.assertEqual(cur.fetchone()[0], other_db) def test_connection_gone_away(self): @@ -56,90 +500,319 @@ def test_connection_gone_away(self): http://dev.mysql.com/doc/refman/5.0/en/gone-away.html http://dev.mysql.com/doc/refman/5.0/en/error-messages-client.html#error_cr_server_gone_error """ - con = self.connections[0] + con = self.connect() cur = con.cursor() cur.execute("SET wait_timeout=1") time.sleep(2) with self.assertRaises(pymysql.OperationalError) as cm: cur.execute("SELECT 1+1") - # error occures while reading, not writing because of socket buffer. - #self.assertEquals(cm.exception.args[0], 2006) + # error occurs while reading, not writing because of socket buffer. + # self.assertEqual(cm.exception.args[0], 2006) self.assertIn(cm.exception.args[0], (2006, 2013)) def test_init_command(self): - conn = pymysql.connect( + conn = self.connect( init_command='SELECT "bar"; SELECT "baz"', - **self.databases[0] + client_flag=CLIENT.MULTI_STATEMENTS, ) c = conn.cursor() c.execute('select "foobar";') - self.assertEqual(('foobar',), c.fetchone()) + self.assertEqual(("foobar",), c.fetchone()) conn.close() with self.assertRaises(pymysql.err.Error): conn.ping(reconnect=False) def test_read_default_group(self): - conn = pymysql.connect( - read_default_group='client', - **self.databases[0] + conn = self.connect( + read_default_group="client", ) self.assertTrue(conn.open) - def test_context(self): - with self.assertRaises(ValueError): - c = pymysql.connect(**self.databases[0]) - with c as cur: - cur.execute('create table test ( a int )') - c.begin() - cur.execute('insert into test values ((1))') - raise ValueError('pseudo abort') - c.commit() - c = pymysql.connect(**self.databases[0]) - with c as cur: - cur.execute('select count(*) from test') - self.assertEqual(0, cur.fetchone()[0]) - cur.execute('insert into test values ((1))') - with c as cur: - cur.execute('select count(*) from test') - self.assertEqual(1,cur.fetchone()[0]) - cur.execute('drop table test') - def test_set_charset(self): - c = pymysql.connect(**self.databases[0]) - c.set_charset('utf8') + c = self.connect() + c.set_charset("utf8mb4") # TODO validate setting here def test_defer_connect(self): import socket - for db in self.databases: - d = db.copy() + + d = self.databases[0].copy() + try: + sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) + sock.connect(d["unix_socket"]) + except KeyError: + sock.close() + sock = socket.create_connection( + (d.get("host", "localhost"), d.get("port", 3306)) + ) + for k in ["unix_socket", "host", "port"]: try: - sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) - sock.connect(d['unix_socket']) + del d[k] except KeyError: - sock = socket.create_connection( - (d.get('host', 'localhost'), d.get('port', 3306))) - for k in ['unix_socket', 'host', 'port']: - try: - del d[k] - except KeyError: - pass - - c = pymysql.connect(defer_connect=True, **d) - self.assertFalse(c.open) - c.connect(sock) - c.close() - - @unittest2.skipUnless(sys.version_info[0:2] >= (3,2), "required py-3.2") - def test_no_delay_warning(self): - current_db = self.databases[0].copy() - current_db['no_delay'] = True - with self.assertWarns(DeprecationWarning) as cm: - conn = pymysql.connect(**current_db) + pass + + c = pymysql.connect(defer_connect=True, **d) + self.assertFalse(c.open) + c.connect(sock) + c.close() + sock.close() + + def test_ssl_connect(self): + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl={ + "ca": "ca", + "cert": "cert", + "key": "key", + "cipher": "cipher", + }, + defer_connect=True, + ) + assert create_default_context.called + assert dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_REQUIRED + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_called_with("cipher") + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl={ + "ca": "ca", + "cert": "cert", + "key": "key", + }, + defer_connect=True, + ) + assert create_default_context.called + assert dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_REQUIRED + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl={ + "ca": "ca", + "cert": "cert", + "key": "key", + "password": "password", + }, + defer_connect=True, + ) + assert create_default_context.called + assert dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_REQUIRED + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password="password", + ) + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_ca="ca", + defer_connect=True, + ) + assert create_default_context.called + assert not dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_NONE + dummy_ssl_context.load_cert_chain.assert_not_called + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_ca="ca", + ssl_cert="cert", + ssl_key="key", + defer_connect=True, + ) + assert create_default_context.called + assert not dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_NONE + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + for ssl_verify_cert in (True, "1", "yes", "true"): + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_cert="cert", + ssl_key="key", + ssl_verify_cert=ssl_verify_cert, + defer_connect=True, + ) + assert create_default_context.called + assert not dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_REQUIRED + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + for ssl_verify_cert in (None, False, "0", "no", "false"): + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_cert="cert", + ssl_key="key", + ssl_verify_cert=ssl_verify_cert, + defer_connect=True, + ) + assert create_default_context.called + assert not dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_NONE + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + for ssl_ca in ("ca", None): + for ssl_verify_cert in ("foo", "bar", ""): + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_ca=ssl_ca, + ssl_cert="cert", + ssl_key="key", + ssl_verify_cert=ssl_verify_cert, + defer_connect=True, + ) + assert create_default_context.called + assert not dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ( + ssl.CERT_REQUIRED if ssl_ca is not None else ssl.CERT_NONE + ), (ssl_ca, ssl_verify_cert) + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_ca="ca", + ssl_cert="cert", + ssl_key="key", + ssl_verify_identity=True, + defer_connect=True, + ) + assert create_default_context.called + assert dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_NONE + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password=None, + ) + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_ca="ca", + ssl_cert="cert", + ssl_key="key", + ssl_key_password="password", + ssl_verify_identity=True, + defer_connect=True, + ) + assert create_default_context.called + assert dummy_ssl_context.check_hostname + assert dummy_ssl_context.verify_mode == ssl.CERT_NONE + dummy_ssl_context.load_cert_chain.assert_called_with( + "cert", + keyfile="key", + password="password", + ) + dummy_ssl_context.set_ciphers.assert_not_called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_disabled=True, + ssl={ + "ca": "ca", + "cert": "cert", + "key": "key", + }, + defer_connect=True, + ) + assert not create_default_context.called + + dummy_ssl_context = mock.Mock(options=0, verify_flags=0) + with mock.patch( + "pymysql.connections.ssl.create_default_context", + new=mock.Mock(return_value=dummy_ssl_context), + ) as create_default_context: + pymysql.connect( + ssl_disabled=True, + ssl_ca="ca", + ssl_cert="cert", + ssl_key="key", + defer_connect=True, + ) + assert not create_default_context.called # A custom type and function to escape it -class Foo(object): +class Foo: value = "bar" @@ -149,56 +822,113 @@ def escape_foo(x, d): class TestEscape(base.PyMySQLTestCase): def test_escape_string(self): - con = self.connections[0] + con = self.connect() cur = con.cursor() self.assertEqual(con.escape("foo'bar"), "'foo\\'bar'") # added NO_AUTO_CREATE_USER as not including it in 5.7 generates warnings - cur.execute("SET sql_mode='NO_BACKSLASH_ESCAPES,NO_AUTO_CREATE_USER'") + # mysql-8.0 removes the option however + if self.mysql_server_is(con, (8, 0, 0)): + cur.execute("SET sql_mode='NO_BACKSLASH_ESCAPES'") + else: + cur.execute("SET sql_mode='NO_BACKSLASH_ESCAPES,NO_AUTO_CREATE_USER'") self.assertEqual(con.escape("foo'bar"), "'foo''bar'") def test_escape_builtin_encoders(self): - con = self.connections[0] - cur = con.cursor() + con = self.connect() val = datetime.datetime(2012, 3, 4, 5, 6) self.assertEqual(con.escape(val, con.encoders), "'2012-03-04 05:06:00'") def test_escape_custom_object(self): - con = self.connections[0] - cur = con.cursor() + con = self.connect() mapping = {Foo: escape_foo} self.assertEqual(con.escape(Foo(), mapping), "bar") def test_escape_fallback_encoder(self): - con = self.connections[0] - cur = con.cursor() + con = self.connect() class Custom(str): pass - mapping = {pymysql.text_type: pymysql.escape_string} - self.assertEqual(con.escape(Custom('foobar'), mapping), "'foobar'") + mapping = {str: pymysql.converters.escape_string} + self.assertEqual(con.escape(Custom("foobar"), mapping), "'foobar'") def test_escape_no_default(self): - con = self.connections[0] - cur = con.cursor() + con = self.connect() self.assertRaises(TypeError, con.escape, 42, {}) - def test_escape_dict_value(self): - con = self.connections[0] - cur = con.cursor() + def test_escape_dict_raise_typeerror(self): + """con.escape(dict) should raise TypeError""" + con = self.connect() mapping = con.encoders.copy() mapping[Foo] = escape_foo - self.assertEqual(con.escape({'foo': Foo()}, mapping), {'foo': "bar"}) + # self.assertEqual(con.escape({"foo": Foo()}, mapping), {"foo": "bar"}) + with self.assertRaises(TypeError): + con.escape({"foo": Foo()}) def test_escape_list_item(self): - con = self.connections[0] - cur = con.cursor() + con = self.connect() mapping = con.encoders.copy() mapping[Foo] = escape_foo self.assertEqual(con.escape([Foo()], mapping), "(bar)") + + def test_previous_cursor_not_closed(self): + con = self.connect( + init_command='SELECT "bar"; SELECT "baz"', + client_flag=CLIENT.MULTI_STATEMENTS, + ) + cur1 = con.cursor() + cur1.execute("SELECT 1; SELECT 2") + cur2 = con.cursor() + cur2.execute("SELECT 3") + self.assertEqual(cur2.fetchone()[0], 3) + + def test_commit_during_multi_result(self): + con = self.connect(client_flag=CLIENT.MULTI_STATEMENTS) + cur = con.cursor() + cur.execute("SELECT 1; SELECT 2") + con.commit() + cur.execute("SELECT 3") + self.assertEqual(cur.fetchone()[0], 3) + + def test_force_close_closes_socketio(self): + con = self.connect() + sock = con._sock + fileno = sock.fileno() + rfile = con._rfile + + con._force_close() + assert rfile.closed + assert sock._closed + assert sock.fileno() != fileno # should be set to -1 + + def test_socket_closed_on_exception_in_connect(self): + con = self.connect(defer_connect=True) + sock = None + rfile = None + fileno = -1 + + def _request_authentication(): + nonlocal sock, rfile, fileno + sock = con._sock + assert sock is not None + fileno = sock.fileno() + rfile = con._rfile + assert rfile is not None + raise TypeError + + con._request_authentication = _request_authentication + + with pytest.raises(TypeError): + con.connect() + assert not con.open + assert con._rfile is None + assert con._sock is None + assert rfile.closed + assert sock._closed + assert sock.fileno() != fileno # should be set to -1 diff --git a/pymysql/tests/test_converters.py b/pymysql/tests/test_converters.py new file mode 100644 index 000000000..b36ee4b39 --- /dev/null +++ b/pymysql/tests/test_converters.py @@ -0,0 +1,54 @@ +import datetime +from unittest import TestCase +from pymysql import converters + + +__all__ = ["TestConverter"] + + +class TestConverter(TestCase): + def test_escape_string(self): + self.assertEqual(converters.escape_string("foo\nbar"), "foo\\nbar") + + def test_convert_datetime(self): + expected = datetime.datetime(2007, 2, 24, 23, 6, 20) + dt = converters.convert_datetime("2007-02-24 23:06:20") + self.assertEqual(dt, expected) + + def test_convert_datetime_with_fsp(self): + expected = datetime.datetime(2007, 2, 24, 23, 6, 20, 511581) + dt = converters.convert_datetime("2007-02-24 23:06:20.511581") + self.assertEqual(dt, expected) + + def _test_convert_timedelta(self, with_negate=False, with_fsp=False): + d = {"hours": 789, "minutes": 12, "seconds": 34} + s = "%(hours)s:%(minutes)s:%(seconds)s" % d + if with_fsp: + d["microseconds"] = 511581 + s += ".%(microseconds)s" % d + + expected = datetime.timedelta(**d) + if with_negate: + expected = -expected + s = "-" + s + + tdelta = converters.convert_timedelta(s) + self.assertEqual(tdelta, expected) + + def test_convert_timedelta(self): + self._test_convert_timedelta(with_negate=False, with_fsp=False) + self._test_convert_timedelta(with_negate=True, with_fsp=False) + + def test_convert_timedelta_with_fsp(self): + self._test_convert_timedelta(with_negate=False, with_fsp=True) + self._test_convert_timedelta(with_negate=False, with_fsp=True) + + def test_convert_time(self): + expected = datetime.time(23, 6, 20) + time_obj = converters.convert_time("23:06:20") + self.assertEqual(time_obj, expected) + + def test_convert_time_with_fsp(self): + expected = datetime.time(23, 6, 20, 511581) + time_obj = converters.convert_time("23:06:20.511581") + self.assertEqual(time_obj, expected) diff --git a/pymysql/tests/test_cursor.py b/pymysql/tests/test_cursor.py index f90077490..2e267fb6a 100644 --- a/pymysql/tests/test_cursor.py +++ b/pymysql/tests/test_cursor.py @@ -1,25 +1,37 @@ -import warnings - +from pymysql.constants import ER from pymysql.tests import base import pymysql.cursors +import pytest + + class CursorTest(base.PyMySQLTestCase): def setUp(self): - super(CursorTest, self).setUp() + super().setUp() - conn = self.connections[0] + conn = self.connect() self.safe_create_table( conn, - "test", "create table test (data varchar(10))", + "test", + "create table test (data varchar(10))", ) cursor = conn.cursor() cursor.execute( - "insert into test (data) values " - "('row1'), ('row2'), ('row3'), ('row4'), ('row5')") + "insert into test (data) values ('row1'), ('row2'), ('row3'), ('row4'), ('row5')" + ) + conn.commit() cursor.close() self.test_connection = pymysql.connect(**self.databases[0]) self.addCleanup(self.test_connection.close) + def test_cursor_is_iterator(self): + """Test that the cursor is an iterator""" + conn = self.test_connection + cursor = conn.cursor() + cursor.execute("select * from test") + self.assertEqual(cursor.__iter__(), cursor) + self.assertEqual(cursor.__next__(), ("row1",)) + def test_cleanup_rows_unbuffered(self): conn = self.test_connection cursor = conn.cursor(pymysql.cursors.SSCursor) @@ -30,22 +42,11 @@ def test_cleanup_rows_unbuffered(self): break del cursor - self.safe_gc_collect() c2 = conn.cursor() - with warnings.catch_warnings(record=True) as log: - warnings.filterwarnings("always") - - c2.execute("select 1") - - self.assertGreater(len(log), 0) - self.assertEqual( - "Previous unbuffered result was left incomplete", - str(log[-1].message)) - self.assertEqual( - c2.fetchone(), (1,) - ) + c2.execute("select 1") + self.assertEqual(c2.fetchone(), (1,)) self.assertIsNone(c2.fetchone()) def test_cleanup_rows_buffered(self): @@ -58,14 +59,164 @@ def test_cleanup_rows_buffered(self): break del cursor - self.safe_gc_collect() c2 = conn.cursor() - c2.execute("select 1") + self.assertEqual(c2.fetchone(), (1,)) + self.assertIsNone(c2.fetchone()) + + def test_executemany(self): + conn = self.test_connection + cursor = conn.cursor(pymysql.cursors.Cursor) + + m = pymysql.cursors.RE_INSERT_VALUES.match( + "INSERT INTO TEST (ID, NAME) VALUES (%s, %s)" + ) + self.assertIsNotNone(m, "error parse %s") + self.assertEqual(m.group(3), "", "group 3 not blank, bug in RE_INSERT_VALUES?") + + m = pymysql.cursors.RE_INSERT_VALUES.match( + "INSERT INTO TEST (ID, NAME) VALUES (%(id)s, %(name)s)" + ) + self.assertIsNotNone(m, "error parse %(name)s") + self.assertEqual(m.group(3), "", "group 3 not blank, bug in RE_INSERT_VALUES?") + + m = pymysql.cursors.RE_INSERT_VALUES.match( + "INSERT INTO TEST (ID, NAME) VALUES (%(id_name)s, %(name)s)" + ) + self.assertIsNotNone(m, "error parse %(id_name)s") + self.assertEqual(m.group(3), "", "group 3 not blank, bug in RE_INSERT_VALUES?") + + m = pymysql.cursors.RE_INSERT_VALUES.match( + "INSERT INTO TEST (ID, NAME) VALUES (%(id_name)s, %(name)s) ON duplicate update" + ) + self.assertIsNotNone(m, "error parse %(id_name)s") self.assertEqual( - c2.fetchone(), (1,) + m.group(3), + " ON duplicate update", + "group 3 not ON duplicate update, bug in RE_INSERT_VALUES?", + ) + + # https://github.com/PyMySQL/PyMySQL/pull/597 + m = pymysql.cursors.RE_INSERT_VALUES.match( + "INSERT INTO bloup(foo, bar)VALUES(%s, %s)" + ) + assert m is not None + + # cursor._executed must bee "insert into test (data) + # values (0),(1),(2),(3),(4),(5),(6),(7),(8),(9)" + # list args + data = range(10) + cursor.executemany("insert into test (data) values (%s)", data) + self.assertTrue( + cursor._executed.endswith(b",(7),(8),(9)"), + "execute many with %s not in one query", + ) + + # dict args + data_dict = [{"data": i} for i in range(10)] + cursor.executemany("insert into test (data) values (%(data)s)", data_dict) + self.assertTrue( + cursor._executed.endswith(b",(7),(8),(9)"), + "execute many with %(data)s not in one query", + ) + + # %% in column set + cursor.execute( + """\ + CREATE TABLE percent_test ( + `A%` INTEGER, + `B%` INTEGER)""" + ) + try: + q = "INSERT INTO percent_test (`A%%`, `B%%`) VALUES (%s, %s)" + self.assertIsNotNone(pymysql.cursors.RE_INSERT_VALUES.match(q)) + cursor.executemany(q, [(3, 4), (5, 6)]) + self.assertTrue( + cursor._executed.endswith(b"(3, 4),(5, 6)"), + "executemany with %% not in one query", + ) + finally: + cursor.execute("DROP TABLE IF EXISTS percent_test") + + def test_execution_time_limit(self): + # this method is similarly implemented in test_SScursor + + conn = self.test_connection + db_type = self.get_mysql_vendor(conn) + + with conn.cursor(pymysql.cursors.Cursor) as cur: + # MySQL MAX_EXECUTION_TIME takes ms + # MariaDB max_statement_time takes seconds as int/float, introduced in 10.1 + + # this will sleep 0.01 seconds per row + if db_type == "mysql": + sql = ( + "SELECT /*+ MAX_EXECUTION_TIME(2000) */ data, sleep(0.01) FROM test" + ) + else: + sql = "SET STATEMENT max_statement_time=2 FOR SELECT data, sleep(0.01) FROM test" + + cur.execute(sql) + # unlike SSCursor, Cursor returns a tuple of tuples here + self.assertEqual( + cur.fetchall(), + ( + ("row1", 0), + ("row2", 0), + ("row3", 0), + ("row4", 0), + ("row5", 0), + ), + ) + + if db_type == "mysql": + sql = ( + "SELECT /*+ MAX_EXECUTION_TIME(2000) */ data, sleep(0.01) FROM test" + ) + else: + sql = "SET STATEMENT max_statement_time=2 FOR SELECT data, sleep(0.01) FROM test" + cur.execute(sql) + self.assertEqual(cur.fetchone(), ("row1", 0)) + + # this discards the previous unfinished query + cur.execute("SELECT 1") + self.assertEqual(cur.fetchone(), (1,)) + + if db_type == "mysql": + sql = "SELECT /*+ MAX_EXECUTION_TIME(1) */ data, sleep(1) FROM test" + else: + sql = "SET STATEMENT max_statement_time=0.001 FOR SELECT data, sleep(1) FROM test" + with pytest.raises(pymysql.err.OperationalError) as cm: + # in a buffered cursor this should reliably raise an + # OperationalError + cur.execute(sql) + + if db_type == "mysql": + # this constant was only introduced in MySQL 5.7, not sure + # what was returned before, may have been ER_QUERY_INTERRUPTED + self.assertEqual(cm.value.args[0], ER.QUERY_TIMEOUT) + else: + self.assertEqual(cm.value.args[0], ER.STATEMENT_TIMEOUT) + + # connection should still be fine at this point + cur.execute("SELECT 1") + self.assertEqual(cur.fetchone(), (1,)) + + def test_warnings(self): + con = self.connect() + cur = con.cursor() + cur.execute("DROP TABLE IF EXISTS `no_exists_table`") + self.assertEqual(cur.warning_count, 1) + + cur.execute("SHOW WARNINGS") + w = cur.fetchone() + self.assertEqual(w[1], ER.BAD_TABLE_ERROR) + self.assertIn( + "no_exists_table", + w[2], ) - self.assertIsNone(c2.fetchone()) + cur.execute("SELECT 1") + self.assertEqual(cur.warning_count, 0) diff --git a/pymysql/tests/test_err.py b/pymysql/tests/test_err.py new file mode 100644 index 000000000..6eb0f987d --- /dev/null +++ b/pymysql/tests/test_err.py @@ -0,0 +1,16 @@ +import pytest +from pymysql import err + + +def test_raise_mysql_exception(): + data = b"\xff\x15\x04#28000Access denied" + with pytest.raises(err.OperationalError) as cm: + err.raise_mysql_exception(data) + assert cm.type == err.OperationalError + assert cm.value.args == (1045, "Access denied") + + data = b"\xff\x10\x04Too many connections" + with pytest.raises(err.OperationalError) as cm: + err.raise_mysql_exception(data) + assert cm.type == err.OperationalError + assert cm.value.args == (1040, "Too many connections") diff --git a/pymysql/tests/test_example.py b/pymysql/tests/test_example.py deleted file mode 100644 index 75d0f1987..000000000 --- a/pymysql/tests/test_example.py +++ /dev/null @@ -1,32 +0,0 @@ -import pymysql -from pymysql.tests import base - -class TestExample(base.PyMySQLTestCase): - def test_example(self): - conn = pymysql.connect(host='127.0.0.1', port=3306, user='root', passwd='', db='mysql') - - - cur = conn.cursor() - - cur.execute("SELECT Host,User FROM user") - - # print cur.description - - # r = cur.fetchall() - # print r - # ...or... - u = False - - for r in cur.fetchall(): - u = u or conn.user in r - - self.assertTrue(u) - - cur.close() - conn.close() - -__all__ = ["TestExample"] - -if __name__ == "__main__": - import unittest - unittest.main() diff --git a/pymysql/tests/test_issues.py b/pymysql/tests/test_issues.py index 5ec65d82a..f1fe8dd48 100644 --- a/pymysql/tests/test_issues.py +++ b/pymysql/tests/test_issues.py @@ -1,32 +1,29 @@ import datetime import time import warnings -import sys + +import pytest import pymysql from pymysql.tests import base -import unittest2 - -try: - import imp - reload = imp.reload -except AttributeError: - pass - __all__ = ["TestOldIssues", "TestNewIssues", "TestGitHubIssues"] + class TestOldIssues(base.PyMySQLTestCase): def test_issue_3(self): - """ undefined methods datetime_or_None, date_or_None """ - conn = self.connections[0] + """undefined methods datetime_or_None, date_or_None""" + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists issue3") c.execute("create table issue3 (d date, t time, dt datetime, ts timestamp)") try: - c.execute("insert into issue3 (d, t, dt, ts) values (%s,%s,%s,%s)", (None, None, None, None)) + c.execute( + "insert into issue3 (d, t, dt, ts) values (%s,%s,%s,%s)", + (None, None, None, None), + ) c.execute("select d from issue3") self.assertEqual(None, c.fetchone()[0]) c.execute("select t from issue3") @@ -34,13 +31,17 @@ def test_issue_3(self): c.execute("select dt from issue3") self.assertEqual(None, c.fetchone()[0]) c.execute("select ts from issue3") - self.assertTrue(isinstance(c.fetchone()[0], datetime.datetime)) + self.assertIn( + type(c.fetchone()[0]), + (type(None), datetime.datetime), + "expected Python type None or datetime from SQL timestamp", + ) finally: c.execute("drop table issue3") def test_issue_4(self): - """ can't retrieve TIMESTAMP fields """ - conn = self.connections[0] + """can't retrieve TIMESTAMP fields""" + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") @@ -54,32 +55,34 @@ def test_issue_4(self): c.execute("drop table issue4") def test_issue_5(self): - """ query on information_schema.tables fails """ - con = self.connections[0] + """query on information_schema.tables fails""" + con = self.connect() cur = con.cursor() cur.execute("select * from information_schema.tables") def test_issue_6(self): - """ exception: TypeError: ord() expected a character, but string of length 0 found """ + """exception: TypeError: ord() expected a character, but string of length 0 found""" # ToDo: this test requires access to db 'mysql'. kwargs = self.databases[0].copy() - kwargs['db'] = "mysql" + kwargs["database"] = "mysql" conn = pymysql.connect(**kwargs) c = conn.cursor() c.execute("select * from user") conn.close() def test_issue_8(self): - """ Primary Key and Index error when selecting data """ - conn = self.connections[0] + """Primary Key and Index error when selecting data""" + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists test") - c.execute("""CREATE TABLE `test` (`station` int(10) NOT NULL DEFAULT '0', `dh` -datetime NOT NULL DEFAULT '2015-01-01 00:00:00', `echeance` int(1) NOT NULL + c.execute( + """CREATE TABLE `test` (`station` int NOT NULL DEFAULT '0', `dh` +datetime NOT NULL DEFAULT '2015-01-01 00:00:00', `echeance` int NOT NULL DEFAULT '0', `me` double DEFAULT NULL, `mo` double DEFAULT NULL, PRIMARY -KEY (`station`,`dh`,`echeance`)) ENGINE=MyISAM DEFAULT CHARSET=latin1;""") +KEY (`station`,`dh`,`echeance`)) ENGINE=MyISAM DEFAULT CHARSET=latin1;""" + ) try: self.assertEqual(0, c.execute("SELECT * FROM test")) c.execute("ALTER TABLE `test` ADD INDEX `idx_station` (`station`)") @@ -87,16 +90,9 @@ def test_issue_8(self): finally: c.execute("drop table test") - def test_issue_9(self): - """ sets DeprecationWarning in Python 2.6 """ - try: - reload(pymysql) - except DeprecationWarning: - self.fail() - def test_issue_13(self): - """ can't handle large result fields """ - conn = self.connections[0] + """can't handle large result fields""" + conn = self.connect() cur = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") @@ -104,7 +100,7 @@ def test_issue_13(self): try: cur.execute("create table issue13 (t text)") # ticket says 18k - size = 18*1024 + size = 18 * 1024 cur.execute("insert into issue13 (t) values (%s)", ("x" * size,)) cur.execute("select t from issue13") # use assertTrue so that obscenely huge error messages don't print @@ -114,41 +110,47 @@ def test_issue_13(self): cur.execute("drop table issue13") def test_issue_15(self): - """ query should be expanded before perform character encoding """ - conn = self.connections[0] + """query should be expanded before perform character encoding""" + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists issue15") c.execute("create table issue15 (t varchar(32))") try: - c.execute("insert into issue15 (t) values (%s)", (u'\xe4\xf6\xfc',)) + c.execute("insert into issue15 (t) values (%s)", ("\xe4\xf6\xfc",)) c.execute("select t from issue15") - self.assertEqual(u'\xe4\xf6\xfc', c.fetchone()[0]) + self.assertEqual("\xe4\xf6\xfc", c.fetchone()[0]) finally: c.execute("drop table issue15") def test_issue_16(self): - """ Patch for string and tuple escaping """ - conn = self.connections[0] + """Patch for string and tuple escaping""" + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists issue16") - c.execute("create table issue16 (name varchar(32) primary key, email varchar(32))") + c.execute( + "create table issue16 (name varchar(32) primary key, email varchar(32))" + ) try: - c.execute("insert into issue16 (name, email) values ('pete', 'floydophone')") + c.execute( + "insert into issue16 (name, email) values ('pete', 'floydophone')" + ) c.execute("select email from issue16 where name=%s", ("pete",)) self.assertEqual("floydophone", c.fetchone()[0]) finally: c.execute("drop table issue16") - @unittest2.skip("test_issue_17() requires a custom, legacy MySQL configuration and will not be run.") + @pytest.mark.skip( + "test_issue_17() requires a custom, legacy MySQL configuration and will not be run." + ) def test_issue_17(self): - """ could not connect mysql use passwod """ - conn = self.connections[0] + """could not connect mysql use password""" + conn = self.connect() host = self.databases[0]["host"] - db = self.databases[0]["db"] + db = self.databases[0]["database"] c = conn.cursor() # grant access to a table to a user with a password @@ -158,7 +160,10 @@ def test_issue_17(self): c.execute("drop table if exists issue17") c.execute("create table issue17 (x varchar(32) primary key)") c.execute("insert into issue17 (x) values ('hello, world!')") - c.execute("grant all privileges on %s.issue17 to 'issue17user'@'%%' identified by '1234'" % db) + c.execute( + "grant all privileges on %s.issue17 to 'issue17user'@'%%' identified by '1234'" + % db + ) conn.commit() conn2 = pymysql.connect(host=host, user="issue17user", passwd="1234", db=db) @@ -168,6 +173,7 @@ def test_issue_17(self): finally: c.execute("drop table issue17") + class TestNewIssues(base.PyMySQLTestCase): def test_issue_34(self): try: @@ -180,16 +186,17 @@ def test_issue_34(self): def test_issue_33(self): conn = pymysql.connect(charset="utf8", **self.databases[0]) - self.safe_create_table(conn, u'hei\xdfe', - u'create table hei\xdfe (name varchar(32))') + self.safe_create_table( + conn, "hei\xdfe", "create table hei\xdfe (name varchar(32))" + ) c = conn.cursor() - c.execute(u"insert into hei\xdfe (name) values ('Pi\xdfata')") - c.execute(u"select name from hei\xdfe") - self.assertEqual(u"Pi\xdfata", c.fetchone()[0]) + c.execute("insert into hei\xdfe (name) values ('Pi\xdfata')") + c.execute("select name from hei\xdfe") + self.assertEqual("Pi\xdfata", c.fetchone()[0]) - @unittest2.skip("This test requires manual intervention") + @pytest.mark.skip("This test requires manual intervention") def test_issue_35(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() print("sudo killall -9 mysqld within the next 10 seconds") try: @@ -235,7 +242,7 @@ def test_issue_36(self): del self.connections[1] def test_issue_37(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() self.assertEqual(1, c.execute("SELECT @foo")) self.assertEqual((None,), c.fetchone()) @@ -243,9 +250,9 @@ def test_issue_37(self): c.execute("set @foo = 'bar'") def test_issue_38(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() - datum = "a" * 1024 * 1023 # reduced size for most default mysql installs + datum = "a" * 1024 * 1023 # reduced size for most default mysql installs try: with warnings.catch_warnings(): @@ -257,13 +264,13 @@ def test_issue_38(self): c.execute("drop table issue38") def disabled_test_issue_54(self): - conn = self.connections[0] + conn = self.connect() c = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists issue54") big_sql = "select * from issue54 where " - big_sql += " and ".join("%d=%d" % (i,i) for i in range(0, 100000)) + big_sql += " and ".join("%d=%d" % (i, i) for i in range(0, 100000)) try: c.execute("create table issue54 (id integer primary key)") @@ -273,17 +280,20 @@ def disabled_test_issue_54(self): finally: c.execute("drop table issue54") + class TestGitHubIssues(base.PyMySQLTestCase): def test_issue_66(self): - """ 'Connection' object has no attribute 'insert_id' """ - conn = self.connections[0] + """'Connection' object has no attribute 'insert_id'""" + conn = self.connect() c = conn.cursor() self.assertEqual(0, conn.insert_id()) try: with warnings.catch_warnings(): warnings.filterwarnings("ignore") c.execute("drop table if exists issue66") - c.execute("create table issue66 (id integer primary key auto_increment, x integer)") + c.execute( + "create table issue66 (id integer primary key auto_increment, x integer)" + ) c.execute("insert into issue66 (x) values (1)") c.execute("insert into issue66 (x) values (1)") self.assertEqual(2, conn.insert_id()) @@ -291,8 +301,8 @@ def test_issue_66(self): c.execute("drop table issue66") def test_issue_79(self): - """ Duplicate field overwrites the previous one in the result of DictCursor """ - conn = self.connections[0] + """Duplicate field overwrites the previous one in the result of DictCursor""" + conn = self.connect() c = conn.cursor(pymysql.cursors.DictCursor) with warnings.catch_warnings(): @@ -302,32 +312,34 @@ def test_issue_79(self): c.execute("""CREATE TABLE a (id int, value int)""") c.execute("""CREATE TABLE b (id int, value int)""") - a=(1,11) - b=(1,22) + a = (1, 11) + b = (1, 22) try: c.execute("insert into a values (%s, %s)", a) c.execute("insert into b values (%s, %s)", b) c.execute("SELECT * FROM a inner join b on a.id = b.id") r = c.fetchall()[0] - self.assertEqual(r['id'], 1) - self.assertEqual(r['value'], 11) - self.assertEqual(r['b.value'], 22) + self.assertEqual(r["id"], 1) + self.assertEqual(r["value"], 11) + self.assertEqual(r["b.value"], 22) finally: c.execute("drop table a") c.execute("drop table b") def test_issue_95(self): - """ Leftover trailing OK packet for "CALL my_sp" queries """ - conn = self.connections[0] + """Leftover trailing OK packet for "CALL my_sp" queries""" + conn = self.connect() cur = conn.cursor() with warnings.catch_warnings(): warnings.filterwarnings("ignore") cur.execute("DROP PROCEDURE IF EXISTS `foo`") - cur.execute("""CREATE PROCEDURE `foo` () + cur.execute( + """CREATE PROCEDURE `foo` () BEGIN SELECT 1; - END""") + END""" + ) try: cur.execute("""CALL foo()""") cur.execute("""SELECT 1""") @@ -338,7 +350,7 @@ def test_issue_95(self): cur.execute("DROP PROCEDURE IF EXISTS `foo`") def test_issue_114(self): - """ autocommit is not set after reconnecting with ping() """ + """autocommit is not set after reconnecting with ping()""" conn = pymysql.connect(charset="utf8", **self.databases[0]) conn.autocommit(False) c = conn.cursor() @@ -363,59 +375,62 @@ def test_issue_114(self): conn.close() def test_issue_175(self): - """ The number of fields returned by server is read in wrong way """ - conn = self.connections[0] + """The number of fields returned by server is read in wrong way""" + conn = self.connect() cur = conn.cursor() for length in (200, 300): - columns = ', '.join('c{0} integer'.format(i) for i in range(length)) - sql = 'create table test_field_count ({0})'.format(columns) + columns = ", ".join(f"c{i} integer" for i in range(length)) + sql = f"create table test_field_count ({columns})" try: cur.execute(sql) - cur.execute('select * from test_field_count') + cur.execute("select * from test_field_count") assert len(cur.description) == length finally: with warnings.catch_warnings(): warnings.filterwarnings("ignore") - cur.execute('drop table if exists test_field_count') + cur.execute("drop table if exists test_field_count") def test_issue_321(self): - """ Test iterable as query argument. """ + """Test iterable as query argument.""" conn = pymysql.connect(charset="utf8", **self.databases[0]) self.safe_create_table( - conn, "issue321", - "create table issue321 (value_1 varchar(1), value_2 varchar(1))") + conn, + "issue321", + "create table issue321 (value_1 varchar(1), value_2 varchar(1))", + ) sql_insert = "insert into issue321 (value_1, value_2) values (%s, %s)" - sql_dict_insert = ("insert into issue321 (value_1, value_2) " - "values (%(value_1)s, %(value_2)s)") - sql_select = ("select * from issue321 where " - "value_1 in %s and value_2=%s") + sql_dict_insert = ( + "insert into issue321 (value_1, value_2) values (%(value_1)s, %(value_2)s)" + ) + sql_select = "select * from issue321 where value_1 in %s and value_2=%s" data = [ - [(u"a", ), u"\u0430"], - [[u"b"], u"\u0430"], - {"value_1": [[u"c"]], "value_2": u"\u0430"} + [("a",), "\u0430"], + [["b"], "\u0430"], + {"value_1": [["c"]], "value_2": "\u0430"}, ] cur = conn.cursor() self.assertEqual(cur.execute(sql_insert, data[0]), 1) self.assertEqual(cur.execute(sql_insert, data[1]), 1) self.assertEqual(cur.execute(sql_dict_insert, data[2]), 1) - self.assertEqual( - cur.execute(sql_select, [(u"a", u"b", u"c"), u"\u0430"]), 3) - self.assertEqual(cur.fetchone(), (u"a", u"\u0430")) - self.assertEqual(cur.fetchone(), (u"b", u"\u0430")) - self.assertEqual(cur.fetchone(), (u"c", u"\u0430")) + self.assertEqual(cur.execute(sql_select, [("a", "b", "c"), "\u0430"]), 3) + self.assertEqual(cur.fetchone(), ("a", "\u0430")) + self.assertEqual(cur.fetchone(), ("b", "\u0430")) + self.assertEqual(cur.fetchone(), ("c", "\u0430")) def test_issue_364(self): - """ Test mixed unicode/binary arguments in executemany. """ - conn = pymysql.connect(charset="utf8", **self.databases[0]) + """Test mixed unicode/binary arguments in executemany.""" + conn = pymysql.connect(charset="utf8mb4", **self.databases[0]) self.safe_create_table( - conn, "issue364", + conn, + "issue364", "create table issue364 (value_1 binary(3), value_2 varchar(3)) " - "engine=InnoDB default charset=utf8") + "engine=InnoDB default charset=utf8mb4", + ) - sql = "insert into issue364 (value_1, value_2) values (_binary%s, _binary%s)" - usql = u"insert into issue364 (value_1, value_2) values (_binary%s, _binary%s)" - values = [b"\x00\xff\x00", u"\xe4\xf6\xfc"] + sql = "insert into issue364 (value_1, value_2) values (_binary %s, %s)" + usql = "insert into issue364 (value_1, value_2) values (_binary %s, %s)" + values = [pymysql.Binary(b"\x00\xff\x00"), "\xe4\xf6\xfc"] # test single insert and select cur = conn.cursor() @@ -436,47 +451,44 @@ def test_issue_364(self): cur.executemany(usql, args=(values, values, values)) def test_issue_363(self): - """ Test binary / geometry types. """ + """Test binary / geometry types.""" conn = pymysql.connect(charset="utf8", **self.databases[0]) self.safe_create_table( - conn, "issue363", + conn, + "issue363", "CREATE TABLE issue363 ( " - "id INTEGER PRIMARY KEY, geom LINESTRING NOT NULL, " + "id INTEGER PRIMARY KEY, geom LINESTRING NOT NULL /*!80003 SRID 0 */, " "SPATIAL KEY geom (geom)) " - "ENGINE=MyISAM default charset=utf8") + "ENGINE=MyISAM", + ) cur = conn.cursor() - # FYI - not sure of 5.7.0 version - if sys.version_info[0:2] >= (3,2) and self.mysql_server_is(conn, (5, 7, 0)): - with self.assertWarns(pymysql.err.Warning) as cm: - cur.execute("INSERT INTO issue363 (id, geom) VALUES (" - "1998, GeomFromText('LINESTRING(1.1 1.1,2.2 2.2)'))") - else: - cur.execute("INSERT INTO issue363 (id, geom) VALUES (" - "1998, GeomFromText('LINESTRING(1.1 1.1,2.2 2.2)'))") + query = ( + "INSERT INTO issue363 (id, geom) VALUES" + "(1998, ST_GeomFromText('LINESTRING(1.1 1.1,2.2 2.2)'))" + ) + cur.execute(query) # select WKT - if sys.version_info[0:2] >= (3,2) and self.mysql_server_is(conn, (5, 7, 0)): - with self.assertWarns(pymysql.err.Warning) as cm: - cur.execute("SELECT AsText(geom) FROM issue363") - else: - cur.execute("SELECT AsText(geom) FROM issue363") + query = "SELECT ST_AsText(geom) FROM issue363" + cur.execute(query) row = cur.fetchone() - self.assertEqual(row, ("LINESTRING(1.1 1.1,2.2 2.2)", )) + self.assertEqual(row, ("LINESTRING(1.1 1.1,2.2 2.2)",)) # select WKB - if sys.version_info[0:2] >= (3,2) and self.mysql_server_is(conn, (5, 7, 0)): - with self.assertWarns(pymysql.err.Warning) as cm: - cur.execute("SELECT AsBinary(geom) FROM issue363") - else: - cur.execute("SELECT AsBinary(geom) FROM issue363") + query = "SELECT ST_AsBinary(geom) FROM issue363" + cur.execute(query) row = cur.fetchone() - self.assertEqual(row, - (b"\x01\x02\x00\x00\x00\x02\x00\x00\x00" - b"\x9a\x99\x99\x99\x99\x99\xf1?" - b"\x9a\x99\x99\x99\x99\x99\xf1?" - b"\x9a\x99\x99\x99\x99\x99\x01@" - b"\x9a\x99\x99\x99\x99\x99\x01@", )) + self.assertEqual( + row, + ( + b"\x01\x02\x00\x00\x00\x02\x00\x00\x00" + b"\x9a\x99\x99\x99\x99\x99\xf1?" + b"\x9a\x99\x99\x99\x99\x99\xf1?" + b"\x9a\x99\x99\x99\x99\x99\x01@" + b"\x9a\x99\x99\x99\x99\x99\x01@", + ), + ) # select internal binary cur.execute("SELECT geom FROM issue363") diff --git a/pymysql/tests/test_load_local.py b/pymysql/tests/test_load_local.py index 1115bb330..509221420 100644 --- a/pymysql/tests/test_load_local.py +++ b/pymysql/tests/test_load_local.py @@ -1,8 +1,8 @@ -from pymysql import OperationalError, Warning +from pymysql import cursors, OperationalError +from pymysql.constants import ER from pymysql.tests import base import os -import warnings __all__ = ["TestLoadLocal"] @@ -10,15 +10,17 @@ class TestLoadLocal(base.PyMySQLTestCase): def test_no_file(self): """Test load local infile when the file does not exist""" - conn = self.connections[0] + conn = self.connect() c = conn.cursor() c.execute("CREATE TABLE test_load_local (a INTEGER, b INTEGER)") try: self.assertRaises( OperationalError, c.execute, - ("LOAD DATA LOCAL INFILE 'no_data.txt' INTO TABLE " - "test_load_local fields terminated by ','") + ( + "LOAD DATA LOCAL INFILE 'no_data.txt' INTO TABLE " + "test_load_local fields terminated by ','" + ), ) finally: c.execute("DROP TABLE test_load_local") @@ -26,43 +28,77 @@ def test_no_file(self): def test_load_file(self): """Test load local infile with a valid file""" - conn = self.connections[0] + conn = self.connect() c = conn.cursor() c.execute("CREATE TABLE test_load_local (a INTEGER, b INTEGER)") - filename = os.path.join(os.path.dirname(os.path.realpath(__file__)), - 'data', - 'load_local_data.txt') + filename = os.path.join( + os.path.dirname(os.path.realpath(__file__)), "data", "load_local_data.txt" + ) try: c.execute( - ("LOAD DATA LOCAL INFILE '{0}' INTO TABLE " + - "test_load_local FIELDS TERMINATED BY ','").format(filename) + f"LOAD DATA LOCAL INFILE '{filename}' INTO TABLE test_load_local" + + " FIELDS TERMINATED BY ','" ) c.execute("SELECT COUNT(*) FROM test_load_local") self.assertEqual(22749, c.fetchone()[0]) finally: c.execute("DROP TABLE test_load_local") + def test_unbuffered_load_file(self): + """Test unbuffered load local infile with a valid file""" + conn = self.connect() + c = conn.cursor(cursors.SSCursor) + c.execute("CREATE TABLE test_load_local (a INTEGER, b INTEGER)") + filename = os.path.join( + os.path.dirname(os.path.realpath(__file__)), "data", "load_local_data.txt" + ) + try: + c.execute( + f"LOAD DATA LOCAL INFILE '{filename}' INTO TABLE test_load_local" + + " FIELDS TERMINATED BY ','" + ) + c.execute("SELECT COUNT(*) FROM test_load_local") + self.assertEqual(22749, c.fetchone()[0]) + finally: + c.close() + conn.close() + conn.connect() + c = conn.cursor() + c.execute("DROP TABLE test_load_local") + def test_load_warnings(self): """Test load local infile produces the appropriate warnings""" - conn = self.connections[0] + conn = self.connect() c = conn.cursor() c.execute("CREATE TABLE test_load_local (a INTEGER, b INTEGER)") - filename = os.path.join(os.path.dirname(os.path.realpath(__file__)), - 'data', - 'load_local_warn_data.txt') + filename = os.path.join( + os.path.dirname(os.path.realpath(__file__)), + "data", + "load_local_warn_data.txt", + ) try: - with warnings.catch_warnings(record=True) as w: - warnings.simplefilter('always') - c.execute( - ("LOAD DATA LOCAL INFILE '{0}' INTO TABLE " + - "test_load_local FIELDS TERMINATED BY ','").format(filename) - ) - self.assertEqual(w[0].category, Warning) - self.assertTrue("Incorrect integer value" in str(w[-1].message)) + c.execute( + ( + "LOAD DATA LOCAL INFILE '{0}' INTO TABLE " + + "test_load_local FIELDS TERMINATED BY ','" + ).format(filename) + ) + self.assertEqual(1, c.warning_count) + + c.execute("SHOW WARNINGS") + w = c.fetchone() + + self.assertEqual(ER.TRUNCATED_WRONG_VALUE_FOR_FIELD, w[1]) + self.assertIn( + "incorrect integer value", + w[2].lower(), + ) finally: c.execute("DROP TABLE test_load_local") + c.close() if __name__ == "__main__": import unittest + unittest.main() diff --git a/pymysql/tests/test_nextset.py b/pymysql/tests/test_nextset.py index cdb6754f5..a10f8d5b7 100644 --- a/pymysql/tests/test_nextset.py +++ b/pymysql/tests/test_nextset.py @@ -1,17 +1,17 @@ -import unittest2 +import pytest +import pymysql from pymysql.tests import base -from pymysql import util +from pymysql.constants import CLIENT class TestNextset(base.PyMySQLTestCase): - - def setUp(self): - super(TestNextset, self).setUp() - self.con = self.connections[0] - def test_nextset(self): - cur = self.con.cursor() + con = self.connect( + init_command='SELECT "bar"; SELECT "baz"', + client_flag=CLIENT.MULTI_STATEMENTS, + ) + cur = con.cursor() cur.execute("SELECT 1; SELECT 2;") self.assertEqual([(1,)], list(cur)) @@ -22,15 +22,26 @@ def test_nextset(self): self.assertIsNone(cur.nextset()) def test_skip_nextset(self): - cur = self.con.cursor() + cur = self.connect(client_flag=CLIENT.MULTI_STATEMENTS).cursor() cur.execute("SELECT 1; SELECT 2;") self.assertEqual([(1,)], list(cur)) cur.execute("SELECT 42") self.assertEqual([(42,)], list(cur)) + def test_nextset_error(self): + con = self.connect(client_flag=CLIENT.MULTI_STATEMENTS) + cur = con.cursor() + + for i in range(3): + cur.execute("SELECT %s; xyzzy;", (i,)) + self.assertEqual([(i,)], list(cur)) + with self.assertRaises(pymysql.ProgrammingError): + cur.nextset() + self.assertEqual([], cur.fetchall()) + def test_ok_and_next(self): - cur = self.con.cursor() + cur = self.connect(client_flag=CLIENT.MULTI_STATEMENTS).cursor() cur.execute("SELECT 1; commit; SELECT 2;") self.assertEqual([(1,)], list(cur)) self.assertTrue(cur.nextset()) @@ -38,10 +49,11 @@ def test_ok_and_next(self): self.assertEqual([(2,)], list(cur)) self.assertFalse(bool(cur.nextset())) - @unittest2.expectedFailure + @pytest.mark.xfail def test_multi_cursor(self): - cur1 = self.con.cursor() - cur2 = self.con.cursor() + con = self.connect(client_flag=CLIENT.MULTI_STATEMENTS) + cur1 = con.cursor() + cur2 = con.cursor() cur1.execute("SELECT 1; SELECT 2;") cur2.execute("SELECT 42") @@ -56,13 +68,16 @@ def test_multi_cursor(self): self.assertIsNone(cur1.nextset()) def test_multi_statement_warnings(self): - cursor = self.con.cursor() + con = self.connect( + init_command='SELECT "bar"; SELECT "baz"', + client_flag=CLIENT.MULTI_STATEMENTS, + ) + cursor = con.cursor() try: - cursor.execute('DROP TABLE IF EXISTS a; ' - 'DROP TABLE IF EXISTS b;') + cursor.execute("DROP TABLE IF EXISTS a; DROP TABLE IF EXISTS b;") except TypeError: self.fail() - #TODO: How about SSCursor and nextset? + # TODO: How about SSCursor and nextset? # It's very hard to implement correctly... diff --git a/pymysql/tests/test_optionfile.py b/pymysql/tests/test_optionfile.py index abc63ea1c..d13553dda 100644 --- a/pymysql/tests/test_optionfile.py +++ b/pymysql/tests/test_optionfile.py @@ -1,32 +1,24 @@ -from pymysql.optionfile import Parser +from io import StringIO from unittest import TestCase -from pymysql._compat import PY2 - -try: - from cStringIO import StringIO -except ImportError: - from io import StringIO +from pymysql.optionfile import Parser -__all__ = ['TestParser'] +__all__ = ["TestParser"] -_cfg_file = (r""" +_cfg_file = r""" [default] string = foo quoted = "bar" single_quoted = 'foobar' -""") +skip-slave-start +""" class TestParser(TestCase): - def test_string(self): parser = Parser() - if PY2: - parser.readfp(StringIO(_cfg_file)) - else: - parser.read_file(StringIO(_cfg_file)) + parser.read_file(StringIO(_cfg_file)) self.assertEqual(parser.get("default", "string"), "foo") self.assertEqual(parser.get("default", "quoted"), "bar") - self.assertEqual(parser.get("default", "single_quoted"), "foobar") + self.assertEqual(parser.get("default", "single-quoted"), "foobar") diff --git a/pymysql/tests/thirdparty/__init__.py b/pymysql/tests/thirdparty/__init__.py index 6d59e1127..d5f053711 100644 --- a/pymysql/tests/thirdparty/__init__.py +++ b/pymysql/tests/thirdparty/__init__.py @@ -1,8 +1,6 @@ from .test_MySQLdb import * if __name__ == "__main__": - try: - import unittest2 as unittest - except ImportError: - import unittest + import unittest + unittest.main() diff --git a/pymysql/tests/thirdparty/test_MySQLdb/__init__.py b/pymysql/tests/thirdparty/test_MySQLdb/__init__.py index e4237c69a..501bfd2db 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/__init__.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/__init__.py @@ -1,7 +1,6 @@ -from .test_MySQLdb_capabilities import test_MySQLdb as test_capabilities from .test_MySQLdb_nonstandard import * -from .test_MySQLdb_dbapi20 import test_MySQLdb as test_dbapi2 if __name__ == "__main__": import unittest + unittest.main() diff --git a/pymysql/tests/thirdparty/test_MySQLdb/capabilities.py b/pymysql/tests/thirdparty/test_MySQLdb/capabilities.py index b0f7cb905..bb47cc5f6 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/capabilities.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/capabilities.py @@ -1,25 +1,18 @@ -#!/usr/bin/env python -O """ Script to test database capabilities and the DB-API interface for functionality and memory leaks. Adapted from a script by M-A Lemburg. """ -import sys from time import time -try: - import unittest2 as unittest -except ImportError: - import unittest +import unittest -PY2 = sys.version_info[0] == 2 class DatabaseTest(unittest.TestCase): - db_module = None connect_args = () - connect_kwargs = dict(use_unicode=True, charset="utf8") - create_table_extra = "ENGINE=INNODB CHARACTER SET UTF8" + connect_kwargs = dict(use_unicode=True, charset="utf8mb4", binary_prefix=True) + create_table_extra = "ENGINE=INNODB CHARACTER SET UTF8MB4" rows = 10 debug = False @@ -27,29 +20,32 @@ def setUp(self): db = self.db_module.connect(*self.connect_args, **self.connect_kwargs) self.connection = db self.cursor = db.cursor() - self.BLOBText = ''.join([chr(i) for i in range(256)] * 100); - if PY2: - self.BLOBUText = unicode().join(unichr(i) for i in range(16834)) - else: - self.BLOBUText = "".join(chr(i) for i in range(16834)) - self.BLOBBinary = self.db_module.Binary(''.join([chr(i) for i in range(256)] * 16)) + self.BLOBText = "".join([chr(i) for i in range(256)] * 100) + self.BLOBUText = "".join(chr(i) for i in range(16834)) + data = bytearray(range(256)) * 16 + self.BLOBBinary = self.db_module.Binary(data) leak_test = True def tearDown(self): if self.leak_test: import gc + del self.cursor orphans = gc.collect() - self.assertFalse(orphans, "%d orphaned objects found after deleting cursor" % orphans) + self.assertFalse( + orphans, "%d orphaned objects found after deleting cursor" % orphans + ) del self.connection orphans = gc.collect() - self.assertFalse(orphans, "%d orphaned objects found after deleting connection" % orphans) + self.assertFalse( + orphans, "%d orphaned objects found after deleting connection" % orphans + ) def table_exists(self, name): try: - self.cursor.execute('select * from %s where 1=0' % name) + self.cursor.execute("select * from %s where 1=0" % name) except Exception: return False else: @@ -61,41 +57,41 @@ def quote_identifier(self, ident): def new_table_name(self): i = id(self.cursor) while True: - name = self.quote_identifier('tb%08x' % i) + name = self.quote_identifier("tb%08x" % i) if not self.table_exists(name): return name i = i + 1 def create_table(self, columndefs): + """ + Create a table using a list of column definitions given in columndefs. - """ Create a table using a list of column definitions given in - columndefs. - - generator must be a function taking arguments (row_number, - col_number) returning a suitable data object for insertion - into the table. - + generator must be a function taking arguments (row_number, + col_number) returning a suitable data object for insertion + into the table. """ self.table = self.new_table_name() - self.cursor.execute('CREATE TABLE %s (%s) %s' % - (self.table, - ',\n'.join(columndefs), - self.create_table_extra)) + self.cursor.execute( + "CREATE TABLE %s (%s) %s" + % (self.table, ",\n".join(columndefs), self.create_table_extra) + ) def check_data_integrity(self, columndefs, generator): # insert self.create_table(columndefs) - insert_statement = ('INSERT INTO %s VALUES (%s)' % - (self.table, - ','.join(['%s'] * len(columndefs)))) - data = [ [ generator(i,j) for j in range(len(columndefs)) ] - for i in range(self.rows) ] + insert_statement = "INSERT INTO %s VALUES (%s)" % ( + self.table, + ",".join(["%s"] * len(columndefs)), + ) + data = [ + [generator(i, j) for j in range(len(columndefs))] for i in range(self.rows) + ] if self.debug: print(data) self.cursor.executemany(insert_statement, data) self.connection.commit() # verify - self.cursor.execute('select * from %s' % self.table) + self.cursor.execute("select * from %s" % self.table) l = self.cursor.fetchall() if self.debug: print(l) @@ -103,62 +99,74 @@ def check_data_integrity(self, columndefs, generator): try: for i in range(self.rows): for j in range(len(columndefs)): - self.assertEqual(l[i][j], generator(i,j)) + self.assertEqual(l[i][j], generator(i, j)) finally: if not self.debug: - self.cursor.execute('drop table %s' % (self.table)) + self.cursor.execute("drop table %s" % (self.table)) def test_transactions(self): - columndefs = ( 'col1 INT', 'col2 VARCHAR(255)') + columndefs = ("col1 INT", "col2 VARCHAR(255)") + def generator(row, col): - if col == 0: return row - else: return ('%i' % (row%10))*255 + if col == 0: + return row + else: + return ("%i" % (row % 10)) * 255 + self.create_table(columndefs) - insert_statement = ('INSERT INTO %s VALUES (%s)' % - (self.table, - ','.join(['%s'] * len(columndefs)))) - data = [ [ generator(i,j) for j in range(len(columndefs)) ] - for i in range(self.rows) ] + insert_statement = "INSERT INTO %s VALUES (%s)" % ( + self.table, + ",".join(["%s"] * len(columndefs)), + ) + data = [ + [generator(i, j) for j in range(len(columndefs))] for i in range(self.rows) + ] self.cursor.executemany(insert_statement, data) # verify self.connection.commit() - self.cursor.execute('select * from %s' % self.table) + self.cursor.execute("select * from %s" % self.table) l = self.cursor.fetchall() self.assertEqual(len(l), self.rows) for i in range(self.rows): for j in range(len(columndefs)): - self.assertEqual(l[i][j], generator(i,j)) - delete_statement = 'delete from %s where col1=%%s' % self.table + self.assertEqual(l[i][j], generator(i, j)) + delete_statement = "delete from %s where col1=%%s" % self.table self.cursor.execute(delete_statement, (0,)) - self.cursor.execute('select col1 from %s where col1=%s' % \ - (self.table, 0)) + self.cursor.execute("select col1 from %s where col1=%s" % (self.table, 0)) l = self.cursor.fetchall() self.assertFalse(l, "DELETE didn't work") self.connection.rollback() - self.cursor.execute('select col1 from %s where col1=%s' % \ - (self.table, 0)) + self.cursor.execute("select col1 from %s where col1=%s" % (self.table, 0)) l = self.cursor.fetchall() self.assertTrue(len(l) == 1, "ROLLBACK didn't work") - self.cursor.execute('drop table %s' % (self.table)) + self.cursor.execute("drop table %s" % (self.table)) def test_truncation(self): - columndefs = ( 'col1 INT', 'col2 VARCHAR(255)') + columndefs = ("col1 INT", "col2 VARCHAR(255)") + def generator(row, col): - if col == 0: return row - else: return ('%i' % (row%10))*((255-self.rows//2)+row) + if col == 0: + return row + else: + return ("%i" % (row % 10)) * ((255 - self.rows // 2) + row) + self.create_table(columndefs) - insert_statement = ('INSERT INTO %s VALUES (%s)' % - (self.table, - ','.join(['%s'] * len(columndefs)))) + insert_statement = "INSERT INTO %s VALUES (%s)" % ( + self.table, + ",".join(["%s"] * len(columndefs)), + ) try: - self.cursor.execute(insert_statement, (0, '0'*256)) + self.cursor.execute(insert_statement, (0, "0" * 256)) except Warning: - if self.debug: print(self.cursor.messages) + if self.debug: + print(self.cursor.messages) except self.connection.DataError: pass else: - self.fail("Over-long column did not generate warnings/exception with single insert") + self.fail( + "Over-long column did not generate warnings/exception with single insert" + ) self.connection.rollback() @@ -166,132 +174,136 @@ def generator(row, col): for i in range(self.rows): data = [] for j in range(len(columndefs)): - data.append(generator(i,j)) - self.cursor.execute(insert_statement,tuple(data)) + data.append(generator(i, j)) + self.cursor.execute(insert_statement, tuple(data)) except Warning: - if self.debug: print(self.cursor.messages) + if self.debug: + print(self.cursor.messages) except self.connection.DataError: pass else: - self.fail("Over-long columns did not generate warnings/exception with execute()") + self.fail( + "Over-long columns did not generate warnings/exception with execute()" + ) self.connection.rollback() try: - data = [ [ generator(i,j) for j in range(len(columndefs)) ] - for i in range(self.rows) ] + data = [ + [generator(i, j) for j in range(len(columndefs))] + for i in range(self.rows) + ] self.cursor.executemany(insert_statement, data) except Warning: - if self.debug: print(self.cursor.messages) + if self.debug: + print(self.cursor.messages) except self.connection.DataError: pass else: - self.fail("Over-long columns did not generate warnings/exception with executemany()") + self.fail( + "Over-long columns did not generate warnings/exception with executemany()" + ) self.connection.rollback() - self.cursor.execute('drop table %s' % (self.table)) + self.cursor.execute("drop table %s" % (self.table)) def test_CHAR(self): # Character data - def generator(row,col): - return ('%i' % ((row+col) % 10)) * 255 - self.check_data_integrity( - ('col1 char(255)','col2 char(255)'), - generator) + def generator(row, col): + return ("%i" % ((row + col) % 10)) * 255 + + self.check_data_integrity(("col1 char(255)", "col2 char(255)"), generator) def test_INT(self): # Number data - def generator(row,col): - return row*row - self.check_data_integrity( - ('col1 INT',), - generator) + def generator(row, col): + return row * row + + self.check_data_integrity(("col1 INT",), generator) def test_DECIMAL(self): # DECIMAL - def generator(row,col): + def generator(row, col): from decimal import Decimal + return Decimal("%d.%02d" % (row, col)) - self.check_data_integrity( - ('col1 DECIMAL(5,2)',), - generator) + + self.check_data_integrity(("col1 DECIMAL(5,2)",), generator) def test_DATE(self): ticks = time() - def generator(row,col): - return self.db_module.DateFromTicks(ticks+row*86400-col*1313) - self.check_data_integrity( - ('col1 DATE',), - generator) + + def generator(row, col): + return self.db_module.DateFromTicks(ticks + row * 86400 - col * 1313) + + self.check_data_integrity(("col1 DATE",), generator) def test_TIME(self): ticks = time() - def generator(row,col): - return self.db_module.TimeFromTicks(ticks+row*86400-col*1313) - self.check_data_integrity( - ('col1 TIME',), - generator) + + def generator(row, col): + return self.db_module.TimeFromTicks(ticks + row * 86400 - col * 1313) + + self.check_data_integrity(("col1 TIME",), generator) def test_DATETIME(self): ticks = time() - def generator(row,col): - return self.db_module.TimestampFromTicks(ticks+row*86400-col*1313) - self.check_data_integrity( - ('col1 DATETIME',), - generator) + + def generator(row, col): + return self.db_module.TimestampFromTicks(ticks + row * 86400 - col * 1313) + + self.check_data_integrity(("col1 DATETIME",), generator) def test_TIMESTAMP(self): ticks = time() - def generator(row,col): - return self.db_module.TimestampFromTicks(ticks+row*86400-col*1313) - self.check_data_integrity( - ('col1 TIMESTAMP',), - generator) + + def generator(row, col): + return self.db_module.TimestampFromTicks(ticks + row * 86400 - col * 1313) + + self.check_data_integrity(("col1 TIMESTAMP",), generator) def test_fractional_TIMESTAMP(self): ticks = time() - def generator(row,col): - return self.db_module.TimestampFromTicks(ticks+row*86400-col*1313+row*0.7*col/3.0) - self.check_data_integrity( - ('col1 TIMESTAMP',), - generator) + + def generator(row, col): + return self.db_module.TimestampFromTicks( + ticks + row * 86400 - col * 1313 + row * 0.7 * col / 3.0 + ) + + self.check_data_integrity(("col1 TIMESTAMP",), generator) def test_LONG(self): - def generator(row,col): + def generator(row, col): if col == 0: return row else: - return self.BLOBUText # 'BLOB Text ' * 1024 - self.check_data_integrity( - ('col1 INT', 'col2 LONG'), - generator) + return self.BLOBUText # 'BLOB Text ' * 1024 + + self.check_data_integrity(("col1 INT", "col2 LONG"), generator) def test_TEXT(self): - def generator(row,col): + def generator(row, col): if col == 0: return row else: - return self.BLOBUText[:5192] # 'BLOB Text ' * 1024 - self.check_data_integrity( - ('col1 INT', 'col2 TEXT'), - generator) + return self.BLOBUText[:5192] # 'BLOB Text ' * 1024 + + self.check_data_integrity(("col1 INT", "col2 TEXT"), generator) def test_LONG_BYTE(self): - def generator(row,col): + def generator(row, col): if col == 0: return row else: - return self.BLOBBinary # 'BLOB\000Binary ' * 1024 - self.check_data_integrity( - ('col1 INT','col2 LONG BYTE'), - generator) + return self.BLOBBinary # 'BLOB\000Binary ' * 1024 + + self.check_data_integrity(("col1 INT", "col2 LONG BYTE"), generator) def test_BLOB(self): - def generator(row,col): + def generator(row, col): if col == 0: return row else: - return self.BLOBBinary # 'BLOB\000Binary ' * 1024 - self.check_data_integrity( - ('col1 INT','col2 BLOB'), - generator) + return self.BLOBBinary # 'BLOB\000Binary ' * 1024 + + self.check_data_integrity(("col1 INT", "col2 BLOB"), generator) diff --git a/pymysql/tests/thirdparty/test_MySQLdb/dbapi20.py b/pymysql/tests/thirdparty/test_MySQLdb/dbapi20.py index d6fcabf98..fff14b86f 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/dbapi20.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/dbapi20.py @@ -1,5 +1,4 @@ -#!/usr/bin/env python -''' Python DB API 2.0 driver compliance unit test suite. +""" Python DB API 2.0 driver compliance unit test suite. This software is Public Domain and may be used without restrictions. @@ -9,18 +8,14 @@ this is turning out to be a thoroughly unwholesome unit test." -- Ian Bicking -''' +""" -__rcs_id__ = '$Id$' -__version__ = '$Revision$'[11:-2] -__author__ = 'Stuart Bishop ' - -try: - import unittest2 as unittest -except ImportError: - import unittest +__rcs_id__ = "$Id$" +__version__ = "$Revision$"[11:-2] +__author__ = "Stuart Bishop " import time +import unittest # $Log$ # Revision 1.1.2.1 2006/02/25 03:44:32 adustman @@ -56,9 +51,9 @@ # - Now a subclass of TestCase, to avoid requiring the driver stub # to use multiple inheritance # - Reversed the polarity of buggy test in test_description -# - Test exception heirarchy correctly +# - Test exception hierarchy correctly # - self.populate is now self._populate(), so if a driver stub -# overrides self.ddl1 this change propogates +# overrides self.ddl1 this change propagates # - VARCHAR columns now have a width, which will hopefully make the # DDL even more portible (this will be reversed if it causes more problems) # - cursor.rowcount being checked after various execute and fetchXXX methods @@ -68,65 +63,66 @@ # - Fix bugs in test_setoutputsize_basic and test_setinputsizes # + class DatabaseAPI20Test(unittest.TestCase): - ''' Test a database self.driver for DB API 2.0 compatibility. - This implementation tests Gadfly, but the TestCase - is structured so that other self.drivers can subclass this - test case to ensure compiliance with the DB-API. It is - expected that this TestCase may be expanded in the future - if ambiguities or edge conditions are discovered. + """Test a database self.driver for DB API 2.0 compatibility. + This implementation tests Gadfly, but the TestCase + is structured so that other self.drivers can subclass this + test case to ensure compiliance with the DB-API. It is + expected that this TestCase may be expanded in the future + if ambiguities or edge conditions are discovered. - The 'Optional Extensions' are not yet being tested. + The 'Optional Extensions' are not yet being tested. - self.drivers should subclass this test, overriding setUp, tearDown, - self.driver, connect_args and connect_kw_args. Class specification - should be as follows: + self.drivers should subclass this test, overriding setUp, tearDown, + self.driver, connect_args and connect_kw_args. Class specification + should be as follows: - import dbapi20 - class mytest(dbapi20.DatabaseAPI20Test): - [...] + import dbapi20 + class mytest(dbapi20.DatabaseAPI20Test): + [...] - Don't 'import DatabaseAPI20Test from dbapi20', or you will - confuse the unit tester - just 'import dbapi20'. - ''' + Don't 'import DatabaseAPI20Test from dbapi20', or you will + confuse the unit tester - just 'import dbapi20'. + """ # The self.driver module. This should be the module where the 'connect' # method is to be found driver = None - connect_args = () # List of arguments to pass to connect - connect_kw_args = {} # Keyword arguments for connect - table_prefix = 'dbapi20test_' # If you need to specify a prefix for tables + connect_args = () # List of arguments to pass to connect + connect_kw_args = {} # Keyword arguments for connect + table_prefix = "dbapi20test_" # If you need to specify a prefix for tables - ddl1 = 'create table %sbooze (name varchar(20))' % table_prefix - ddl2 = 'create table %sbarflys (name varchar(20))' % table_prefix - xddl1 = 'drop table %sbooze' % table_prefix - xddl2 = 'drop table %sbarflys' % table_prefix + ddl1 = "create table %sbooze (name varchar(20))" % table_prefix + ddl2 = "create table %sbarflys (name varchar(20))" % table_prefix + xddl1 = "drop table %sbooze" % table_prefix + xddl2 = "drop table %sbarflys" % table_prefix - lowerfunc = 'lower' # Name of stored procedure to convert string->lowercase + lowerfunc = "lower" # Name of stored procedure to convert string->lowercase # Some drivers may need to override these helpers, for example adding # a 'commit' after the execute. - def executeDDL1(self,cursor): + def executeDDL1(self, cursor): cursor.execute(self.ddl1) - def executeDDL2(self,cursor): + def executeDDL2(self, cursor): cursor.execute(self.ddl2) def setUp(self): - ''' self.drivers should override this method to perform required setup - if any is necessary, such as creating the database. - ''' + """self.drivers should override this method to perform required setup + if any is necessary, such as creating the database. + """ pass def tearDown(self): - ''' self.drivers should override this method to perform required cleanup - if any is necessary, such as deleting the test database. - The default drops the tables that may be created. - ''' + """self.drivers should override this method to perform required cleanup + if any is necessary, such as deleting the test database. + The default drops the tables that may be created. + """ con = self._connect() try: cur = con.cursor() - for ddl in (self.xddl1,self.xddl2): + for ddl in (self.xddl1, self.xddl2): try: cur.execute(ddl) con.commit() @@ -139,9 +135,7 @@ def tearDown(self): def _connect(self): try: - return self.driver.connect( - *self.connect_args,**self.connect_kw_args - ) + return self.driver.connect(*self.connect_args, **self.connect_kw_args) except AttributeError: self.fail("No connect method found in self.driver module") @@ -154,7 +148,7 @@ def test_apilevel(self): # Must exist apilevel = self.driver.apilevel # Must equal 2.0 - self.assertEqual(apilevel,'2.0') + self.assertEqual(apilevel, "2.0") except AttributeError: self.fail("Driver doesn't define apilevel") @@ -163,7 +157,7 @@ def test_threadsafety(self): # Must exist threadsafety = self.driver.threadsafety # Must be a valid value - self.assertTrue(threadsafety in (0,1,2,3)) + self.assertTrue(threadsafety in (0, 1, 2, 3)) except AttributeError: self.fail("Driver doesn't define threadsafety") @@ -172,38 +166,24 @@ def test_paramstyle(self): # Must exist paramstyle = self.driver.paramstyle # Must be a valid value - self.assertTrue(paramstyle in ( - 'qmark','numeric','named','format','pyformat' - )) + self.assertTrue( + paramstyle in ("qmark", "numeric", "named", "format", "pyformat") + ) except AttributeError: self.fail("Driver doesn't define paramstyle") def test_Exceptions(self): # Make sure required exceptions exist, and are in the - # defined heirarchy. - self.assertTrue(issubclass(self.driver.Warning,Exception)) - self.assertTrue(issubclass(self.driver.Error,Exception)) - self.assertTrue( - issubclass(self.driver.InterfaceError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.DatabaseError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.OperationalError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.IntegrityError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.InternalError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.ProgrammingError,self.driver.Error) - ) - self.assertTrue( - issubclass(self.driver.NotSupportedError,self.driver.Error) - ) + # defined hierarchy. + self.assertTrue(issubclass(self.driver.Warning, Exception)) + self.assertTrue(issubclass(self.driver.Error, Exception)) + self.assertTrue(issubclass(self.driver.InterfaceError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.DatabaseError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.OperationalError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.IntegrityError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.InternalError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.ProgrammingError, self.driver.Error)) + self.assertTrue(issubclass(self.driver.NotSupportedError, self.driver.Error)) def test_ExceptionsAsConnectionAttributes(self): # OPTIONAL EXTENSION @@ -224,7 +204,6 @@ def test_ExceptionsAsConnectionAttributes(self): self.assertTrue(con.ProgrammingError is drv.ProgrammingError) self.assertTrue(con.NotSupportedError is drv.NotSupportedError) - def test_commit(self): con = self._connect() try: @@ -237,7 +216,7 @@ def test_rollback(self): con = self._connect() # If rollback is defined, it should either work or throw # the documented exception - if hasattr(con,'rollback'): + if hasattr(con, "rollback"): try: con.rollback() except self.driver.NotSupportedError: @@ -246,7 +225,7 @@ def test_rollback(self): def test_cursor(self): con = self._connect() try: - cur = con.cursor() + con.cursor() finally: con.close() @@ -258,14 +237,14 @@ def test_cursor_isolation(self): cur1 = con.cursor() cur2 = con.cursor() self.executeDDL1(cur1) - cur1.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) + cur1.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) cur2.execute("select name from %sbooze" % self.table_prefix) booze = cur2.fetchall() - self.assertEqual(len(booze),1) - self.assertEqual(len(booze[0]),1) - self.assertEqual(booze[0][0],'Victoria Bitter') + self.assertEqual(len(booze), 1) + self.assertEqual(len(booze[0]), 1) + self.assertEqual(booze[0][0], "Victoria Bitter") finally: con.close() @@ -274,31 +253,41 @@ def test_description(self): try: cur = con.cursor() self.executeDDL1(cur) - self.assertEqual(cur.description,None, - 'cursor.description should be none after executing a ' - 'statement that can return no rows (such as DDL)' - ) - cur.execute('select name from %sbooze' % self.table_prefix) - self.assertEqual(len(cur.description),1, - 'cursor.description describes too many columns' - ) - self.assertEqual(len(cur.description[0]),7, - 'cursor.description[x] tuples must have 7 elements' - ) - self.assertEqual(cur.description[0][0].lower(),'name', - 'cursor.description[x][0] must return column name' - ) - self.assertEqual(cur.description[0][1],self.driver.STRING, - 'cursor.description[x][1] must return column type. Got %r' - % cur.description[0][1] - ) + self.assertEqual( + cur.description, + None, + "cursor.description should be none after executing a " + "statement that can return no rows (such as DDL)", + ) + cur.execute("select name from %sbooze" % self.table_prefix) + self.assertEqual( + len(cur.description), 1, "cursor.description describes too many columns" + ) + self.assertEqual( + len(cur.description[0]), + 7, + "cursor.description[x] tuples must have 7 elements", + ) + self.assertEqual( + cur.description[0][0].lower(), + "name", + "cursor.description[x][0] must return column name", + ) + self.assertEqual( + cur.description[0][1], + self.driver.STRING, + "cursor.description[x][1] must return column type. Got %r" + % cur.description[0][1], + ) # Make sure self.description gets reset self.executeDDL2(cur) - self.assertEqual(cur.description,None, - 'cursor.description not being set to None when executing ' - 'no-result statements (eg. DDL)' - ) + self.assertEqual( + cur.description, + None, + "cursor.description not being set to None when executing " + "no-result statements (eg. DDL)", + ) finally: con.close() @@ -307,47 +296,49 @@ def test_rowcount(self): try: cur = con.cursor() self.executeDDL1(cur) - self.assertEqual(cur.rowcount,-1, - 'cursor.rowcount should be -1 after executing no-result ' - 'statements' - ) - cur.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) - self.assertTrue(cur.rowcount in (-1,1), - 'cursor.rowcount should == number or rows inserted, or ' - 'set to -1 after executing an insert statement' - ) + self.assertEqual( + cur.rowcount, + -1, + "cursor.rowcount should be -1 after executing no-result statements", + ) + cur.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) + self.assertTrue( + cur.rowcount in (-1, 1), + "cursor.rowcount should == number or rows inserted, or " + "set to -1 after executing an insert statement", + ) cur.execute("select name from %sbooze" % self.table_prefix) - self.assertTrue(cur.rowcount in (-1,1), - 'cursor.rowcount should == number of rows returned, or ' - 'set to -1 after executing a select statement' - ) + self.assertTrue( + cur.rowcount in (-1, 1), + "cursor.rowcount should == number of rows returned, or " + "set to -1 after executing a select statement", + ) self.executeDDL2(cur) - self.assertEqual(cur.rowcount,-1, - 'cursor.rowcount not being reset to -1 after executing ' - 'no-result statements' - ) + self.assertEqual( + cur.rowcount, + -1, + "cursor.rowcount not being reset to -1 after executing " + "no-result statements", + ) finally: con.close() - lower_func = 'lower' + lower_func = "lower" + def test_callproc(self): con = self._connect() try: cur = con.cursor() - if self.lower_func and hasattr(cur,'callproc'): - r = cur.callproc(self.lower_func,('FOO',)) - self.assertEqual(len(r),1) - self.assertEqual(r[0],'FOO') + if self.lower_func and hasattr(cur, "callproc"): + r = cur.callproc(self.lower_func, ("FOO",)) + self.assertEqual(len(r), 1) + self.assertEqual(r[0], "FOO") r = cur.fetchall() - self.assertEqual(len(r),1,'callproc produced no result set') - self.assertEqual(len(r[0]),1, - 'callproc produced invalid result set' - ) - self.assertEqual(r[0][0],'foo', - 'callproc produced invalid results' - ) + self.assertEqual(len(r), 1, "callproc produced no result set") + self.assertEqual(len(r[0]), 1, "callproc produced invalid result set") + self.assertEqual(r[0][0], "foo", "callproc produced invalid results") finally: con.close() @@ -360,14 +351,14 @@ def test_close(self): # cursor.execute should raise an Error if called after connection # closed - self.assertRaises(self.driver.Error,self.executeDDL1,cur) + self.assertRaises(self.driver.Error, self.executeDDL1, cur) # connection.commit should raise an Error if called after connection' # closed.' - self.assertRaises(self.driver.Error,con.commit) + self.assertRaises(self.driver.Error, con.commit) # connection.close should raise an Error if called more than once - self.assertRaises(self.driver.Error,con.close) + self.assertRaises(self.driver.Error, con.close) def test_execute(self): con = self._connect() @@ -377,105 +368,99 @@ def test_execute(self): finally: con.close() - def _paraminsert(self,cur): + def _paraminsert(self, cur): self.executeDDL1(cur) - cur.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) - self.assertTrue(cur.rowcount in (-1,1)) + cur.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) + self.assertTrue(cur.rowcount in (-1, 1)) - if self.driver.paramstyle == 'qmark': + if self.driver.paramstyle == "qmark": cur.execute( - 'insert into %sbooze values (?)' % self.table_prefix, - ("Cooper's",) - ) - elif self.driver.paramstyle == 'numeric': + "insert into %sbooze values (?)" % self.table_prefix, ("Cooper's",) + ) + elif self.driver.paramstyle == "numeric": cur.execute( - 'insert into %sbooze values (:1)' % self.table_prefix, - ("Cooper's",) - ) - elif self.driver.paramstyle == 'named': + "insert into %sbooze values (:1)" % self.table_prefix, ("Cooper's",) + ) + elif self.driver.paramstyle == "named": cur.execute( - 'insert into %sbooze values (:beer)' % self.table_prefix, - {'beer':"Cooper's"} - ) - elif self.driver.paramstyle == 'format': + "insert into %sbooze values (:beer)" % self.table_prefix, + {"beer": "Cooper's"}, + ) + elif self.driver.paramstyle == "format": cur.execute( - 'insert into %sbooze values (%%s)' % self.table_prefix, - ("Cooper's",) - ) - elif self.driver.paramstyle == 'pyformat': + "insert into %sbooze values (%%s)" % self.table_prefix, ("Cooper's",) + ) + elif self.driver.paramstyle == "pyformat": cur.execute( - 'insert into %sbooze values (%%(beer)s)' % self.table_prefix, - {'beer':"Cooper's"} - ) + "insert into %sbooze values (%%(beer)s)" % self.table_prefix, + {"beer": "Cooper's"}, + ) else: - self.fail('Invalid paramstyle') - self.assertTrue(cur.rowcount in (-1,1)) + self.fail("Invalid paramstyle") + self.assertTrue(cur.rowcount in (-1, 1)) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) res = cur.fetchall() - self.assertEqual(len(res),2,'cursor.fetchall returned too few rows') - beers = [res[0][0],res[1][0]] + self.assertEqual(len(res), 2, "cursor.fetchall returned too few rows") + beers = [res[0][0], res[1][0]] beers.sort() - self.assertEqual(beers[0],"Cooper's", - 'cursor.fetchall retrieved incorrect data, or data inserted ' - 'incorrectly' - ) - self.assertEqual(beers[1],"Victoria Bitter", - 'cursor.fetchall retrieved incorrect data, or data inserted ' - 'incorrectly' - ) + self.assertEqual( + beers[0], + "Cooper's", + "cursor.fetchall retrieved incorrect data, or data inserted incorrectly", + ) + self.assertEqual( + beers[1], + "Victoria Bitter", + "cursor.fetchall retrieved incorrect data, or data inserted incorrectly", + ) def test_executemany(self): con = self._connect() try: cur = con.cursor() self.executeDDL1(cur) - largs = [ ("Cooper's",) , ("Boag's",) ] - margs = [ {'beer': "Cooper's"}, {'beer': "Boag's"} ] - if self.driver.paramstyle == 'qmark': + largs = [("Cooper's",), ("Boag's",)] + margs = [{"beer": "Cooper's"}, {"beer": "Boag's"}] + if self.driver.paramstyle == "qmark": cur.executemany( - 'insert into %sbooze values (?)' % self.table_prefix, - largs - ) - elif self.driver.paramstyle == 'numeric': + "insert into %sbooze values (?)" % self.table_prefix, largs + ) + elif self.driver.paramstyle == "numeric": cur.executemany( - 'insert into %sbooze values (:1)' % self.table_prefix, - largs - ) - elif self.driver.paramstyle == 'named': + "insert into %sbooze values (:1)" % self.table_prefix, largs + ) + elif self.driver.paramstyle == "named": cur.executemany( - 'insert into %sbooze values (:beer)' % self.table_prefix, - margs - ) - elif self.driver.paramstyle == 'format': + "insert into %sbooze values (:beer)" % self.table_prefix, margs + ) + elif self.driver.paramstyle == "format": cur.executemany( - 'insert into %sbooze values (%%s)' % self.table_prefix, - largs - ) - elif self.driver.paramstyle == 'pyformat': + "insert into %sbooze values (%%s)" % self.table_prefix, largs + ) + elif self.driver.paramstyle == "pyformat": cur.executemany( - 'insert into %sbooze values (%%(beer)s)' % ( - self.table_prefix - ), - margs - ) - else: - self.fail('Unknown paramstyle') - self.assertTrue(cur.rowcount in (-1,2), - 'insert using cursor.executemany set cursor.rowcount to ' - 'incorrect value %r' % cur.rowcount + "insert into %sbooze values (%%(beer)s)" % (self.table_prefix), + margs, ) - cur.execute('select name from %sbooze' % self.table_prefix) + else: + self.fail("Unknown paramstyle") + self.assertTrue( + cur.rowcount in (-1, 2), + "insert using cursor.executemany set cursor.rowcount to " + "incorrect value %r" % cur.rowcount, + ) + cur.execute("select name from %sbooze" % self.table_prefix) res = cur.fetchall() - self.assertEqual(len(res),2, - 'cursor.fetchall retrieved incorrect number of rows' - ) - beers = [res[0][0],res[1][0]] + self.assertEqual( + len(res), 2, "cursor.fetchall retrieved incorrect number of rows" + ) + beers = [res[0][0], res[1][0]] beers.sort() - self.assertEqual(beers[0],"Boag's",'incorrect data retrieved') - self.assertEqual(beers[1],"Cooper's",'incorrect data retrieved') + self.assertEqual(beers[0], "Boag's", "incorrect data retrieved") + self.assertEqual(beers[1], "Cooper's", "incorrect data retrieved") finally: con.close() @@ -486,59 +471,62 @@ def test_fetchone(self): # cursor.fetchone should raise an Error if called before # executing a select-type query - self.assertRaises(self.driver.Error,cur.fetchone) + self.assertRaises(self.driver.Error, cur.fetchone) # cursor.fetchone should raise an Error if called after - # executing a query that cannnot return rows + # executing a query that cannot return rows self.executeDDL1(cur) - self.assertRaises(self.driver.Error,cur.fetchone) + self.assertRaises(self.driver.Error, cur.fetchone) - cur.execute('select name from %sbooze' % self.table_prefix) - self.assertEqual(cur.fetchone(),None, - 'cursor.fetchone should return None if a query retrieves ' - 'no rows' - ) - self.assertTrue(cur.rowcount in (-1,0)) + cur.execute("select name from %sbooze" % self.table_prefix) + self.assertEqual( + cur.fetchone(), + None, + "cursor.fetchone should return None if a query retrieves no rows", + ) + self.assertTrue(cur.rowcount in (-1, 0)) # cursor.fetchone should raise an Error if called after - # executing a query that cannnot return rows - cur.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) - self.assertRaises(self.driver.Error,cur.fetchone) + # executing a query that cannot return rows + cur.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) + self.assertRaises(self.driver.Error, cur.fetchone) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) r = cur.fetchone() - self.assertEqual(len(r),1, - 'cursor.fetchone should have retrieved a single row' - ) - self.assertEqual(r[0],'Victoria Bitter', - 'cursor.fetchone retrieved incorrect data' - ) - self.assertEqual(cur.fetchone(),None, - 'cursor.fetchone should return None if no more rows available' - ) - self.assertTrue(cur.rowcount in (-1,1)) + self.assertEqual( + len(r), 1, "cursor.fetchone should have retrieved a single row" + ) + self.assertEqual( + r[0], "Victoria Bitter", "cursor.fetchone retrieved incorrect data" + ) + self.assertEqual( + cur.fetchone(), + None, + "cursor.fetchone should return None if no more rows available", + ) + self.assertTrue(cur.rowcount in (-1, 1)) finally: con.close() samples = [ - 'Carlton Cold', - 'Carlton Draft', - 'Mountain Goat', - 'Redback', - 'Victoria Bitter', - 'XXXX' - ] + "Carlton Cold", + "Carlton Draft", + "Mountain Goat", + "Redback", + "Victoria Bitter", + "XXXX", + ] def _populate(self): - ''' Return a list of sql commands to setup the DB for the fetch - tests. - ''' + """Return a list of sql commands to setup the DB for the fetch + tests. + """ populate = [ - "insert into %sbooze values ('%s')" % (self.table_prefix,s) - for s in self.samples - ] + "insert into %sbooze values ('%s')" % (self.table_prefix, s) + for s in self.samples + ] return populate def test_fetchmany(self): @@ -547,78 +535,88 @@ def test_fetchmany(self): cur = con.cursor() # cursor.fetchmany should raise an Error if called without - #issuing a query - self.assertRaises(self.driver.Error,cur.fetchmany,4) + # issuing a query + self.assertRaises(self.driver.Error, cur.fetchmany, 4) self.executeDDL1(cur) for sql in self._populate(): cur.execute(sql) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) r = cur.fetchmany() - self.assertEqual(len(r),1, - 'cursor.fetchmany retrieved incorrect number of rows, ' - 'default of arraysize is one.' - ) - cur.arraysize=10 - r = cur.fetchmany(3) # Should get 3 rows - self.assertEqual(len(r),3, - 'cursor.fetchmany retrieved incorrect number of rows' - ) - r = cur.fetchmany(4) # Should get 2 more - self.assertEqual(len(r),2, - 'cursor.fetchmany retrieved incorrect number of rows' - ) - r = cur.fetchmany(4) # Should be an empty sequence - self.assertEqual(len(r),0, - 'cursor.fetchmany should return an empty sequence after ' - 'results are exhausted' + self.assertEqual( + len(r), + 1, + "cursor.fetchmany retrieved incorrect number of rows, " + "default of arraysize is one.", + ) + cur.arraysize = 10 + r = cur.fetchmany(3) # Should get 3 rows + self.assertEqual( + len(r), 3, "cursor.fetchmany retrieved incorrect number of rows" + ) + r = cur.fetchmany(4) # Should get 2 more + self.assertEqual( + len(r), 2, "cursor.fetchmany retrieved incorrect number of rows" + ) + r = cur.fetchmany(4) # Should be an empty sequence + self.assertEqual( + len(r), + 0, + "cursor.fetchmany should return an empty sequence after " + "results are exhausted", ) - self.assertTrue(cur.rowcount in (-1,6)) + self.assertTrue(cur.rowcount in (-1, 6)) # Same as above, using cursor.arraysize - cur.arraysize=4 - cur.execute('select name from %sbooze' % self.table_prefix) - r = cur.fetchmany() # Should get 4 rows - self.assertEqual(len(r),4, - 'cursor.arraysize not being honoured by fetchmany' - ) - r = cur.fetchmany() # Should get 2 more - self.assertEqual(len(r),2) - r = cur.fetchmany() # Should be an empty sequence - self.assertEqual(len(r),0) - self.assertTrue(cur.rowcount in (-1,6)) - - cur.arraysize=6 - cur.execute('select name from %sbooze' % self.table_prefix) - rows = cur.fetchmany() # Should get all rows - self.assertTrue(cur.rowcount in (-1,6)) - self.assertEqual(len(rows),6) - self.assertEqual(len(rows),6) + cur.arraysize = 4 + cur.execute("select name from %sbooze" % self.table_prefix) + r = cur.fetchmany() # Should get 4 rows + self.assertEqual( + len(r), 4, "cursor.arraysize not being honoured by fetchmany" + ) + r = cur.fetchmany() # Should get 2 more + self.assertEqual(len(r), 2) + r = cur.fetchmany() # Should be an empty sequence + self.assertEqual(len(r), 0) + self.assertTrue(cur.rowcount in (-1, 6)) + + cur.arraysize = 6 + cur.execute("select name from %sbooze" % self.table_prefix) + rows = cur.fetchmany() # Should get all rows + self.assertTrue(cur.rowcount in (-1, 6)) + self.assertEqual(len(rows), 6) + self.assertEqual(len(rows), 6) rows = [r[0] for r in rows] rows.sort() # Make sure we get the right data back out - for i in range(0,6): - self.assertEqual(rows[i],self.samples[i], - 'incorrect data retrieved by cursor.fetchmany' - ) - - rows = cur.fetchmany() # Should return an empty list - self.assertEqual(len(rows),0, - 'cursor.fetchmany should return an empty sequence if ' - 'called after the whole result set has been fetched' + for i in range(0, 6): + self.assertEqual( + rows[i], + self.samples[i], + "incorrect data retrieved by cursor.fetchmany", ) - self.assertTrue(cur.rowcount in (-1,6)) + + rows = cur.fetchmany() # Should return an empty list + self.assertEqual( + len(rows), + 0, + "cursor.fetchmany should return an empty sequence if " + "called after the whole result set has been fetched", + ) + self.assertTrue(cur.rowcount in (-1, 6)) self.executeDDL2(cur) - cur.execute('select name from %sbarflys' % self.table_prefix) - r = cur.fetchmany() # Should get empty sequence - self.assertEqual(len(r),0, - 'cursor.fetchmany should return an empty sequence if ' - 'query retrieved no rows' - ) - self.assertTrue(cur.rowcount in (-1,0)) + cur.execute("select name from %sbarflys" % self.table_prefix) + r = cur.fetchmany() # Should get empty sequence + self.assertEqual( + len(r), + 0, + "cursor.fetchmany should return an empty sequence if " + "query retrieved no rows", + ) + self.assertTrue(cur.rowcount in (-1, 0)) finally: con.close() @@ -638,36 +636,41 @@ def test_fetchall(self): # cursor.fetchall should raise an Error if called # after executing a a statement that cannot return rows - self.assertRaises(self.driver.Error,cur.fetchall) + self.assertRaises(self.driver.Error, cur.fetchall) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) rows = cur.fetchall() - self.assertTrue(cur.rowcount in (-1,len(self.samples))) - self.assertEqual(len(rows),len(self.samples), - 'cursor.fetchall did not retrieve all rows' - ) + self.assertTrue(cur.rowcount in (-1, len(self.samples))) + self.assertEqual( + len(rows), + len(self.samples), + "cursor.fetchall did not retrieve all rows", + ) rows = [r[0] for r in rows] rows.sort() - for i in range(0,len(self.samples)): - self.assertEqual(rows[i],self.samples[i], - 'cursor.fetchall retrieved incorrect rows' + for i in range(0, len(self.samples)): + self.assertEqual( + rows[i], self.samples[i], "cursor.fetchall retrieved incorrect rows" ) rows = cur.fetchall() self.assertEqual( - len(rows),0, - 'cursor.fetchall should return an empty list if called ' - 'after the whole result set has been fetched' - ) - self.assertTrue(cur.rowcount in (-1,len(self.samples))) + len(rows), + 0, + "cursor.fetchall should return an empty list if called " + "after the whole result set has been fetched", + ) + self.assertTrue(cur.rowcount in (-1, len(self.samples))) self.executeDDL2(cur) - cur.execute('select name from %sbarflys' % self.table_prefix) + cur.execute("select name from %sbarflys" % self.table_prefix) rows = cur.fetchall() - self.assertTrue(cur.rowcount in (-1,0)) - self.assertEqual(len(rows),0, - 'cursor.fetchall should return an empty list if ' - 'a select query returns no rows' - ) + self.assertTrue(cur.rowcount in (-1, 0)) + self.assertEqual( + len(rows), + 0, + "cursor.fetchall should return an empty list if " + "a select query returns no rows", + ) finally: con.close() @@ -680,74 +683,74 @@ def test_mixedfetch(self): for sql in self._populate(): cur.execute(sql) - cur.execute('select name from %sbooze' % self.table_prefix) - rows1 = cur.fetchone() + cur.execute("select name from %sbooze" % self.table_prefix) + rows1 = cur.fetchone() rows23 = cur.fetchmany(2) - rows4 = cur.fetchone() + rows4 = cur.fetchone() rows56 = cur.fetchall() - self.assertTrue(cur.rowcount in (-1,6)) - self.assertEqual(len(rows23),2, - 'fetchmany returned incorrect number of rows' - ) - self.assertEqual(len(rows56),2, - 'fetchall returned incorrect number of rows' - ) + self.assertTrue(cur.rowcount in (-1, 6)) + self.assertEqual( + len(rows23), 2, "fetchmany returned incorrect number of rows" + ) + self.assertEqual( + len(rows56), 2, "fetchall returned incorrect number of rows" + ) rows = [rows1[0]] - rows.extend([rows23[0][0],rows23[1][0]]) + rows.extend([rows23[0][0], rows23[1][0]]) rows.append(rows4[0]) - rows.extend([rows56[0][0],rows56[1][0]]) + rows.extend([rows56[0][0], rows56[1][0]]) rows.sort() - for i in range(0,len(self.samples)): - self.assertEqual(rows[i],self.samples[i], - 'incorrect data retrieved or inserted' - ) + for i in range(0, len(self.samples)): + self.assertEqual( + rows[i], self.samples[i], "incorrect data retrieved or inserted" + ) finally: con.close() - def help_nextset_setUp(self,cur): - ''' Should create a procedure called deleteme - that returns two result sets, first the - number of rows in booze then "name from booze" - ''' - raise NotImplementedError('Helper not implemented') - #sql=""" + def help_nextset_setUp(self, cur): + """Should create a procedure called deleteme + that returns two result sets, first the + number of rows in booze then "name from booze" + """ + raise NotImplementedError("Helper not implemented") + # sql=""" # create procedure deleteme as # begin # select count(*) from booze # select name from booze # end - #""" - #cur.execute(sql) + # """ + # cur.execute(sql) - def help_nextset_tearDown(self,cur): - 'If cleaning up is needed after nextSetTest' - raise NotImplementedError('Helper not implemented') - #cur.execute("drop procedure deleteme") + def help_nextset_tearDown(self, cur): + "If cleaning up is needed after nextSetTest" + raise NotImplementedError("Helper not implemented") + # cur.execute("drop procedure deleteme") def test_nextset(self): con = self._connect() try: cur = con.cursor() - if not hasattr(cur,'nextset'): + if not hasattr(cur, "nextset"): return try: self.executeDDL1(cur) - sql=self._populate() + sql = self._populate() for sql in self._populate(): cur.execute(sql) self.help_nextset_setUp(cur) - cur.callproc('deleteme') - numberofrows=cur.fetchone() - assert numberofrows[0]== len(self.samples) + cur.callproc("deleteme") + numberofrows = cur.fetchone() + assert numberofrows[0] == len(self.samples) assert cur.nextset() - names=cur.fetchall() + names = cur.fetchall() assert len(names) == len(self.samples) - s=cur.nextset() - assert s == None,'No more return sets, should return None' + s = cur.nextset() + assert s == None, "No more return sets, should return None" finally: self.help_nextset_tearDown(cur) @@ -755,16 +758,16 @@ def test_nextset(self): con.close() def test_nextset(self): - raise NotImplementedError('Drivers need to override this test') + raise NotImplementedError("Drivers need to override this test") def test_arraysize(self): # Not much here - rest of the tests for this are in test_fetchmany con = self._connect() try: cur = con.cursor() - self.assertTrue(hasattr(cur,'arraysize'), - 'cursor.arraysize must be defined' - ) + self.assertTrue( + hasattr(cur, "arraysize"), "cursor.arraysize must be defined" + ) finally: con.close() @@ -772,8 +775,8 @@ def test_setinputsizes(self): con = self._connect() try: cur = con.cursor() - cur.setinputsizes( (25,) ) - self._paraminsert(cur) # Make sure cursor still works + cur.setinputsizes((25,)) + self._paraminsert(cur) # Make sure cursor still works finally: con.close() @@ -783,74 +786,68 @@ def test_setoutputsize_basic(self): try: cur = con.cursor() cur.setoutputsize(1000) - cur.setoutputsize(2000,0) - self._paraminsert(cur) # Make sure the cursor still works + cur.setoutputsize(2000, 0) + self._paraminsert(cur) # Make sure the cursor still works finally: con.close() def test_setoutputsize(self): - # Real test for setoutputsize is driver dependant - raise NotImplementedError('Driver need to override this test') + # Real test for setoutputsize is driver dependent + raise NotImplementedError("Driver need to override this test") def test_None(self): con = self._connect() try: cur = con.cursor() self.executeDDL1(cur) - cur.execute('insert into %sbooze values (NULL)' % self.table_prefix) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("insert into %sbooze values (NULL)" % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) r = cur.fetchall() - self.assertEqual(len(r),1) - self.assertEqual(len(r[0]),1) - self.assertEqual(r[0][0],None,'NULL value not returned as None') + self.assertEqual(len(r), 1) + self.assertEqual(len(r[0]), 1) + self.assertEqual(r[0][0], None, "NULL value not returned as None") finally: con.close() def test_Date(self): - d1 = self.driver.Date(2002,12,25) - d2 = self.driver.DateFromTicks(time.mktime((2002,12,25,0,0,0,0,0,0))) + self.driver.Date(2002, 12, 25) + self.driver.DateFromTicks(time.mktime((2002, 12, 25, 0, 0, 0, 0, 0, 0))) # Can we assume this? API doesn't specify, but it seems implied # self.assertEqual(str(d1),str(d2)) def test_Time(self): - t1 = self.driver.Time(13,45,30) - t2 = self.driver.TimeFromTicks(time.mktime((2001,1,1,13,45,30,0,0,0))) + self.driver.Time(13, 45, 30) + self.driver.TimeFromTicks(time.mktime((2001, 1, 1, 13, 45, 30, 0, 0, 0))) # Can we assume this? API doesn't specify, but it seems implied # self.assertEqual(str(t1),str(t2)) def test_Timestamp(self): - t1 = self.driver.Timestamp(2002,12,25,13,45,30) - t2 = self.driver.TimestampFromTicks( - time.mktime((2002,12,25,13,45,30,0,0,0)) - ) + self.driver.Timestamp(2002, 12, 25, 13, 45, 30) + self.driver.TimestampFromTicks(time.mktime((2002, 12, 25, 13, 45, 30, 0, 0, 0))) # Can we assume this? API doesn't specify, but it seems implied # self.assertEqual(str(t1),str(t2)) def test_Binary(self): - b = self.driver.Binary('Something') - b = self.driver.Binary('') + self.driver.Binary(b"Something") + self.driver.Binary(b"") def test_STRING(self): - self.assertTrue(hasattr(self.driver,'STRING'), - 'module.STRING must be defined' - ) + self.assertTrue(hasattr(self.driver, "STRING"), "module.STRING must be defined") def test_BINARY(self): - self.assertTrue(hasattr(self.driver,'BINARY'), - 'module.BINARY must be defined.' - ) + self.assertTrue( + hasattr(self.driver, "BINARY"), "module.BINARY must be defined." + ) def test_NUMBER(self): - self.assertTrue(hasattr(self.driver,'NUMBER'), - 'module.NUMBER must be defined.' - ) + self.assertTrue( + hasattr(self.driver, "NUMBER"), "module.NUMBER must be defined." + ) def test_DATETIME(self): - self.assertTrue(hasattr(self.driver,'DATETIME'), - 'module.DATETIME must be defined.' - ) + self.assertTrue( + hasattr(self.driver, "DATETIME"), "module.DATETIME must be defined." + ) def test_ROWID(self): - self.assertTrue(hasattr(self.driver,'ROWID'), - 'module.ROWID must be defined.' - ) + self.assertTrue(hasattr(self.driver, "ROWID"), "module.ROWID must be defined.") diff --git a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_capabilities.py b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_capabilities.py index 9cacbbd34..6a2894a5a 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_capabilities.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_capabilities.py @@ -1,25 +1,25 @@ -#!/usr/bin/env python from . import capabilities -try: - import unittest2 as unittest -except ImportError: - import unittest import pymysql from pymysql.tests import base import warnings -warnings.filterwarnings('error') +warnings.filterwarnings("error") -class test_MySQLdb(capabilities.DatabaseTest): +class test_MySQLdb(capabilities.DatabaseTest): db_module = pymysql connect_args = () connect_kwargs = base.PyMySQLTestCase.databases[0].copy() - connect_kwargs.update(dict(read_default_file='~/.my.cnf', - use_unicode=True, - charset='utf8', sql_mode="ANSI,STRICT_TRANS_TABLES,TRADITIONAL")) + connect_kwargs.update( + dict( + read_default_file="~/.my.cnf", + use_unicode=True, + binary_prefix=True, + charset="utf8mb4", + sql_mode="ANSI,STRICT_TRANS_TABLES,TRADITIONAL", + ) + ) - create_table_extra = "ENGINE=INNODB CHARACTER SET UTF8" leak_test = False def quote_identifier(self, ident): @@ -27,64 +27,70 @@ def quote_identifier(self, ident): def test_TIME(self): from datetime import timedelta - def generator(row,col): - return timedelta(0, row*8000) - self.check_data_integrity( - ('col1 TIME',), - generator) + + def generator(row, col): + return timedelta(0, row * 8000) + + self.check_data_integrity(("col1 TIME",), generator) def test_TINYINT(self): # Number data - def generator(row,col): - v = (row*row) % 256 + def generator(row, col): + v = (row * row) % 256 if v > 127: - v = v-256 + v = v - 256 return v - self.check_data_integrity( - ('col1 TINYINT',), - generator) + + self.check_data_integrity(("col1 TINYINT",), generator) def test_stored_procedures(self): db = self.connection c = self.cursor try: - self.create_table(('pos INT', 'tree CHAR(20)')) - c.executemany("INSERT INTO %s (pos,tree) VALUES (%%s,%%s)" % self.table, - list(enumerate('ash birch cedar larch pine'.split()))) + self.create_table(("pos INT", "tree CHAR(20)")) + c.executemany( + "INSERT INTO %s (pos,tree) VALUES (%%s,%%s)" % self.table, + list(enumerate("ash birch cedar larch pine".split())), + ) db.commit() - c.execute(""" + c.execute( + """ CREATE PROCEDURE test_sp(IN t VARCHAR(255)) BEGIN SELECT pos FROM %s WHERE tree = t; END - """ % self.table) + """ + % self.table + ) db.commit() - c.callproc('test_sp', ('larch',)) + c.callproc("test_sp", ("larch",)) rows = c.fetchall() self.assertEqual(len(rows), 1) self.assertEqual(rows[0][0], 3) c.nextset() finally: c.execute("DROP PROCEDURE IF EXISTS test_sp") - c.execute('drop table %s' % (self.table)) + c.execute("drop table %s" % (self.table)) def test_small_CHAR(self): # Character data - def generator(row,col): - i = ((row+1)*(col+1)+62)%256 - if i == 62: return '' - if i == 63: return None + def generator(row, col): + i = ((row + 1) * (col + 1) + 62) % 256 + if i == 62: + return "" + if i == 63: + return None return chr(i) - self.check_data_integrity( - ('col1 char(1)','col2 char(1)'), - generator) + + self.check_data_integrity(("col1 char(1)", "col2 char(1)"), generator) def test_bug_2671682(self): from pymysql.constants import ER + try: - self.cursor.execute("describe some_non_existent_table"); + self.cursor.execute("describe some_non_existent_table") except self.connection.ProgrammingError as msg: self.assertEqual(msg.args[0], ER.NO_SUCH_TABLE) @@ -95,15 +101,7 @@ def test_literal_int(self): self.assertTrue("2" == self.connection.literal(2)) def test_literal_float(self): - self.assertTrue("3.1415" == self.connection.literal(3.1415)) + self.assertEqual("3.1415e0", self.connection.literal(3.1415)) def test_literal_string(self): self.assertTrue("'foo'" == self.connection.literal("foo")) - - -if __name__ == '__main__': - if test_MySQLdb.leak_test: - import gc - gc.enable() - gc.set_debug(gc.DEBUG_LEAK) - unittest.main() diff --git a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_dbapi20.py b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_dbapi20.py index ca430fd0e..5c34d40d1 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_dbapi20.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_dbapi20.py @@ -1,25 +1,25 @@ -#!/usr/bin/env python from . import dbapi20 import pymysql from pymysql.tests import base -try: - import unittest2 as unittest -except ImportError: - import unittest - class test_MySQLdb(dbapi20.DatabaseAPI20Test): driver = pymysql connect_args = () connect_kw_args = base.PyMySQLTestCase.databases[0].copy() - connect_kw_args.update(dict(read_default_file='~/.my.cnf', - charset='utf8', - sql_mode="ANSI,STRICT_TRANS_TABLES,TRADITIONAL")) + connect_kw_args.update( + dict( + read_default_file="~/.my.cnf", + charset="utf8", + sql_mode="ANSI,STRICT_TRANS_TABLES,TRADITIONAL", + ) + ) + + def test_setoutputsize(self): + pass - def test_setoutputsize(self): pass - def test_setoutputsize_basic(self): pass - def test_nextset(self): pass + def test_setoutputsize_basic(self): + pass """The tests on fetchone and fetchall and rowcount bogusly test for an exception if the statement cannot return a @@ -41,36 +41,41 @@ def test_fetchall(self): # cursor.fetchall should raise an Error if called # after executing a a statement that cannot return rows -## self.assertRaises(self.driver.Error,cur.fetchall) + ## self.assertRaises(self.driver.Error,cur.fetchall) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) rows = cur.fetchall() - self.assertTrue(cur.rowcount in (-1,len(self.samples))) - self.assertEqual(len(rows),len(self.samples), - 'cursor.fetchall did not retrieve all rows' - ) + self.assertTrue(cur.rowcount in (-1, len(self.samples))) + self.assertEqual( + len(rows), + len(self.samples), + "cursor.fetchall did not retrieve all rows", + ) rows = [r[0] for r in rows] rows.sort() - for i in range(0,len(self.samples)): - self.assertEqual(rows[i],self.samples[i], - 'cursor.fetchall retrieved incorrect rows' + for i in range(0, len(self.samples)): + self.assertEqual( + rows[i], self.samples[i], "cursor.fetchall retrieved incorrect rows" ) rows = cur.fetchall() self.assertEqual( - len(rows),0, - 'cursor.fetchall should return an empty list if called ' - 'after the whole result set has been fetched' - ) - self.assertTrue(cur.rowcount in (-1,len(self.samples))) + len(rows), + 0, + "cursor.fetchall should return an empty list if called " + "after the whole result set has been fetched", + ) + self.assertTrue(cur.rowcount in (-1, len(self.samples))) self.executeDDL2(cur) - cur.execute('select name from %sbarflys' % self.table_prefix) + cur.execute("select name from %sbarflys" % self.table_prefix) rows = cur.fetchall() - self.assertTrue(cur.rowcount in (-1,0)) - self.assertEqual(len(rows),0, - 'cursor.fetchall should return an empty list if ' - 'a select query returns no rows' - ) + self.assertTrue(cur.rowcount in (-1, 0)) + self.assertEqual( + len(rows), + 0, + "cursor.fetchall should return an empty list if " + "a select query returns no rows", + ) finally: con.close() @@ -82,39 +87,40 @@ def test_fetchone(self): # cursor.fetchone should raise an Error if called before # executing a select-type query - self.assertRaises(self.driver.Error,cur.fetchone) + self.assertRaises(self.driver.Error, cur.fetchone) # cursor.fetchone should raise an Error if called after - # executing a query that cannnot return rows + # executing a query that cannot return rows self.executeDDL1(cur) -## self.assertRaises(self.driver.Error,cur.fetchone) + ## self.assertRaises(self.driver.Error,cur.fetchone) - cur.execute('select name from %sbooze' % self.table_prefix) - self.assertEqual(cur.fetchone(),None, - 'cursor.fetchone should return None if a query retrieves ' - 'no rows' - ) - self.assertTrue(cur.rowcount in (-1,0)) + cur.execute("select name from %sbooze" % self.table_prefix) + self.assertEqual( + cur.fetchone(), + None, + "cursor.fetchone should return None if a query retrieves no rows", + ) + self.assertTrue(cur.rowcount in (-1, 0)) # cursor.fetchone should raise an Error if called after - # executing a query that cannnot return rows - cur.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) -## self.assertRaises(self.driver.Error,cur.fetchone) + # executing a query that cannot return rows + cur.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) + ## self.assertRaises(self.driver.Error,cur.fetchone) - cur.execute('select name from %sbooze' % self.table_prefix) + cur.execute("select name from %sbooze" % self.table_prefix) r = cur.fetchone() - self.assertEqual(len(r),1, - 'cursor.fetchone should have retrieved a single row' - ) - self.assertEqual(r[0],'Victoria Bitter', - 'cursor.fetchone retrieved incorrect data' - ) -## self.assertEqual(cur.fetchone(),None, -## 'cursor.fetchone should return None if no more rows available' -## ) - self.assertTrue(cur.rowcount in (-1,1)) + self.assertEqual( + len(r), 1, "cursor.fetchone should have retrieved a single row" + ) + self.assertEqual( + r[0], "Victoria Bitter", "cursor.fetchone retrieved incorrect data" + ) + ## self.assertEqual(cur.fetchone(),None, + ## 'cursor.fetchone should return None if no more rows available' + ## ) + self.assertTrue(cur.rowcount in (-1, 1)) finally: con.close() @@ -124,87 +130,86 @@ def test_rowcount(self): try: cur = con.cursor() self.executeDDL1(cur) -## self.assertEqual(cur.rowcount,-1, -## 'cursor.rowcount should be -1 after executing no-result ' -## 'statements' -## ) - cur.execute("insert into %sbooze values ('Victoria Bitter')" % ( - self.table_prefix - )) -## self.assertTrue(cur.rowcount in (-1,1), -## 'cursor.rowcount should == number or rows inserted, or ' -## 'set to -1 after executing an insert statement' -## ) + ## self.assertEqual(cur.rowcount,-1, + ## 'cursor.rowcount should be -1 after executing no-result ' + ## 'statements' + ## ) + cur.execute( + "insert into %sbooze values ('Victoria Bitter')" % (self.table_prefix) + ) + ## self.assertTrue(cur.rowcount in (-1,1), + ## 'cursor.rowcount should == number or rows inserted, or ' + ## 'set to -1 after executing an insert statement' + ## ) cur.execute("select name from %sbooze" % self.table_prefix) - self.assertTrue(cur.rowcount in (-1,1), - 'cursor.rowcount should == number of rows returned, or ' - 'set to -1 after executing a select statement' - ) + self.assertTrue( + cur.rowcount in (-1, 1), + "cursor.rowcount should == number of rows returned, or " + "set to -1 after executing a select statement", + ) self.executeDDL2(cur) -## self.assertEqual(cur.rowcount,-1, -## 'cursor.rowcount not being reset to -1 after executing ' -## 'no-result statements' -## ) + ## self.assertEqual(cur.rowcount,-1, + ## 'cursor.rowcount not being reset to -1 after executing ' + ## 'no-result statements' + ## ) finally: con.close() def test_callproc(self): - pass # performed in test_MySQL_capabilities - - def help_nextset_setUp(self,cur): - ''' Should create a procedure called deleteme - that returns two result sets, first the - number of rows in booze then "name from booze" - ''' - sql=""" + pass # performed in test_MySQL_capabilities + + def help_nextset_setUp(self, cur): + """Should create a procedure called deleteme + that returns two result sets, first the + number of rows in booze then "name from booze" + """ + sql = """ create procedure deleteme() begin select count(*) from %(tp)sbooze; select name from %(tp)sbooze; end - """ % dict(tp=self.table_prefix) + """ % dict( + tp=self.table_prefix + ) cur.execute(sql) - def help_nextset_tearDown(self,cur): - 'If cleaning up is needed after nextSetTest' + def help_nextset_tearDown(self, cur): + "If cleaning up is needed after nextSetTest" cur.execute("drop procedure deleteme") def test_nextset(self): - from warnings import warn con = self._connect() try: cur = con.cursor() - if not hasattr(cur,'nextset'): + if not hasattr(cur, "nextset"): return try: self.executeDDL1(cur) - sql=self._populate() + sql = self._populate() for sql in self._populate(): cur.execute(sql) self.help_nextset_setUp(cur) - cur.callproc('deleteme') - numberofrows=cur.fetchone() - assert numberofrows[0]== len(self.samples) + cur.callproc("deleteme") + numberofrows = cur.fetchone() + assert numberofrows[0] == len(self.samples) assert cur.nextset() - names=cur.fetchall() + names = cur.fetchall() assert len(names) == len(self.samples) - s=cur.nextset() + s = cur.nextset() if s: empty = cur.fetchall() - self.assertEqual(len(empty), 0, - "non-empty result set after other result sets") - #warn("Incompatibility: MySQL returns an empty result set for the CALL itself", + self.assertEqual( + len(empty), 0, "non-empty result set after other result sets" + ) + # warn("Incompatibility: MySQL returns an empty result set for the CALL itself", # Warning) - #assert s == None,'No more return sets, should return None' + # assert s == None,'No more return sets, should return None' finally: self.help_nextset_tearDown(cur) finally: con.close() - - -if __name__ == '__main__': - unittest.main() diff --git a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_nonstandard.py b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_nonstandard.py index 17fc2cde5..1545fbb5e 100644 --- a/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_nonstandard.py +++ b/pymysql/tests/thirdparty/test_MySQLdb/test_MySQLdb_nonstandard.py @@ -1,17 +1,10 @@ -import sys -try: - import unittest2 as unittest -except ImportError: - import unittest +import unittest import pymysql + _mysql = pymysql from pymysql.constants import FIELD_TYPE from pymysql.tests import base -from pymysql._compat import PY2, long_type - -if not PY2: - basestring = str class TestDBAPISet(unittest.TestCase): @@ -33,17 +26,17 @@ class CoreModule(unittest.TestCase): def test_NULL(self): """Should have a NULL constant.""" - self.assertEqual(_mysql.NULL, 'NULL') + self.assertEqual(_mysql.NULL, "NULL") def test_version(self): """Version information sanity.""" - self.assertTrue(isinstance(_mysql.__version__, basestring)) + self.assertTrue(isinstance(_mysql.__version__, str)) self.assertTrue(isinstance(_mysql.version_info, tuple)) self.assertEqual(len(_mysql.version_info), 5) def test_client_info(self): - self.assertTrue(isinstance(_mysql.get_client_info(), basestring)) + self.assertTrue(isinstance(_mysql.get_client_info(), str)) def test_thread_safe(self): self.assertTrue(isinstance(_mysql.thread_safe(), int)) @@ -62,40 +55,45 @@ def tearDown(self): def test_thread_id(self): tid = self.conn.thread_id() - self.assertTrue(isinstance(tid, (int, long_type)), - "thread_id didn't return an integral value.") + self.assertTrue( + isinstance(tid, int), "thread_id didn't return an integral value." + ) - self.assertRaises(TypeError, self.conn.thread_id, ('evil',), - "thread_id shouldn't accept arguments.") + self.assertRaises( + TypeError, + self.conn.thread_id, + ("evil",), + "thread_id shouldn't accept arguments.", + ) def test_affected_rows(self): - self.assertEqual(self.conn.affected_rows(), 0, - "Should return 0 before we do anything.") + self.assertEqual( + self.conn.affected_rows(), 0, "Should return 0 before we do anything." + ) - - #def test_debug(self): - ## FIXME Only actually tests if you lack SUPER - #self.assertRaises(pymysql.OperationalError, - #self.conn.dump_debug_info) + # def test_debug(self): + ## FIXME Only actually tests if you lack SUPER + # self.assertRaises(pymysql.OperationalError, + # self.conn.dump_debug_info) def test_charset_name(self): - self.assertTrue(isinstance(self.conn.character_set_name(), basestring), - "Should return a string.") + self.assertTrue( + isinstance(self.conn.character_set_name(), str), "Should return a string." + ) def test_host_info(self): - assert isinstance(self.conn.get_host_info(), basestring), "should return a string" + assert isinstance(self.conn.get_host_info(), str), "should return a string" def test_proto_info(self): - self.assertTrue(isinstance(self.conn.get_proto_info(), int), - "Should return an int.") + self.assertTrue( + isinstance(self.conn.get_proto_info(), int), "Should return an int." + ) def test_server_info(self): - if sys.version_info[0] == 2: - self.assertTrue(isinstance(self.conn.get_server_info(), basestring), - "Should return an str.") - else: - self.assertTrue(isinstance(self.conn.get_server_info(), basestring), - "Should return an str.") + self.assertTrue( + isinstance(self.conn.get_server_info(), str), "Should return an str." + ) + if __name__ == "__main__": unittest.main() diff --git a/pymysql/times.py b/pymysql/times.py index c47db09eb..4497dacf6 100644 --- a/pymysql/times.py +++ b/pymysql/times.py @@ -1,16 +1,20 @@ from time import localtime from datetime import date, datetime, time, timedelta + Date = date Time = time TimeDelta = timedelta Timestamp = datetime + def DateFromTicks(ticks): return date(*localtime(ticks)[:3]) + def TimeFromTicks(ticks): return time(*localtime(ticks)[3:6]) + def TimestampFromTicks(ticks): return datetime(*localtime(ticks)[:6]) diff --git a/pymysql/util.py b/pymysql/util.py deleted file mode 100644 index cc622e57b..000000000 --- a/pymysql/util.py +++ /dev/null @@ -1,19 +0,0 @@ -import struct - -def byte2int(b): - if isinstance(b, int): - return b - else: - return struct.unpack("!B", b)[0] - -def int2byte(i): - return struct.pack("!B", i) - -def join_bytes(bs): - if len(bs) == 0: - return "" - else: - rv = bs[0] - for b in bs[1:]: - rv += b - return rv diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 000000000..d5057982f --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,59 @@ +[project] +name = "PyMySQL" +description = "Pure Python MySQL Driver" +authors = [ + {name = "Inada Naoki", email = "songofacandy@gmail.com"}, + {name = "Yutaka Matsubara", email = "yutaka.matsubara@gmail.com"} +] +dependencies = [] + +requires-python = ">=3.8" +readme = "README.md" +license = "MIT" +keywords = ["MySQL"] +classifiers = [ + "Development Status :: 5 - Production/Stable", + "Programming Language :: Python :: Implementation :: CPython", + "Programming Language :: Python :: Implementation :: PyPy", + "Intended Audience :: Developers", + "Topic :: Database", +] +dynamic = ["version"] + +[project.optional-dependencies] +"rsa" = [ + "cryptography" +] +"ed25519" = [ + "PyNaCl>=1.4.0" +] + +[project.urls] +"Project" = "https://github.com/PyMySQL/PyMySQL" +"Documentation" = "https://pymysql.readthedocs.io/" +"Changelog" = "https://github.com/PyMySQL/PyMySQL/blob/main/CHANGELOG.md" + +[build-system] +requires = ["setuptools>=77"] +build-backend = "setuptools.build_meta" + +[tool.setuptools.packages.find] +namespaces = false +include = ["pymysql*"] +exclude = ["tests*", "pymysql.tests*"] + +[tool.setuptools.dynamic] +version = {attr = "pymysql.VERSION_STRING"} + +[tool.ruff] +exclude = [ + "pymysql/tests/thirdparty", +] + +[tool.ruff.lint] +ignore = ["E721"] + +[tool.pdm.dev-dependencies] +dev = [ + "pytest-cov>=4.0.0", +] diff --git a/renovate.json b/renovate.json new file mode 100644 index 000000000..09e16da6b --- /dev/null +++ b/renovate.json @@ -0,0 +1,7 @@ +{ + "$schema": "https://docs.renovatebot.com/renovate-schema.json", + "extends": [ + "config:base" + ], + "dependencyDashboard": false +} diff --git a/requirements-dev.txt b/requirements-dev.txt new file mode 100644 index 000000000..140d37067 --- /dev/null +++ b/requirements-dev.txt @@ -0,0 +1,4 @@ +cryptography +PyNaCl>=1.4.0 +pytest +pytest-cov diff --git a/runtests.py b/runtests.py deleted file mode 100755 index 367e6ac2b..000000000 --- a/runtests.py +++ /dev/null @@ -1,26 +0,0 @@ -#!/usr/bin/env python -import unittest2 - -from pymysql._compat import PYPY, JYTHON, IRONPYTHON - -if not (PYPY or JYTHON or IRONPYTHON): - import atexit - import gc - gc.set_debug(gc.DEBUG_UNCOLLECTABLE) - - @atexit.register - def report_uncollectable(): - if not gc.garbage: - print("No garbages!") - return - print('uncollectable objects') - for obj in gc.garbage: - print(obj) - if hasattr(obj, '__dict__'): - print(obj.__dict__) - for ref in gc.get_referrers(obj): - print("referrer:", ref) - print('---') - -import pymysql.tests -unittest2.main(pymysql.tests, verbosity=2) diff --git a/setup.cfg b/setup.cfg deleted file mode 100644 index 992ddaba1..000000000 --- a/setup.cfg +++ /dev/null @@ -1,7 +0,0 @@ -[wheel] -universal = 1 - -[flake8] -ignore = E226,E301,E701 -exclude = tests,build -max-line-length = 99 diff --git a/setup.py b/setup.py deleted file mode 100755 index 92873a164..000000000 --- a/setup.py +++ /dev/null @@ -1,37 +0,0 @@ -#!/usr/bin/env python -from setuptools import setup, find_packages - -version_tuple = __import__('pymysql').VERSION - -if version_tuple[3] is not None: - version = "%d.%d.%d_%s" % version_tuple -else: - version = "%d.%d.%d" % version_tuple[:3] - -setup( - name="PyMySQL", - version=version, - url='https://github.com/PyMySQL/PyMySQL/', - author='yutaka.matsubara', - author_email='yutaka.matsubara@gmail.com', - maintainer='INADA Naoki', - maintainer_email='songofacandy@gmail.com', - description='Pure-Python MySQL Driver', - license="MIT", - packages=find_packages(), - classifiers=[ - 'Programming Language :: Python :: 2', - 'Programming Language :: Python :: 2.6', - 'Programming Language :: Python :: 2.7', - 'Programming Language :: Python :: 3', - 'Programming Language :: Python :: 3.3', - 'Programming Language :: Python :: 3.4', - 'Programming Language :: Python :: 3.5', - 'Programming Language :: Python :: Implementation :: CPython', - 'Programming Language :: Python :: Implementation :: PyPy', - 'Development Status :: 4 - Beta', - 'Intended Audience :: Developers', - 'License :: OSI Approved :: MIT License', - 'Topic :: Database', - ] -) diff --git a/tests/__init__.py b/tests/__init__.py new file mode 100644 index 000000000..e69de29bb diff --git a/tests/test_auth.py b/tests/test_auth.py new file mode 100644 index 000000000..d7a0e82fc --- /dev/null +++ b/tests/test_auth.py @@ -0,0 +1,120 @@ +"""Test for auth methods supported by MySQL 8""" + +import os +import pymysql + +# pymysql.connections.DEBUG = True +# pymysql._auth.DEBUG = True + +host = "127.0.0.1" +port = 3306 + +ca = os.path.expanduser("~/ca.pem") +ssl = {"ca": ca, "check_hostname": False} + +pass_sha256 = "pass_sha256_01234567890123456789" +pass_caching_sha2 = "pass_caching_sha2_01234567890123456789" + + +def test_sha256_no_password(): + con = pymysql.connect(user="nopass_sha256", host=host, port=port, ssl=None) + con.close() + + +def test_sha256_no_passowrd_ssl(): + con = pymysql.connect(user="nopass_sha256", host=host, port=port, ssl=ssl) + con.close() + + +def test_sha256_password(): + con = pymysql.connect( + user="user_sha256", password=pass_sha256, host=host, port=port, ssl=None + ) + con.close() + + +def test_sha256_password_ssl(): + con = pymysql.connect( + user="user_sha256", password=pass_sha256, host=host, port=port, ssl=ssl + ) + con.close() + + +def test_caching_sha2_no_password(): + con = pymysql.connect(user="nopass_caching_sha2", host=host, port=port, ssl=None) + con.close() + + +def test_caching_sha2_no_password_ssl(): + con = pymysql.connect(user="nopass_caching_sha2", host=host, port=port, ssl=ssl) + con.close() + + +def test_caching_sha2_password(): + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=None, + ) + con.close() + + # Fast path of caching sha2 + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=None, + ) + con.query("FLUSH PRIVILEGES") + con.close() + + # Fast path after auth_switch_request + pymysql.connections._DEFAULT_AUTH_PLUGIN = "mysql_native_password" + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=ssl, + ) + con.query("FLUSH PRIVILEGES") + con.close() + pymysql.connections._DEFAULT_AUTH_PLUGIN = None + + +def test_caching_sha2_password_ssl(): + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=ssl, + ) + con.close() + + # Fast path of caching sha2 + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=ssl, + ) + con.query("FLUSH PRIVILEGES") + con.close() + + # Fast path after auth_switch_request + pymysql.connections._DEFAULT_AUTH_PLUGIN = "mysql_native_password" + con = pymysql.connect( + user="user_caching_sha2", + password=pass_caching_sha2, + host=host, + port=port, + ssl=ssl, + ) + con.query("FLUSH PRIVILEGES") + con.close() + pymysql.connections._DEFAULT_AUTH_PLUGIN = None diff --git a/tox.ini b/tox.ini deleted file mode 100644 index dd67cd4c7..000000000 --- a/tox.ini +++ /dev/null @@ -1,7 +0,0 @@ -[tox] -envlist = py26,py27,py33,py34,pypy,pypy3 - -[testenv] -commands = coverage run ./runtests.py -deps = unittest2 - coverage